元器件型号 | 厂商 | 描述 | 封装14 # | 数量 asia | 价格 (usd) | ||||
---|---|---|---|---|---|---|---|---|---|
60178-511 00 | 3m | terminal block, idc, 4way | 1637141 | 0 |
|
||||
1100 | 3m | foam ear plugs bx 200 | 1569396 | 46 |
|
||||
2211100 | 3m | tape, masking, 100mm | 1495711 | 4 |
|
||||
81100-600203rb | 3m | header, straight, 100way | 1224899 | 34 |
|
||||
89110-0001 | 3m | wire-board conn, socket, 10pos, 2.54mm | 1296146 | 131 |
|
||||
d89110-0031hk | 3m | wire-board conn, socket, 10pos, 2.54mm | 1788709 | 260 |
|
||||
d89110-0131hk | 3m | wire-board conn, socket, 10pos, 2.54mm | 1788710 | 1448 |
|
||||
3759-34 | 3m | ribbon cable, 34way, 30.5m | 8611009 | 5 |
|
||||
62c64-1100ec. | 3m | socket, female, 26 & 28 american wire ga | 4602328 | 97 |
|
||||
62c64-1100ec | 3m | socket, idc, din41612, 64way | 9359974 | 145 |
|
||||
89110-0101. | 3m | preassembled wiremount socket, 10 contac | 1854770 | 6205 |
|
||||
158106-1100 | 3m | socket, 2mm, idc, 6way | 1892410 | 403 |
|
||||
158108-1100 | 3m | socket, 2mm, idc, 8way | 1892412 | 318 |
|
||||
158110-1100 | 3m | socket, 2mm, idc, 10way | 1892413 | 377 |
|
||||
158120-1100 | 3m | socket, 2mm, idc, 20way | 1892414 | 0 |
|
||||
158140-1100 | 3m | socket, 2mm, idc, 40way | 1892415 | 0 |
|
||||
158144-1100 | 3m | socket, 2mm, idc, 44way | 1892416 | 0 |
|
||||
158150-1100 | 3m | socket, 2mm, idc, 50way | 1892417 | 251 |
|
||||
89110-0103 | 3m | header connector,cable mount,plug,10 contacts,skt,0.1 pitch,idc terminal | 1908401 | 1000 |
|
||||
89110-0101ha | 3m | socket, idc, bump & clip, 10way | 3003577 | 7779 |
|
||||
501100b00000g | aavid thermalloy | heat sink | 1332468 | 3048 |
|
||||
abw1 100r | ab (potentiometers) | potentiometer, 100r | 1219018 | 172 |
|
||||
ps1-3-1-100 | abb control | busbar,3mms+1aux,3ph,100a | 1846284 | 3 |
|
||||
ps1-4-1-100 | abb control | busbar,4mms+1aux,3ph,100a | 1846285 | 3 |
|
||||
ps1-5-1-100 | abb control | busbar,5mms+1aux,3ph,100a | 1846286 | 3 |
|
||||
1svr011714r1100 | abb control | converter, analog, 0-0.02a/0-0.02a | 1895974 | 1 |
|
||||
asdm1-100.000mhz-lc-t | abracon | mems oscillator, 100mhz, smd | 1633544 | 155 |
|
||||
asem1-100.000mhz-lc-t | abracon | mems oscillator, 100mhz, smd | 1633603 | 71 |
|
||||
asflm1-10.000mhz-l-c-t | abracon | mems oscillator, 10mhz, smd | 1633631 | 492 |
|
||||
aocjy1-100.000mhz | abracon | oscillator, ocxo, 100mhz, through hole | 1885669 | 4 |
|
||||
aocjy1-10.000mhz | abracon | oscillator, ocxo, 10mhz, through hole | 1885667 | 1 |
|
||||
ac-1100 | acme electric | current sense transformer | 1707847 | 14 |
|
||||
sg-1100-arm2-434 | aei security | alarm, wireless | 8305528 | 18 |
|
||||
r11-61-1.00a-w06-ch-v | airpax | magnetic hydraulic circuit breaker, 1, 1a | 1866776 | 34 |
|
||||
1551-100 brn. | alpha wire | hook-up wire conductor size awg:22 | 1257985 | 5 |
|
||||
3071-100 blk. | alpha wire | hook-up wire conductor size awg:22 | 1269859 | 1 |
|
||||
1771 100 blk | alpha wire | 1771 black 100 ft | 3052448 | 1 |
|
||||
spec121100 | alps | switch, 2pole, latching | 1123866 | 1099 |
|
||||
120a1-100sst1a | amperite | time delay relay spst-no, 100sec, 120vac | 1091590 | 1 |
|
||||
120a1-100mst1a | amperite | time delay relay spst-no, 100min, 120vac | 1093619 | 4 |
|
||||
120a1-100mstb | amperite | time delay relay spst-no, 100min, 120vac | 1655842 | 2 |
|
||||
12d1-100mstb | amperite | time delay relay, spst-no, 100min, 12vdc | 1531733 | 1 |
|
||||
120a1-100sst2 | amperite | time delay relay spst-no, 100sec, 120vac | 4692548 | 24 |
|
||||
12d1-100sst2 | amperite | time delay relay, spst-no, 100sec, 12vdc | 4692512 | 1 |
|
||||
120a1-100sstb | amperite | time delay relay spst-no, 100sec, 120vac | 4692536 | 19 |
|
||||
12d1-100sstb | amperite | time delay relay, spst-no, 100sec, 12vdc | 4693152 | 26 |
|
||||
120a1-100sst1 | amperite | time delay relay spst-no, 100sec, 120vac | 4693190 | 2 |
|
||||
lusb-a111-00 | amphenol | receptacle, usb, a, posilock | 1792487 | 93 |
|
||||
ms3106a28-12py | amphenol | connector, circular, size 28, 26way | 1481100 | 241 |
|
||||
c016g11000e10v | amphenol | ecomate mixed bodies, pk5 | 1520094 | 84 |
|
||||
aia-5003-11-00-00-10-aa-04 | amphenol | backshell, straight, size 11 | 1281656 | 49 |
|
||||
aia-5003-11-00-90-10-aa-04 | amphenol | backshell, right angle, size 11 | 1281660 | 14 |
|
||||
aia-5001-10-00-00-10-aa-04 | amphenol | backshell, 62gb, size 10 | 3912103 | 96 |
|
||||
l17rrd1f01100 | amphenol | crimp contact, skt, dsub, 20-24awg | 1849886 | 8 |
|
||||
musb-a511-00 | amphenol | usb, rugged, type a, musb | 1849907 | 60 |
|
||||
842-800-1211-002 | amphenol commercial products | polarizing key, 812 series idc conn | 1023823 | 626 |
|
||||
l17rrd2f01100 | amphenol commercial products | d sub contact, socket, 28-24awg, crimp | 1614136 | 4250 |
|
||||
l17rrd2m01100 | amphenol commercial products | d sub contact, pin, 28-24awg, crimp | 1456716 | 22 |
|
||||
musba51100 | amphenol commercial products | socket, usb, type a, pcb | 1860545 | 43 |
|
||||
musbc51100 | amphenol commercial products | socket, 2x usb, type a, pcb | 1860553 | 26 |
|
||||
musbd51100 | amphenol commercial products | socket, usb, type b, pcb | 1860556 | 37 |
|
||||
musb2d11004bp | amphenol commercial products | dust cap, usb type b, grey | 1860560 | 4 |
|
||||
135110-01-06.00 | amphenol connex | coaxial cable assy, rg-316, 6in, black | 1778155 | 23 |
|
||||
135110-01-12.00 | amphenol connex | coaxial cable assy, rg-316, 12in, black | 1778156 | 20 |
|
||||
135110-01-24.00 | amphenol connex | coaxial cable assy, rg-316, 24in, black | 1778157 | 3 |
|
||||
135110-01-36.00 | amphenol connex | coaxial cable assy, rg-316, 36in, black | 1776805 | 10 |
|
||||
135110-02-06.00 | amphenol connex | coaxial cable assy, rg-174, 6in, black | 1776806 | 10 |
|
||||
135110-02-12.00 | amphenol connex | coaxial cable assy, rg-174, 12in, black | 1776807 | 5 |
|
||||
135110-02-24.00 | amphenol connex | coaxial cable assy, rg-174, 24in, black | 1776808 | 1 |
|
||||
135110-02-36.00 | amphenol connex | coaxial cable assy, rg-174, 36in, black | 1776809 | 10 |
|
||||
135110-03-12.00 | amphenol connex | coaxial cable assy, rg-316, 12in, black | 1776811 | 5 |
|
||||
135110-03-24.00 | amphenol connex | coaxial cable assy, rg-316, 24in, black | 1776813 | 18 |
|
||||
135110-03-36.00 | amphenol connex | coaxial cable assy, rg-316, 36in, black | 1776814 | 12 |
|
||||
135110-04-12.00 | amphenol connex | coaxial cable assy, rg-58, 12in, black | 1776816 | 17 |
|
||||
135110-04-36.00 | amphenol connex | coaxial cable assy, rg-58, 36in, black | 1776818 | 10 |
|
||||
135110-04-48.00 | amphenol connex | coaxial cable assy, rg-58, 48in, black | 1776819 | 25 |
|
||||
172129 | amphenol connex | rf/coaxial, n bhd jack, str, 50ohm crimp | 5811004 | 1977 |
|
||||
255110-01-06.00 | amphenol connex | coaxial cable assy, rg316, 6in, black | 1872866 | 23 |
|
||||
255110-01-12.00 | amphenol connex | coaxial cable assy, rg316, 12in, black | 1872867 | 28 |
|
||||
255110-01-24.00 | amphenol connex | coaxial cable assy, rg316, 24in, black | 1872868 | 28 |
|
||||
255110-01-36.00 | amphenol connex | coaxial cable assy, rg316, 36in, black | 1872869 | 11 |
|
||||
l17rrd1m01100 | amphenol industrial | d sub contact, pin, 24-20awg, crimp | 1530881 | 22 |
|
||||
d38999/24wg75sc | amphenol industrial | connector, circ, 21-75, 4way, size 21 | 1591100 | 8 |
|
||||
901-10097 | amphenol rf | bulkhead adapter, amc jack-sma jack | 1273128 | 1 |
|
||||
901-10019b | amphenol rf | rf/coaxial, sma jack, str, 50ohm, solder | 1792071 | 5 |
|
||||
901-10025-rfx | amphenol rf | rf/coaxial, sma plug, str, 50ohm, crimp | 1792104 | 93 |
|
||||
901-10028-rfx | amphenol rf | rf/coaxial, sma plug, r/a, 50ohm, crimp | 1792105 | 70 |
|
||||
31-321-1000 | amphenol rf | rf/coaxial, bnc plug, str, 50ohm, crimp | 1310501 | 135 |
|
||||
901-10003 | amphenol rf | rf/coaxial connector | 1241789 | 6 |
|
||||
91100 (ug-30d/u) | amphenol rf | bulkhead adapter, n jack-n jack | 1199854 | 90 |
|
||||
901-10007 | amphenol rf | rf/coaxial adapter sma plug-1.0/2.3 plug | 4787365 | 75 |
|
||||
adum1100arz | analog devices | high speed digital isolator, smd | 1226206 | 727 |
|
||||
adum1100brz | analog devices | high speed digital isolator, smd | 1226207 | 638 |
|
||||
adm1485anz | analog devices | ic, rs-485 transceiver, 5.25v, dip-8 | 1311007 | 190 |
|
||||
ad698apz | analog devices | ic, lvdt signal cond, 20khz, 0.05% lcc28 | 1311008 | 788 |
|
||||
ad823arz | analog devices | ic, op-amp, 16mhz, 25v/s, soic-8 | 1311009 | 1073 |
|
||||
and5ga | and optoelectronics | led, 1.8mm, green, 125mcd, 571nm | 1100373 | 410 |
|
||||
and190hrp | and optoelectronics | led, t-3, red, 10000mcd, 631nm | 1100282 | 247 |
|
||||
and5ra | and optoelectronics | led, 1.8mm, red, 480mcd, 643nm | 1100336 | 236 |
|
||||
and5ya | and optoelectronics | led, 1.8mm, yellow, 625mcd, 589nm | 1100361 | 992 |
|
元器件型号 | 厂商 | 描述 | newark # | 数量 | 价格 | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
901-10006 | amphenol rf | rf/coaxial adapter sma jack-1.0/2.3 plug, each | 01c0679 | 0 |
|
||||||||||||||||||
refk1907024cg1 | hammond | cabinet rack, 19in, 21.34in, 40u, each | 01f1100 | 3 |
|
||||||||||||||||||
908-21100 | amphenol rf | rf/coaxial, mmcx plug, str, 50ohm solder, each | 01f2402 | 0 |
|
||||||||||||||||||
3005p-1-100 | bourns | trimmer, potentiometer 10ohm 20turn thd, each | 01f8457 | 95 |
|
||||||||||||||||||
3250w-1-100 | bourns | trimmer, potentiometer 10ohm 25turn thd, each | 01f9166 | 106 |
|
||||||||||||||||||
musb-a511-00 | amphenol commercial products | mini usb type a connector, rcpt 4pos thd, each | 01m6103 | 48 |
|
||||||||||||||||||
08611.0-00 | stego | multi-purpose protective cover, each | 01m9713 | 0 |
|
||||||||||||||||||
ej511-0010-mm | black box | rca audio/video cable, 10ft, each | 02c0191 | 14 |
|
||||||||||||||||||
ej511-0015-mf | black box | delux a/v cable m to f 15ft., each | 02c0192 | 1 |
|
||||||||||||||||||
ej511-0025-mm | black box | delux a/v cable m to m 25ft., each | 02c0195 | 41 |
|
||||||||||||||||||
evn1100-0007 | black box | patch cable, cat5e, 7ft, each | 02c0956 | 157 |
|
||||||||||||||||||
8918 001100 | belden | hook-up wire, 100ft, 18awg cu, brown, spool of 100 | 02f4363 | 6 |
|
||||||||||||||||||
8918 0011000 | belden | hook-up wire, 1000ft, 18awg cu brown, spool of 1000 | 02f4371 | 0 |
|
||||||||||||||||||
8917 001100 | belden | hook-up wire, 100ft, 16awg cu, brown, spool of 100 | 02f4385 | 4 |
|
||||||||||||||||||
8916 001100 | belden | hook-up wire, 100ft, 14awg cu, brown, spool of 100 | 02f4414 | 12 |
|
||||||||||||||||||
8501 001100 | belden | hook-up wire, 100ft, 18awg cu, brown, spool of 100 | 02f4458 | 5 |
|
||||||||||||||||||
8501 0211000 | belden | hook-up wire, 1000ft 18awg cu white/gray, spool of 1000 | 02f4494 | 0 |
|
||||||||||||||||||
8503 001100 | belden | hook-up wire, 100ft, 22awg cu, brown, spool of 100 | 02f4529 | 6 |
|
||||||||||||||||||
8503 0211000 | belden | hook-up wire, 1000ft 22awg cu white/gray, spool of 1000 | 02f4565 | 0 |
|
||||||||||||||||||
8505 0011000 | belden | hook-up wire, 1000ft, 26awg cu brown, spool of 1000 | 02f4624 | 2 |
|
||||||||||||||||||
83000 001100 | belden | hook-up wire, 100ft, 30awg cu, brown, spool of 100 | 02f4673 | 0 |
|
||||||||||||||||||
83001 001100 | belden | hook-up wire, 100ft, 28awg cu, brown, spool of 100 | 02f4698 | 13 |
|
||||||||||||||||||
83002 001100 | belden | hook-up wire, 100ft, 26awg cu, brown, spool of 100 | 02f4718 | 11 |
|
||||||||||||||||||
83003 001100 | belden | hook-up wire, 100ft, 24awg cu, brown, spool of 100 | 02f4740 | 74 |
|
||||||||||||||||||
83003 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 02f4759 | 0 |
|
||||||||||||||||||
83004 001100 | belden | hook-up wire, 100ft, 24awg cu, brown, spool of 100 | 02f4769 | 35 |
|
||||||||||||||||||
83004 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 02f4782 | 0 |
|
||||||||||||||||||
83005 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 02f4806 | 0 |
|
||||||||||||||||||
83010 0011000 | belden | hook-up wire, 1000ft, 16awg cu brown, spool of 1000 | 02f4846 | 1 |
|
||||||||||||||||||
8521 001100 | belden | hook-up wire, 100ft, 16awg cu, brown, spool of 100 | 02f4886 | 2 |
|
||||||||||||||||||
8521 011100 | belden | hook-up wire, 100ft, 16awg, cu, tan, spool of 100 | 02f4896 | 0 |
|
||||||||||||||||||
8521 0011000 | belden | hook-up wire, 1000ft, 16awg cu brown, spool of 1000 | 02f4908 | 0 |
|
||||||||||||||||||
8521 0111000 | belden | hook-up wire, 1000ft, 16awg, cu, tan, spool of 1000 | 02f4918 | 0 |
|
||||||||||||||||||
8521 0211000 | belden | hook-up wire, 1000ft 16awg cu white/gray, spool of 1000 | 02f4928 | 0 |
|
||||||||||||||||||
8525 001100 | belden | hook-up wire, 100ft, 24awg cu, brown, spool of 100 | 02f4968 | 0 |
|
||||||||||||||||||
8520 001100 | belden | hook-up wire, 100ft, 14awg cu, brown, spool of 100 | 02f5012 | 8 |
|
||||||||||||||||||
8520 0011000 | belden | hook-up wire, 1000ft, 14awg cu brown, spool of 1000 | 02f5030 | 1 |
|
||||||||||||||||||
8524 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 02f5143 | 1 |
|
||||||||||||||||||
8524 001100 | belden | hook-up wire, 100ft, 22awg cu, brown, spool of 100 | 02f5113 | 1 |
|
||||||||||||||||||
8523 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 02f5193 | 2 |
|
||||||||||||||||||
8523 0211000 | belden | hook-up wire, 1000ft 20awg cu white/gray, spool of 1000 | 02f5213 | 0 |
|
||||||||||||||||||
8011 000100 | belden | bus bar wire, 100ft, 12awg, cu, spool of 100 | 02f5306 | 36 |
|
||||||||||||||||||
83030 0011000 | belden | hook-up wire, 1000ft, 16awg cu brown, spool of 1000 | 02f5434 | 0 |
|
||||||||||||||||||
9924 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 02f5455 | 0 |
|
||||||||||||||||||
9978 001100 | belden | hook-up wire, 100ft, 30awg cu, brown, spool of 100 | 02f5463 | 1 |
|
||||||||||||||||||
83006 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 02f5562 | 1 |
|
||||||||||||||||||
83007 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 02f5587 | 0 |
|
||||||||||||||||||
83008 001100 | belden | hook-up wire, 100ft, 20awg cu, brown, spool of 100 | 02f5597 | 2 |
|
||||||||||||||||||
83008 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 02f5611 | 0 |
|
||||||||||||||||||
83264 0011000 | belden | coaxial cable, rg-179/u, 1000ft, brown, spool of 1000 | 02f5785 | 0 |
|
||||||||||||||||||
83023 001100 | belden | hook-up wire, 100ft, 24awg cu, brown, spool of 100 | 02f5788 | 3 |
|
||||||||||||||||||
83023 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 02f5800 | 0 |
|
||||||||||||||||||
83025 001100 | belden | hook-up wire, 100ft, 22awg cu, brown, spool of 100 | 02f5810 | 0 |
|
||||||||||||||||||
83025 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 02f5821 | 0 |
|
||||||||||||||||||
83026 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 02f5842 | 0 |
|
||||||||||||||||||
83027 001100 | belden | hook-up wire, 100ft, 20awg cu, brown, spool of 100 | 02f5852 | 3 |
|
||||||||||||||||||
83028 001100 | belden | hook-up wire, 100ft, 20awg cu, brown, spool of 100 | 02f5877 | 1 |
|
||||||||||||||||||
83028 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 02f5888 | 0 |
|
||||||||||||||||||
83029 001100 | belden | hook-up wire, 100ft, 18awg cu, brown, spool of 100 | 02f5898 | 5 |
|
||||||||||||||||||
83029 0011000 | belden | hook-up wire, 1000ft, 18awg cu brown, spool of 1000 | 02f5915 | 1 |
|
||||||||||||||||||
83045 001100 | belden | hook-up wire, 100ft, 28awg cu, brown, spool of 100 | 02f5946 | 1 |
|
||||||||||||||||||
83046 0011000 | belden | hook-up wire, 1000ft, 26awg cu brown, spool of 1000 | 02f5966 | 0 |
|
||||||||||||||||||
3071-100 yel | alpha wire | hook-up wire, 100ft, 22awg cu yellow, spool of 100 | 02f8376 | 1 |
|
||||||||||||||||||
pvhr-008-1100-blk | pro power | shrink tubing, spool of 100 | 04f6459 | 3 |
|
||||||||||||||||||
brt-thg-1-100 | banner engineering | tape, retro reflective, 25mmx2.5m, each | 02h6396 | 0 |
|
||||||||||||||||||
pvhr-012-1100-blk | pro power | shrink tubing, spool of 100 | 04f6463 | 3 |
|
||||||||||||||||||
pvhr-016-1100-blk | pro power | shrink tubing, spool of 100 | 04f6467 | 2 |
|
||||||||||||||||||
71100 | wiha | phillips bit with 1/4" hex drive, each | 28c2106 | 61 |
|
||||||||||||||||||
pvhr-024-1100-blk | pro power | shrink tubing, spool of 100 | 04f6471 | 6 |
|
||||||||||||||||||
pvhr-032-1100-blk | pro power | shrink tubing, spool of 100 | 04f6475 | 4 |
|
||||||||||||||||||
pvhr-048-1100-blk | pro power | shrink tubing, spool of 100 | 04f6479 | 1 |
|
||||||||||||||||||
pvhr-064-1100-blk | pro power | shrink tubing, spool of 100 | 04f6483 | 2 |
|
||||||||||||||||||
9161-1000-60 | belden | unshld multipr cable 8pr 1000ft 300v chr, spool of 1000 | 03f1614 | 0 |
|
||||||||||||||||||
9930 0011000 | belden | hook-up wire, 1000ft, 30awg cu brown, spool of 1000 | 03f1771 | 0 |
|
||||||||||||||||||
9928 001100 | belden | hook-up wire, 100ft, 28awg cu, brown, spool of 100 | 03f1781 | 0 |
|
||||||||||||||||||
9926 0011000 | belden | hook-up wire, 1000ft, 26awg cu brown, spool of 1000 | 03f1810 | 0 |
|
||||||||||||||||||
9923 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 03f1830 | 0 |
|
||||||||||||||||||
9921 001100 | belden | hook-up wire, 100ft, 22awg cu, brown, spool of 100 | 03f1840 | 16 |
|
||||||||||||||||||
9921 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 03f1850 | 4 |
|
||||||||||||||||||
9919 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 03f1870 | 2 |
|
||||||||||||||||||
9918 001100 | belden | hook-up wire, 100ft, 18awg cu, brown, spool of 100 | 03f1880 | 5 |
|
||||||||||||||||||
9918 0011000 | belden | hook-up wire, 1000ft, 18awg cu brown, spool of 1000 | 03f1890 | 0 |
|
||||||||||||||||||
9916 0011000 | belden | hook-up wire, 1000ft, 16awg, cu, red, spool of 1000 | 03f1920 | 0 |
|
||||||||||||||||||
9912 001100 | belden | hook-up wire, 100ft, 12awg cu, brown, spool of 100 | 03f1930 | 3 |
|
||||||||||||||||||
9986 0011000 | belden | hook-up wire, 1000ft, 28awg cu brown, spool of 1000 | 03f1978 | 1 |
|
||||||||||||||||||
9985 001100 | belden | hook-up wire, 100ft, 26awg cu, brown, spool of 100 | 03f1988 | 8 |
|
||||||||||||||||||
9984 0011000 | belden | hook-up wire, 1000ft, 24awg cu brown, spool of 1000 | 03f2018 | 2 |
|
||||||||||||||||||
9983 0011000 | belden | hook-up wire, 1000ft, 22awg cu brown, spool of 1000 | 03f2038 | 0 |
|
||||||||||||||||||
9982 0011000 | belden | hook-up wire, 1000ft, 20awg cu brown, spool of 1000 | 03f2058 | 1 |
|
||||||||||||||||||
pvs-006-1100-blk | pro power | heat-shrink tubing, 3/32 in, 2.36mm, spool of 100 | 03f3457 | 17 |
|
||||||||||||||||||
pvs-008-1100-blk | pro power | heat-shrink tubing, 1/8 in, 3.18mm, spool of 100 | 03f3462 | 13 |
|
||||||||||||||||||
pvs-048-1100-blk | pro power | heat-shrink tubing, 3/4 in, 19.05mm, spool of 100 | 03f3487 | 17 |
|
||||||||||||||||||
pvs-064-1100-blk | pro power | heat-shrink tubing, 1 in, 25.4mm, spool of 100 | 03f3490 | 0 |
|
||||||||||||||||||
pvi-s24-1100-blk | pro power | insulating tubing, spool of 100 | 03f3576 | 20 |
|
||||||||||||||||||
pvi-s22-1100-blk | pro power | insulating tubing, spool of 100 | 03f3581 | 15 |
|
||||||||||||||||||
pvi-s22-1100-clr | pro power | sleeving/tubing, insulating, 0.69mm dia, clr, 100ft, spool of 100 | 03f3583 | 14 |
|
||||||||||||||||||
pvi-s20-1100-clr | pro power | insulating tubing, spool of 100 | 03f3589 | 3 |
|
||||||||||||||||||
pvi-s18-1100-blk | pro power | insulating tubing, spool of 100 | 03f3592 | 109 |
|
||||||||||||||||||
pvi-s16-1100-blk | pro power | insulating tubing, spool of 100 | 03f3597 | 45 |
|
||||||||||||||||||
pvi-s14-1100-blk | pro power | insulating tubing, spool of 100 | 03f3602 | 39 |
|
元器件型号 | 厂商 | 描述 | farnell # | 数量 asia | 数量 europe | 价格 (gbp) | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
0001.1001 | schurter | fuse, fast acting, ceramic, 500ma | 1360825 | 724 | 958 |
|
||||||||||||
0001.1004 | schurter | fuse, fast acting, ceramic, 1a | 1360829 | 320 | 534 |
|
||||||||||||
0001.1005 | schurter | fuse, fast acting, ceramic, 1.25a | 1360830 | 0 | 20 |
|
||||||||||||
0001.1006 | schurter | fuse, fast acting, ceramic, 1.6a | 1360831 | 40 | 640 |
|
||||||||||||
0001.1007 | schurter | fuse, fast acting, ceramic, 2a | 1360832 | 3703 | 568 |
|
||||||||||||
0001.1008 | schurter | fuse, fast acting, ceramic, 2.5a | 1360833 | 7 | 272 |
|
||||||||||||
0001.1009 | schurter | fuse, fast acting, ceramic, 3.15a | 1360835 | 127 | 2001 |
|
||||||||||||
001100 | hammond | case, black, abs, 40x60x18.5mm | 1877325 | 0 | 41 |
|
||||||||||||
001-1007-040fb9 | itt cannon | terminal, ptfe, test | 1347797 | 59 | 6199 |
|
||||||||||||
01100000 | bopla | box, aluminium, euromas | 4190051 | 26 | 49 |
|
||||||||||||
01110000 | bopla | box, aluminium, euromas | 4190105 | 5 | 11 |
|
||||||||||||
01110005mr | littelfuse | fuse holder, 5 x 20mm, pcb mount | 1155771 | 4018 | 986 |
|
||||||||||||
011-1004-040fb9 | itt cannon | terminal, ptfe, test | 1347796 | 2750 | 4784 |
|
||||||||||||
02011.0-01 | stego | convection heater, 100w, 135c, 120v | 1694631 | 8 | 8 |
|
||||||||||||
02811.0-00 | stego | fan heater, 250w, t/safe, d/rail clip | 1870843 | 0 | 6 |
|
||||||||||||
02811.0-00 | stego | fan heater, 250w, t/safe, d/rail clip | 1870843 | 0 | 6 |
|
||||||||||||
02811.0-01 | stego | fan heater, 250w, t/safe, screw mnt | 1870844 | 0 | 6 |
|
||||||||||||
02811.0-01 | stego | fan heater, 250w, t/safe, screw mnt | 1870844 | 0 | 6 |
|
||||||||||||
0318007.hxp | littelfuse | fuse, axial, 7a, 6.3 x 32mm, fast acting | 1681100 | 116 | 116 |
|
||||||||||||
0355-0-15-01-02-01-10-0 | mill max | pin receptacle, pc board, solder | 4523430 | 27484 | 27484 |
|
||||||||||||
04023j0r9abstr | avx | capacitor, accu-p, 0402, 0.9pf, 25v | 1100617rl | 0 | 0 |
|
||||||||||||
04023j0r2abstr | avx | capacitor, accu-p, 0402, 0.2pf, 25v | 1100608rl | 0 | 0 |
|
||||||||||||
04023j0r2abstr | avx | capacitor, accu-p, 0402, 0.2pf, 25v | 1100608 | 211 | 3953 |
|
||||||||||||
04023j0r3abstr | avx | capacitor, accu-p, 0402, 0.3pf, 25v | 1100611 | 42 | 0 |
|
||||||||||||
04023j0r3abstr | avx | capacitor, accu-p, 0402, 0.3pf, 25v | 1100611rl | 0 | 0 |
|
||||||||||||
04023j0r5abstr | avx | capacitor, accu-p, 0402, 0.5pf, 25v | 1100613rl | 0 | 0 |
|
||||||||||||
04023j0r5abstr | avx | capacitor, accu-p, 0402, 0.5pf, 25v | 1100613 | 684 | 23187 |
|
||||||||||||
04023j0r7abstr | avx | capacitor, accu-p, 0402, 0.7pf, 25v | 1100615 | 0 | 4158 |
|
||||||||||||
04023j0r7abstr | avx | capacitor, accu-p, 0402, 0.7pf, 25v | 1100615rl | 0 | 0 |
|
||||||||||||
04023j0r8abstr | avx | capacitor, accu-p, 0402, 0.8pf, 25v | 1100616 | 907 | 2352 |
|
||||||||||||
04023j0r8abstr | avx | capacitor, accu-p, 0402, 0.8pf, 25v | 1100616rl | 0 | 0 |
|
||||||||||||
04023j0r9abstr | avx | capacitor, accu-p, 0402, 0.9pf, 25v | 1100617 | 0 | 2287 |
|
||||||||||||
04023j1r2bbstr | avx | capacitor, accu-p, 0402, 1.2pf, 25v | 1100618rl | 0 | 0 |
|
||||||||||||
04023j1r2bbstr | avx | capacitor, accu-p, 0402, 1.2pf, 25v | 1100618 | 350 | 3778 |
|
||||||||||||
04023j1r8bbstr | avx | capacitor, accu-p, 0402, 1.8pf, 25v | 1100620 | 0 | 6806 |
|
||||||||||||
04023j1r8bbstr | avx | capacitor, accu-p, 0402, 1.8pf, 25v | 1100620rl | 0 | 0 |
|
||||||||||||
04023j2r7bbstr | avx | capacitor, accu-p, 0402, 2.7pf, 25v | 1100623rl | 0 | 0 |
|
||||||||||||
04023j2r7bbstr | avx | capacitor, accu-p, 0402, 2.7pf, 25v | 1100623 | 0 | 1603 |
|
||||||||||||
04023j3r9bbstr | avx | capacitor, accu-p, 0402, 3.9pf, 25v | 1100625 | 0 | 3839 |
|
||||||||||||
04023j3r9bbstr | avx | capacitor, accu-p, 0402, 3.9pf, 25v | 1100625rl | 0 | 0 |
|
||||||||||||
04023j4r7bbstr | avx | capacitor, accu-p, 0402, 4.7pf, 25v | 1100626 | 1286 | 495 |
|
||||||||||||
04023j4r7bbstr | avx | capacitor, accu-p, 0402, 4.7pf, 25v | 1100626rl | 0 | 0 |
|
||||||||||||
0402zj220gbstr | avx | capacitor, accu-p 22pf 10v 0402 | 1100635rl | 0 | 0 |
|
||||||||||||
0402zk180gbstr | avx | capacitor, accu-p, 0402, 18pf, 10v | 1100633 | 0 | 8768 |
|
||||||||||||
0402zk180gbstr | avx | capacitor, accu-p, 0402, 18pf, 10v | 1100633rl | 0 | 0 |
|
||||||||||||
04311000 | bopla | housing, plastic, euromas | 1217447 | 54 | 12 |
|
||||||||||||
04323-00011-00 | tesa | tape, gp masking 38mm, 50m | 1775779 | 0 | 69 |
|
||||||||||||
0451.100mrl | littelfuse | fuse, quick blow, smd, 100ma | 1596462 | 330 | 1150 |
|
||||||||||||
05811000 | te connectivity | cable marker, 0, blk, pk100 | 141565 | 37 | 591 |
|
||||||||||||
06011.0-00 | stego | heater w/stat, 100w, +15c | 1870836 | 0 | 2 |
|
||||||||||||
06011.0-00. | stego | touch safe heater, 100w, 120c, 240v | 1694499 | 10 | 10 |
|
||||||||||||
062905- | roebuck | rbk non-woven abrasive d/green d crs pad | 1821100 | 0 | 28 |
|
||||||||||||
0801-1000 | unbranded | feltron 0801-1000 absta.bolz.100/pk | 820313 | 0 | 16 |
|
||||||||||||
09 0111 00 04 | binder | plug, panel, rear mount, 4way | 1122437 | 0 | 34 |
|
||||||||||||
09 0311 00 04 | binder | plug, panel, 4way | 1122597 | 135 | 374 |
|
||||||||||||
09 0411 00 04 | binder | plug, sealed panel, 4way | 1122565 | 5 | 59 |
|
||||||||||||
09 0411 00 04 | binder | plug, sealed panel, 4way | 1122565 | 5 | 59 |
|
||||||||||||
09 06 203 281100 | harting | socket, din41612, h3, 3way | 1207574 | 13 | 80 |
|
||||||||||||
09 06 203 291100 | harting | plug, din41612, h3, 3way | 1207573 | 0 | 75 |
|
||||||||||||
09 11 000 6116 | harting | crimp contact, pin, 16mm2 | 1892261 | 0 | 8 |
|
||||||||||||
09 11 000 6116 | harting | crimp contact, pin, 16mm2 | 1892261 | 0 | 8 |
|
||||||||||||
09 11 000 6125 | harting | crimp contact, pin, 25mm2 | 1892263 | 0 | 10 |
|
||||||||||||
09 11 000 6125 | harting | crimp contact, pin, 25mm2 | 1892263 | 0 | 10 |
|
||||||||||||
09 11 000 6132 | harting | crimp contact, pin, 16mm2 | 1892282 | 0 | 10 |
|
||||||||||||
09 11 000 6133 | harting | crimp contact, pin, 25mm2 | 1892284 | 0 | 6 |
|
||||||||||||
09 11 000 6135 | harting | crimp contact, pin, 35mm2 | 1892266 | 0 | 10 |
|
||||||||||||
09 11 000 6135 | harting | crimp contact, pin, 35mm2 | 1892266 | 0 | 10 |
|
||||||||||||
09 11 000 6216 | harting | crimp contact, skt, 16mm2 | 1892262 | 0 | 10 |
|
||||||||||||
09 11 000 6216 | harting | crimp contact, skt, 16mm2 | 1892262 | 0 | 10 |
|
||||||||||||
09 11 000 6225 | harting | crimp contact, skt, 25mm2 | 1892264 | 0 | 10 |
|
||||||||||||
09 11 000 6225 | harting | crimp contact, skt, 25mm2 | 1892264 | 0 | 10 |
|
||||||||||||
09 11 000 6231 | harting | crimp contact, skt, 10mm2 | 1892281 | 0 | 9 |
|
||||||||||||
09 11 000 6232 | harting | crimp contact, skt, 16mm2 | 1892283 | 0 | 10 |
|
||||||||||||
09 11 000 6233 | harting | crimp contact, skt, 25mm2 | 1892285 | 0 | 6 |
|
||||||||||||
09 11 000 6235 | harting | crimp contact, skt, 35mm2 | 1892267 | 0 | 10 |
|
||||||||||||
09 11 000 6235 | harting | crimp contact, skt, 35mm2 | 1892267 | 0 | 10 |
|
||||||||||||
09 14 000 611100 | harting | contact, coaxial, pin, 50ohm | 3458337 | 0 | 40 |
|
||||||||||||
09 14 000 621100 | harting | socket, coaxial contact, 50ohm | 3458350 | 0 | 38 |
|
||||||||||||
09 45 225 1100 | harting | feed-through, 3a, rj45, ip67 | 1106821 | 0 | 113 |
|
||||||||||||
09 45 115 1100 | harting | plug, rj45, 3a, ip67 | 1106816 | 2 | 57 |
|
||||||||||||
09 45 125 1100 | harting | plug, cable, data, rj45, 3a, plastic | 1106819 | 5 | 8 |
|
||||||||||||
09 45 145 1100 | harting | plug, push-pull, rj45, ip67 | 1106815 | 12 | 37 |
|
||||||||||||
09 45 151 1100 | harting | plug, rj45, ip20 | 1106814 | 180 | 37 |
|
||||||||||||
09 45 215 1100 | harting | feed-through, 3a, rj45, ip67 | 1106817 | 0 | 267 |
|
||||||||||||
09 45 215 1100 | harting | feed-through, 3a, rj45, ip67 | 1106817 | 0 | 267 |
|
||||||||||||
09 69 110 0022 | harting | connector, male, 2w2c | 1707663 | 101 | 80 |
|
||||||||||||
09 69 110 0022 | harting | connector, male, 2w2c | 1707663 | 101 | 80 |
|
||||||||||||
09451511100 | harting | rj45 modular plug, 8pos, 1 port | 1762925 | 49 | 49 |
|
||||||||||||
09-4811-00-04 | binder | plug, panel, rear, 4way | 1778835 | 0 | 5 |
|
||||||||||||
09-91-1000 | molex | crimp housing, 0.156", 10way | 9731563 | 122 | 0 |
|
||||||||||||
0ic1100a0c | ersa | sold. station i-con1c with interface | 1625360 | 0 | 7 |
|
||||||||||||
1.10.001.001/0104 | rafi | switch, pushbutton, mom, opaque, black | 9927352 | 49 | 299 |
|
||||||||||||
1.10.001.001/0205 | rafi | switch, pushbutton, mom, opaque, white | 9927360 | 0 | 308 |
|
||||||||||||
1.10.001.001/0301 | rafi | switch, pushbutton, mom, opaque, red | 9927379 | 0 | 399 |
|
||||||||||||
1.10.001.001/0507 | rafi | switch, pushbutton, mom, opaque, green | 9927387 | 9 | 1039 |
|
||||||||||||
1.10.001.011/0301 | rafi | switch, pushbutton, mom, opaque, red | 9927417 | 0 | 359 |
|
||||||||||||
1.14.002.011/0000 | rafi | keyswitch micon 5 smd | 1579998 | 0 | 1634 |
|
||||||||||||
1.14.002.011/0000 | rafi | keyswitch micon 5 smd | 1579998 | 0 | 1634 |
|
||||||||||||
1.14.002.111/0000 | rafi | keyswitch micon 5 smd | 1579996 | 0 | 1214 |
|
||||||||||||
1.14.002.111/0000 | rafi | keyswitch micon 5 smd | 1579996 | 0 | 1214 |
|
元器件型号 | 厂商 | 描述 | digi-key # | 数量 | 价格 | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
0031.1001 | schurter inc | fep fuseholder 5x20 | 0031.1001-nd | 0 |
|
||||||||||||||||||||
0001.1001 | schurter inc | fuse 500ma 250v 5x20 fast cerm | 0001.1001-nd | 0 |
|
||||||||||||||||||||
000-91100 | amphenol-rf division | conn adpt n jack-jack hermetic | 000-91100-nd | 0 |
|
||||||||||||||||||||
0001.1001.pt | schurter inc | fuse 500ma 250v 5x20 fast cerm | 0001.1001.pt-nd | 0 |
|
||||||||||||||||||||
0001.1001.tr | schurter inc | fuse 500ma 250v 5x20 fast cerm | 0001.1001.tr-nd | 0 |
|
||||||||||||||||||||
0001.1002 | schurter inc | fuse 630ma 250v 5x20 fast cerm | 0001.1002-nd | 0 |
|
||||||||||||||||||||
0001.1003 | schurter inc | fuse 800ma 250v 5x20 fast cerm | 0001.1003-nd | 0 |
|
||||||||||||||||||||
0001.1003.pt | schurter inc | fuse 800ma 250v 5x20 fast cerm | 0001.1003.pt-nd | 0 |
|
||||||||||||||||||||
0001.1004 | schurter inc | fuse 1a 250v 5x20 fast-act cerm | 0001.1004-nd | 0 |
|
||||||||||||||||||||
0001.1004.pt | schurter inc | fuse 1a 250v 5x20 fast cerm | 0001.1004.pt-nd | 0 |
|
||||||||||||||||||||
0001.1005 | schurter inc | fuse 1.25a 250v 5x20 fast cerm | 0001.1005-nd | 0 |
|
||||||||||||||||||||
0001.1005.pt | schurter inc | fuse 1.25a 250v 5x20 fast cerm | 0001.1005.pt-nd | 0 |
|
||||||||||||||||||||
0001.1005.tr | schurter inc | fuse 1.25a 250v 5x20 fst cerm tr | 0001.1005.tr-nd | 0 |
|
||||||||||||||||||||
0001.1006 | schurter inc | fuse 1.6a 250v 5x20 fast cerm | 0001.1006-nd | 0 |
|
||||||||||||||||||||
0001.1007 | schurter inc | fuse 2a 250v 5x20 fast-act cerm | 0001.1007-nd | 0 |
|
||||||||||||||||||||
0001.1007.pt | schurter inc | fuse 2a 250v 5x20 fast cerm | 0001.1007.pt-nd | 0 |
|
||||||||||||||||||||
0001.1007.tr | schurter inc | fuse 2a 250v 5x20 fast cerm t/r | 0001.1007.tr-nd | 0 |
|
||||||||||||||||||||
0001.1008 | schurter inc | fuse 2.5a 250v 5x20 fast cerm | 0001.1008-nd | 0 |
|
||||||||||||||||||||
0001.1008.pt | schurter inc | fuse 2.5a 250v 5x20 fast cerm | 0001.1008.pt-nd | 0 |
|
||||||||||||||||||||
0001.1009 | schurter inc | fuse 3.15a 250v 5x20 fast cerm | 0001.1009-nd | 0 |
|
||||||||||||||||||||
0001.1009.pt | schurter inc | fuse 3.15a 250v 5x20 fast cerm | 0001.1009.pt-nd | 0 |
|
||||||||||||||||||||
0029110022 | molex inc | 2ckt mini spox plug housing | wm2814-nd | 374 bag |
|
||||||||||||||||||||
0029110023 | molex inc | 2ckt mini spox plug housing | wm2815-nd | 1700 bag |
|
||||||||||||||||||||
0029110033 | molex inc | mini spox plug housing 3pos | wm4381-nd | 646 bag |
|
||||||||||||||||||||
0029110042 | molex inc | 4ckt mini spox plug housing | wm2816-nd | 4627 bag |
|
||||||||||||||||||||
006208505110000 | avx corporation | conn ffc/fpc 5pos 1mm zif smd | 478-1958-1-nd | 0 |
|
||||||||||||||||||||
006208505110000 | avx corporation | conn ffc/fpc 5pos 1mm zif smd | 478-1958-2-nd | 0 |
|
||||||||||||||||||||
006208505110000+ | avx corporation | conn ffc/fpc 5pos 1mm zif smd | 006208505110000+-nd | 0 |
|
||||||||||||||||||||
006208506110000 | avx corporation | conn ffc/fpc 6pos 1mm zif smd | 478-1959-2-nd | 0 |
|
||||||||||||||||||||
006208506110000 | avx corporation | conn ffc/fpc 6pos 1mm zif smd | 478-1959-1-nd | 312 cut tape |
|
||||||||||||||||||||
006208506110000+ | avx corporation | conn ffc/fpc 6pos 1mm zif smd | 006208506110000+-nd | 2000 tape & reel |
|
||||||||||||||||||||
006208508110000 | avx corporation | conn ffc/fpc 8pos 1mm zif smd | 478-1960-1-nd | 0 |
|
||||||||||||||||||||
006208508110000 | avx corporation | conn ffc/fpc 8pos 1mm zif smd | 478-1960-2-nd | 0 |
|
||||||||||||||||||||
006208508110000+ | avx corporation | conn ffc/fpc 8pos 1mm zif smd | 006208508110000+-nd | 0 |
|
||||||||||||||||||||
006208510110000 | avx corporation | conn ffc/fpc 10pos 1mm zif smd | 478-1961-1-nd | 0 |
|
||||||||||||||||||||
006208510110000 | avx corporation | conn ffc/fpc 10pos 1mm zif smd | 478-1961-2-nd | 0 |
|
||||||||||||||||||||
006208510110000+ | avx corporation | conn ffc/fpc 10pos 1mm zif smd | 006208510110000+-nd | 0 |
|
||||||||||||||||||||
007967-000 | te connectivity | boot molded | 222k121-100-0-nd | 0 |
|
||||||||||||||||||||
009176001011006 | avx corporation | conn idc 1 pos 20 awg black smd | 478-6078-6-nd | 3034 digi-reel® |
|
||||||||||||||||||||
009176001011006 | avx corporation | conn idc 1 pos 20 awg black smd | 478-6078-1-nd | 3034 cut tape |
|
||||||||||||||||||||
009176001011006 | avx corporation | conn idc 1 pos 20 awg black smd | 478-6078-2-nd | 3000 tape & reel |
|
||||||||||||||||||||
009176002011006 | avx corporation | conn idc 2 pos smd 20 awg | 478-4614-1-nd | 3392 cut tape |
|
||||||||||||||||||||
009176002011006 | avx corporation | conn idc 2 pos smd 20 awg | 478-4614-2-nd | 3000 tape & reel |
|
||||||||||||||||||||
009176002011006 | avx corporation | conn idc 2 pos smd 20 awg | 478-4614-6-nd | 3392 digi-reel® |
|
||||||||||||||||||||
009176003011006 | avx corporation | conn idc 3 pos smd 20 awg | 478-4618-1-nd | 3191 cut tape |
|
||||||||||||||||||||
009176003011006 | avx corporation | conn idc 3 pos smd 20 awg | 478-4618-2-nd | 3000 tape & reel |
|
||||||||||||||||||||
009176003011006 | avx corporation | conn idc 3 pos smd 20 awg | 478-4618-6-nd | 3191 digi-reel® |
|
||||||||||||||||||||
0110020000 | weidmuller | term blk sak 10 ts32 krg | 0110020000-nd | 0 |
|
||||||||||||||||||||
0110060000 | weidmuller | term blk sak 10 ts32 pa beige | 0110060000-nd | 0 |
|
||||||||||||||||||||
0110070000 | weidmuller | term blk sak 10 ts32 krg blue | 0110070000-nd | 0 |
|
||||||||||||||||||||
0110080000 | weidmuller | term blk sak 10 ts32 pa blue | 0110080000-nd | 0 |
|
||||||||||||||||||||
01110005mr | littelfuse inc | fuse clip 5mm t/ammo ear bronze | f043ct-nd | 2648 cut tape |
|
||||||||||||||||||||
01110005mr | littelfuse inc | fuse clip 5mm t/ammo ear bronze | f043tb-nd | 2000 tape & box |
|
||||||||||||||||||||
016211-000 | te connectivity | boot molded str size 63 w/lip | 202k163-100/180-0-nd | 0 |
|
||||||||||||||||||||
02-09-2101 | molex connector corporation | conn term male 14-20awg tin | wm1100ct-nd | 21200 cut tape |
|
||||||||||||||||||||
02-09-2101 | molex connector corporation | conn term male 14-20awg tin | wm1100tr-nd | 14000 tape & reel |
|
||||||||||||||||||||
02-09-2103 | molex inc | conn term male 14-20awg tin | wm1100-nd | 96016 bag |
|
||||||||||||||||||||
02-09-2103-c | molex inc | conn term male 14-20awg tin | wm1100-nd | 96016 bag |
|
||||||||||||||||||||
02221100 | rose+bopla enclosures | enclosure poly 7.87x4.72x2.95" | 02221100-nd | 0 |
|
||||||||||||||||||||
0210201100 | molex inc | cable flat flex 3" 0.50mm 39pos | 0210201100-nd | 0 |
|
||||||||||||||||||||
02110002-000 | measurement specialties inc/schaevitz | snsr tilt ratio 60deg 500ma flng | 356-1032-nd | 183 bulk |
|
||||||||||||||||||||
02119011-000 | measurement specialties inc/schaevitz | snsr tilt rt/pwm 20deg 10ma case | 356-1034-nd | 14 bulk |
|
||||||||||||||||||||
0220-21xx | helicomm inc | programmer ip-prog 1220 | 611-1007-nd | 5 box |
|
||||||||||||||||||||
02231100 | rose+bopla enclosures | enclosure poly 6.29x3.14x3.34" | 02231100-nd | 0 |
|
||||||||||||||||||||
022611-000 | te connectivity | hot air gun reflector | hl1802e-070519-nd | 0 |
|
||||||||||||||||||||
025-0611-000 | itt cannon, llc | dust cap 16 16s plastic | 025-0611-000-nd | 0 |
|
||||||||||||||||||||
0250011001 | molex inc | cable 10pos .100 jumper 1 inches | 0250011001-nd | 0 |
|
||||||||||||||||||||
02560411-000 | measurement specialties inc/schaevitz | sensor lvdt mhr series +-12.7mm | 356-1014-nd | 0 |
|
||||||||||||||||||||
0273-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn receptacle pin .078" | 0273-015011601100-nd | 0 |
|
||||||||||||||||||||
0279-0-15-01-47-01-10-0 | mill-max manufacturing corp. | conn receptacle pin .062" | 0279-015014701100-nd | 0 |
|
||||||||||||||||||||
0284-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn pin recept .145" .070" | 0284-015011601100-nd | 0 |
|
||||||||||||||||||||
0285-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn pin recept .090" .065" | 0285-015011601100-nd | 4000 bulk |
|
||||||||||||||||||||
0287-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.034" .065" | 0287-015011601100-nd | 0 |
|
||||||||||||||||||||
0291-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.034" .145" | 0291-015011601100-nd | 0 |
|
||||||||||||||||||||
0292-0-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.032" .063" | 0292-0-15-01-06-01-10-0-nd | 0 |
|
||||||||||||||||||||
029243-000 | te connectivity | boot molded | 234a111-100-0-nd | 0 |
|
||||||||||||||||||||
0293-0-15-01-16-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.034" .067" | 0293-015011601100-nd | 0 |
|
||||||||||||||||||||
0294-0-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.032" .076" | 0294-015010601100-nd | 0 |
|
||||||||||||||||||||
0295-0-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.032" .063" | 0295-015010601100-nd | 0 |
|
||||||||||||||||||||
0298-1-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .031" .051" | 0298-115010601100-nd | 0 |
|
||||||||||||||||||||
0298-2-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .062" .082" | 0298-215010601100-nd | 0 |
|
||||||||||||||||||||
0298-3-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .094" .113" | 0298-315010601100-nd | 0 |
|
||||||||||||||||||||
0298-4-15-01-06-01-10-0 | mill-max manufacturing corp. | conn recept pin .125" .145" | 0298-415010601100-nd | 0 |
|
||||||||||||||||||||
02y7471#1000 | hoei america inc | cable sma plug-r/a plug 1000mm | 305-1031-nd | 0 |
|
||||||||||||||||||||
0300-1-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .110" .025" | 0300-115014701100-nd | 0 |
|
||||||||||||||||||||
0300-2-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .187" .025" | 0300-215014701100-nd | 1000 bulk |
|
||||||||||||||||||||
0301-1-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .187 .025" | 0301-115014701100-nd | 0 |
|
||||||||||||||||||||
0303-0-19-01-16-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.034" .150" | 0303-019011601100-nd | 0 |
|
||||||||||||||||||||
0305-0-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.037" .095" | 0305-015014701100-nd | 0 |
|
||||||||||||||||||||
0305-1-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.037" .105" | 0305-115014701100-nd | 0 |
|
||||||||||||||||||||
0305-2-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.037" .155" | 0305-215014701100-nd | 0 |
|
||||||||||||||||||||
0306-0-19-01-16-01-10-0 | mill-max manufacturing corp. | conn recept pin .022-.034" .248" | 0306-019011601100-nd | 0 |
|
||||||||||||||||||||
0307001100 | molex inc | hdac64 dr female 10 ckt gray | wm4326-nd | 2349 bag |
|
||||||||||||||||||||
0309-2-15-01-47-01-10-0 | mill-max manufacturing corp. | conn recept pin .025-.037" .080" | 0309-215014701100-nd | 0 |
|
||||||||||||||||||||
031-1310-01-100 | dialight | led base lg panel mini ind bayo | 031-1310-01-100-nd | 0 |
|
||||||||||||||||||||
031-3101-01-100 | dialight | led base s-6 lg panel indicator | 031-3101-01-100-nd | 0 |
|
||||||||||||||||||||
0311004.h | littelfuse inc | fuse 4a 32v fast acting ul | f2235-nd | 0 |
|
||||||||||||||||||||
0311005.h | littelfuse inc | fuse 5a 32v fast acting ul | f2236-nd | 0 |
|
||||||||||||||||||||
0311006.h | littelfuse inc | fuse 6a 32v fast acting ul | f2237-nd | 0 |
|
||||||||||||||||||||
0311007.h | littelfuse inc | fuse 7a 32v fast acting ul | f2238-nd | 0 |
|
tti, inc. product information | rohs
lead (pb) |
pricing | availability | |||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
compliantpb-free
|
|
2,700
|
|||||||||||||||||
|
compliantpb-free
|
|
4,872
|
|||||||||||||||||
|
compliantpb-free
|
|
4,385
|
|||||||||||||||||
|
compliantpb-free
|
|
6,300
|
|||||||||||||||||
|
compliantpb-free
|
|
16,000
|
|||||||||||||||||
|
compliantpb-free
|
|
9,000
|
|||||||||||||||||
|
compliantpb-free
|
|
97
|
|||||||||||||||||
|
compliantpb-free
|
|
32,100
|
|||||||||||||||||
|
compliant per exemption pb-free
|
|
60,000
|
|||||||||||||||||
|
compliant per exemption pb-free
|
|
3,956
|
|||||||||||||||||
|
compliantpb-free
|
|
8,595
|
|||||||||||||||||
|
compliantpb-free
|
|
4,000
|
|||||||||||||||||
|
compliantpb-free
|
|
3,200
|
|||||||||||||||||
|
compliantpb-free
|
|
2,200
|
|||||||||||||||||
|
compliantpb-free
|
|
3,322
|
|||||||||||||||||
|
compliant per exemption pb-free
|
|
1,644
|
|||||||||||||||||
|
compliantpb-free
|
|
5,900
|
|||||||||||||||||
|
compliantpb-free
|
|
90,200
|
|||||||||||||||||
|
compliant per exemption pb-free
|
|
220,000
|
|||||||||||||||||
|
compliantpb-free
|
|
7,450
|
|||||||||||||||||
|
compliantpb-free
|
|
16,000
|
|||||||||||||||||
|
compliantpb-free
|
|
6,900
|
|||||||||||||||||
|
compliantpb-free
|
|
12,000
|
|||||||||||||||||
|
compliantpb-free
|
|
9,900
|
|||||||||||||||||
|
compliantpb-free
|
|
50,300
|
元器件型号 | 厂商 | 描述 | rohs | 数量 | 价格 | |
---|---|---|---|---|---|---|
sqt-11001-f-d | samtec | conn socket strip skt 20 pos 2mm solder st thru-hole tube | yes | 46 |
|
|
mbr1100 | vishay | diode schottky 100v 10a 2-pin do-204al box | yes | 0 |
|
|
0294-0-15-01-06-01-10-0 | mill-max | conn contact rcp 1 pos solder st thru-hole bulk | no | 5208 |
|
|
823211-000 | tyco electronics | cable accessories t-transition semi-rigid modified polyolefin | yes | 17 |
|
|
814711-000 | tyco electronics | cable accessories molded boot straight 5.3-17.8 cable diameter semi-rigid polyolefin | yes | 326 |
|
|
561-2401-100f | dialight | led uni-color red 635nm 2-pin bulk | yes | 0 |
|
|
561-2201-100f | dialight | led uni-color green 565nm 2-pin | yes | 962 |
|
|
tsw-110-08-g-d | samtec | conn unshrouded header hdr 20 pos 2.54mm solder st thru-hole | yes | 151 |
|
|
rmcf 1/1005%r | stackpole electronics | res thick film 0805 0 ohm 5% 1/8w smd paper t/r | yes | 48000 |
|
|
csc10a01100kgpa | vishay | res thick film net 100k ohm 2% 1.25w 100ppm/c bus 10-pin sip pin thru-hole bulk | no | 1055 |
|
|
csc06a01100kgpa | vishay | res thick film net 100k ohm 2% 3/4w 100ppm/c bus 6-pin sip pin thru-hole bulk | no | 0 |
|
|
ftsh-110-01-lm-dv | samtec | conn unshrouded header hdr 20 pos 1.27mm solder st smd tube | yes | 4405 |
|
|
sqw-11001fdvsptr | samtec | conn socket strip skt 20 pos 2mm solder st smd t/r | yes | 1050 |
|
|
310-13-132-41-001100 | mill-max | conn socket strip skt 32 pos 2.54mm solder st thru-hole | yes | 1983 |
|
|
a11005rncq | c & k components | switch rotary sp 10 shaft pc pins 2.5a 125vac 125vdc | yes | 73 |
|
|
dfls1100-7 | diodes inc | diode schottky 100v 1a 2-pin powerdi 123 t/r | yes | 6000 |
|
|
mur1100eg | on semiconductor | diode ultra fast recovery rectifier 1kv 1a 2-pin do-41 bag | yes | 6370 |
|
|
8350110001 | tyco electronics | cable accessories marker sleeve polyolefin white | yes | 29250 |
|
|
5111008-1 | tyco electronics | conn ejector header hdr 10 pos 2.54mm solder st thru-hole | yes | 180 |
|
|
120411-000 | tyco electronics | cable accessories coaxial terminator polyvinylidene fluoride transparent blue | no | 500 |
|
|
tsm-110-01-lm-sh-a-p | samtec | conn unshrouded header hdr 10 pos 2.54mm solder ra smd tube | yes | 850 |
|
|
tle-11001gdvaktr | samtec | conn socket strip skt 20 pos 2mm solder st smd t/r | yes | 0 |
|
|
mtsw-110-07-t-d-205 | samtec | conn unshrouded header hdr 20 pos 2.54mm solder st thru-hole | yes | 178 |
|
|
mmt-110-01-s-sh-p-tr | samtec | conn unshrouded header hdr 10 pos 2mm solder ra smd t/r | yes | 625 |
|
|
hmtsw-110-09-t-d-500 | samtec | conn unshrouded header hdr 20 pos 2.54mm solder st thru-hole | yes | 568 |
|
|
ftsh-110-01-f-dh-a | samtec | conn unshrouded header hdr 20 pos 1.27mm solder ra smd tube | yes | 192 |
|
|
fts-110-01-l-d | samtec | conn unshrouded header hdr 20 pos 1.27mm solder st thru-hole tube | yes | 653 |
|
|
fte-110-01-g-dv | samtec | conn unshrouded header hdr 20 pos 0.8mm solder st smd tube | yes | 0 |
|
|
51004-1100 | molex | conn housing rcp 11 pos 2mm st bag | yes | 530 |
|
|
39611000440 | littelfuse | fuse 1a 125v subminiature 2-pin bulk | yes | 181 |
|
|
561-2101-100f | dialight | led uni-color red 635nm 2-pin bulk | yes | 1258 |
|
|
3006p-1-100lf | bourns | res trimmer 10 ohm 10% 3/4w 15turn 2.36mm pin thru-hole tube | yes | 462 |
|
|
68691-100hlf | fci electronics | conn unshrouded header hdr 2.54mm solder st thru-hole bag | yes | 31710 |
|
|
78211-008lf | fci electronics | conn housing rcp 8 pos 2.54mm st bag | yes | 661 |
|
|
ud1100002-01 | lantronix | serial device servers | yes | 5 |
|
|
68691-100h | fci electronics | conn unshrouded header hdr 2.54mm solder st thru-hole bag | no | 43828 |
|
|
78211-005lf | fci electronics | conn housing rcp 5 pos 2.54mm st bag | yes | 0 |
|
|
37011000410 | littelfuse | fuse 1a 250v subminiature 2-pin bulk | yes | 0 |
|
|
xio1100zgb | texas instruments | phy 1-ch 100-pin bga tray | yes | 795 |
|
|
3296w-1-100lf | bourns | res trimmer 10 ohm 10% 1/2w 25turn 2.19mm pin thru-hole tube | yes | 4230 |
|
|
ssw-110-01-f-d-ll | samtec | conn socket strip skt 20 pos 2.54mm solder st thru-hole | yes | 308 |
|
|
ftr-110-03-g-d-lc-06 | samtec | conn unshrouded header hdr 20 pos 1.27mm solder st smd tube | yes | 195 |
|
|
smm-11002sdlcktr | samtec | conn socket strip skt 20 pos 2mm solder st smd t/r | yes | 375 |
|
|
fjh1100 | fairchild semiconductor | diode standard recovery rectifier 5v 0.15a 2-pin do-35 bulk | yes | 366 |
|
|
78511-100h | fci electronics | conn unshrouded header hdr 1 pos solder st thru-hole bag | yes | 38400 |
|
|
0328-0-15-01-34-01-10-0 | mill-max | conn contact rcp 1 pos press fit st bulk | no | 14000 |
|
|
351-10-164-00-011000 | mill-max | conn unshrouded header hdr 64 pos 2.54mm solder st thru-hole | yes | 500 |
|
|
hcnw2211-000e | avago technologies | optocoupl logic-out totem-pole dc-in 1-ch 8-pin pdip tube | yes | 0 |
|
|
561-1301-100f | dialight | led uni-color green 565nm 2-pin | yes | 0 |
|
|
37211000411 | littelfuse | fuse 1a 250v time lag acting 2-pin bulk | yes | 7067 |
|
|
eht-11001sd | samtec | conn ejector header hdr 20 pos 2mm solder st thru-hole tube | yes | 720 |
|
|
b1100-13-f | diodes inc | diode schottky 100v 1a 2-pin sma t/r | yes | 20000 |
|
|
b1100lb-13-f | diodes inc | diode schottky 100v 2a 2-pin smb t/r | yes | 171000 |
|
|
mbrs1100t3g | on semiconductor | diode schottky 100v 2a 2-pin smb t/r | yes | 97500 |
|
|
clt-110-02-l-da-k-tr | samtec | conn socket strip skt 20 pos 2mm solder st smd t/r | yes | 88 |
|
|
0111 0005mr | littelfuse | fuse clips ammo | yes | 34000 |
|
|
811 0000 0005 | littelfuse | fuse holders 2-pin bulk | yes | 10769 |
|
|
tsm-110-01-t-dv-a | samtec | conn unshrouded header hdr 20 pos 2.54mm solder st smd tube | yes | 584 |
|
|
hcpl-2611-000e | avago technologies | optocoupl logic-out open collector dc-in 1-ch 8-pin pdip tube | yes | 13253 |
|
|
561-1101-100f | dialight | led uni-color red 635nm 2-pin | yes | 225 |
|
|
pr02000201100ja100 | vishay | res metal film 110 ohm 5% 2w 250ppm/c axl thru-hole ammo pack | yes | 0 |
|
|
sogc2001100kjrz | vishay | res thick film net 100k ohm 5% 2w 100ppm/c bus 20-pin dip gull wing smd t/r | no | 0 |
|
|
ec1100et-20.000m | ecliptek | th crystal oscillator 20mhz 5v 50pf 4-pin metal dip | yes | 694 |
|
|
0355-0-15-01-02-01-10-0 | mill-max | conn contact rcp 1 pos solder st bulk | no | 27741 |
|
|
ssw-110-01-s-d-ll | samtec | conn socket strip skt 20 pos 2.54mm solder st thru-hole | yes | 996 |
|
|
110-13-328-41-001100 | mill-max | conn dip socket skt 28 pos 2.54mm solder st thru-hole tube | yes | 481 |
|
|
msp08a01-100kfda | vishay | res thick film net 100k ohm 1% 1w 100ppm/c bus 8-pin sip pin thru-hole tube | no | 7392 |
|
|
csc08a01100kgpa | vishay | res thick film net 100k ohm 2% 1w 100ppm/c bus 8-pin sip pin thru-hole bulk | no | 1100 |
|
|
chp1-100-1002-j-blk | tt electronics | res metal glaze 2512 10k ohm 5% 1w 100ppm/c melf smd bulk | no | 3600 |
|
|
89110-0111 | 3m | conn idc connector skt 10 pos 2.54mm idt ra cable mount | yes | 696 |
|
|
atevk1100 | atmel | evaluation kit for avr32 at32uc3a microcontroller | yes | 10 |
|
|
170-90-628-00-001-100 | mill-max | conn dip adapter hdr 28 pos 2.54mm solder st thru-hole tube | no | 10 |
|
|
mur1100erlg | on semiconductor | diode ultra fast recovery rectifier 1kv 1a 2-pin do-41 t/r | yes | 25000 |
|
|
0364-0-15-01-13-01-10-0 | mill-max | conn contact rcp 1 pos solder st thru-hole bulk | no | 0 |
|
|
78211-003lf | fci electronics | conn housing rcp 3 pos 2.54mm st bag | yes | 3312 |
|
|
hcpl-0611-000e | avago technologies | optocoupl logic-out open collector dc-in 1-ch 8-pin soic tube | yes | 7760 |
|
|
adum1100arz | analog devices | optocoupler 1-ch 8-pin soic n | yes | 3165 |
|
|
adum1100ur | analog devices | optocoupler 1-ch 8-pin soic n | no | 175 |
|
|
78211-004lf | fci electronics | conn housing rcp 4 pos 2.54mm st bag | yes | 2100 |
|
|
hcpl-0211-000e | avago technologies | optocoupl logic-out totem-pole dc-in 1-ch 8-pin soic tube | yes | 4336 |
|
|
51761-10002406aalf | fci electronics | conn power rcp 24power/6signal pos 6.35mm/2.54mm solder ra thru-hole 30 terminal 1 port tray | yes | 576 |
|
|
adum1100ur-rl7 | analog devices | optocoupler 1-ch 8-pin soic n t/r | no | 0 |
|
|
469411-000 | tyco electronics | 0024a0024-9x,cable mount & accessories 24awg 19strnd 2c white | no | 3590 |
|
|
0598110000 | molex | screws heavy hex hex head | yes | 1005 |
|
|
adum1100brz | analog devices | optocoupler 1-ch 8-pin soic n | yes | 997 |
|
|
4816p-1-100lf | bourns | res thick film net 10 ohm 1 ohm 1.28w 250ppm/c isol 16-pin som gull wing smd t/r | yes | 0 |
|
|
jm38510/11001bca | national semiconductor | op amp quad gp 22v 14-pin cdip rail | no | 8041 |
|
|
hcpl-m611-000e | avago technologies | optocoupl logic-out open collector dc-in 1-ch 5-pin soic tube | yes | 512 |
|
|
488911-000 | tyco electronics | cable accessories solder sleeve shield terminator polyolefin transparent clear | no | 484 |
|
|
511311-000 | tyco electronics | connector accessories tinel lock adapter straight aluminum alloy olive drab cadmium over electroless nickel | no | 25 |
|
|
rmcf 1/100r | stackpole electronics | res thick film 0805 0 ohm 1/8w smd paper t/r | yes | 315000 |
|
|
0510211000 | molex | conn housing rcp 10 pos 1.25mm st bag | yes | 29463 |
|
|
3741100041 | littelfuse | fuse 1a 250v time lag acting 2-pin bulk | yes | 9896 |
|
|
emif01-10005w5 | stmicroelectronics | emi filter gull wing smd | yes | 24000 |
|
|
51721-10002406aalf | fci electronics | conn power hdr 24power/6signal pos 6.35mm/2.54mm solder ra thru-hole 30 terminal 1 port tray | yes | 288 |
|
|
37411000000 | littelfuse | fuse 1a 250v time lag acting 2-pin tape and ammo | yes | 4000 |
|
|
90311-006lf | fci electronics | conn housing 6 pos 2mm crimp st cable mount bag | yes | 5388 |
|
|
ftsh-110-01-l-dv-p-tr | samtec | conn unshrouded header hdr 20 pos 1.27mm solder st smd t/r | yes | 6256 |
|
|
tmm-110-03-g-d | samtec | conn unshrouded header hdr 20 pos 2mm solder st thru-hole | yes | 918 |
|
|
90311-008lf | fci electronics | conn housing 8 pos 2mm crimp st cable mount bag | yes | 14980 |
|
元器件型号 | 厂商 | 描述 | avnet # | 数量 | 价格 | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
308-dp1p1611-000 | amphenol | filtered i/o - bulk | 308-dp1p1611-000 | call for delivery |
|
||||||||||||
ds1100lz-400+ | maxim integrated products | actv tapped dly line 5 tap 1-in 80ns abs 400ns max 8soic n - rail/tube | ds1100lz-400+ | call for delivery |
|
||||||||||||
ds1100lz-450+ | maxim integrated products | actv tapped dly line 5 tap 1-in 90ns abs 450ns max 8soic n - rail/tube | ds1100lz-450+ | call for delivery |
|
||||||||||||
901-10003 | amphenol | conn sma rcp 0hz to 18ghz 50ohm sldr st edge mnt au over ni - bulk | 901-10003 | 10 wks factory lead time |
|
||||||||||||
m85049/11-100n | glenair | conn acc st env bss al eltrlss ni - bulk | m85049/11-100n | 5 wks factory lead time |
|
||||||||||||
elc301100 | amphenol pcd | .156 cl screw terminal edgcard - bulk | elc301100 | 8 wks factory lead time |
|
||||||||||||
sfm-110-02-s-d-a | samtec inc. | conn sckt strp skt 20 pos 1.27mm sldr st th - bulk | sfm-110-02-s-d-a | 1 wks factory lead time |
|
||||||||||||
adum1100arz | analog devices | pb free 25mbd single channel digital iso - rail/tube | adum1100arz | 855 in stock |
|
||||||||||||
ftmh-110-02-l-dv-a | samtec inc. | conn unshrd hdr hdr 20 pos 1mm sldr st smd - rail/tube | ftmh-110-02-l-dv-a | 1 wks factory lead time |
|
||||||||||||
tsm-110-01-l-dh-a-k-tr | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr ra smd - tape and reel | tsm-110-01-l-dh-a-k-tr | 1 wks factory lead time |
|
||||||||||||
tms-110-01-g-s | samtec inc. | conn unshrd hdr hdr 10 pos 1.27mm sldr st th - bulk | tms-110-01-g-s | 1 wks factory lead time |
|
||||||||||||
0039301100 | molex | conn wire to bd hdr 10 pos 4.2mm sldr ra th - bulk | 39-30-1100 | 8 wks factory lead time |
|
||||||||||||
0436451100 | molex | conn housing rcp 11 pos 3mm st - bulk | 43645-1100 | 2867 in stock |
|
||||||||||||
ssq-110-01-g-d-mw | samtec inc. | conn sckt strp skt 20 pos 2.54mm sldr st th - bulk | ssq-110-01-g-d-mw | 1 wks factory lead time |
|
||||||||||||
05400754445 | 3m interconnect solutions | conn idc conn skt 10 pos 2.54mm idt ra cbl mnt - bulk | 89110-0001 | 460 in stock |
|
||||||||||||
mtsw-110-08-t-d-300 | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st th - bulk | mtsw-110-08-t-d-300 | 1 wks factory lead time |
|
||||||||||||
smm-110-02-s-d | samtec inc. | conn sckt strp skt 20 pos 2mm sldr st smd - bulk | smm-110-02-s-d | 431 in stock |
|
||||||||||||
tsw-110-08-s-t-na | samtec inc. | conn unshrd hdr hdr 30 pos 2.54mm sldr ra th - bulk | tsw-110-08-s-t-na | 1 wks factory lead time |
|
||||||||||||
2019-1511-000 | aep (applied engineering products) | conn smb m 0hz to 4ghz 50ohm sldr st pnl mnt au - bulk | 2019-1511-000 | 4703 in stock |
|
||||||||||||
28b0631-100 | steward | cbl acc broad band ferrite for rnd cbls blk - bulk | 28b0631-100 | 3325 in stock |
|
||||||||||||
tmm-110-05-s-d-sm | samtec inc. | conn unshrd hdr hdr 20 pos 2mm sldr st smd - rail/tube | tmm-110-05-s-d-sm | 1 wks factory lead time |
|
||||||||||||
r414511000 | radiall | attenuator - bulk | r414511000 | 5 wks factory lead time |
|
||||||||||||
0194011000 | molex | conn pwr pl/rcp 3 pos 10.6mm idt st cbl mnt 3term - bulk | 19401-1000 | 1 wks factory lead time |
|
||||||||||||
ftsh-110-01-f-dv-tr | samtec inc. | conn unshrd hdr hdr 20 pos 1.27mm sldr st smd - tape and reel | ftsh-110-01-f-dv-tr | 1 wks factory lead time |
|
||||||||||||
a11003rnzb | c&k components | swit rotary sp 10 shaft sldr lug 20vac 20vdc 0.4w - bulk | a11003rnzb | 12 wks factory lead time |
|
||||||||||||
tst-110-01-l-d | samtec inc. | conn shrd hdr hdr 20 pos 2.54mm sldr st th - bulk | tst-110-01-l-d | 1 wks factory lead time |
|
||||||||||||
tsw-110-08-t-s-la | samtec inc. | conn unshrd hdr hdr 10 pos 2.54mm sldr ra th - bulk | tsw-110-08-t-s-la | 1 wks factory lead time |
|
||||||||||||
mtlw-110-05-g-d-175 | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st th - bulk | mtlw-110-05-g-d-175 | 1 wks factory lead time |
|
||||||||||||
ds1100z-300 | maxim integrated products | delay line 8pin 5tap 300ns soic - rail/tube | ds1100z-300 | 32 wks factory lead time |
|
||||||||||||
tsm-110-01-t-dv-m-tr | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st smd - tape and reel | tsm-110-01-t-dv-m-tr | 1 wks factory lead time |
|
||||||||||||
111811-0000 | itt interconnect solutions | female gender changer 111811-0000 - bulk | db111811 | 26 wks factory lead time |
|
||||||||||||
74ac11004dw | texas instruments | inverter 6-elem cmos 20soic - bulk | 74ac11004dw | 189 in stock |
|
||||||||||||
ssw-110-02-f-d | samtec inc. | conn sckt strp skt 20 pos 2.54mm sldr st th - bulk | ssw-110-02-f-d | 1 wks factory lead time |
|
||||||||||||
sel-110-01-ftl-s-tr | samtec inc. | conn intrfc m 10 pos 1mm sldr ra smd - tape and reel | sel-110-01-ftl-s-tr | 1 wks factory lead time |
|
||||||||||||
me97294-1100 | itt interconnect solutions | 097294-1100 - bulk | me97294-1100 | call for delivery |
|
||||||||||||
elb321100 | amphenol pcd | cage-clamp/edgecard connector - bulk | elb321100 | 8 wks factory lead time |
|
||||||||||||
ds1100lz-45 | maxim integrated products | delay line 3v 8pin 5tap 45ns soic - rail/tube | ds1100lz-45 | call for delivery |
|
||||||||||||
ds1100zl-75 | maxim integrated products | - rail/tube | ds1100zl-75 | call for delivery |
|
||||||||||||
bsw-110-04-t-d | samtec inc. | conn bottom mnt sckt strp skt 20 pos 2.54mm sldr st th - bulk | bsw-110-04-t-d | 1 wks factory lead time |
|
||||||||||||
ces-110-01-s-d | samtec inc. | conn sckt strp skt 20 pos 2.54mm sldr st th - bulk | ces-110-01-s-d | 1 wks factory lead time |
|
||||||||||||
adum1100urz-rl7 | analog devices | pb free 100 c single channel digital iso - tape and reel | adum1100urz-rl7 | 7 wks factory lead time |
|
||||||||||||
05400719942 | 3m interconnect solutions | conn ejector hdr hdr 34 pos 2.54mm sldr ra th - bulk | 3431-1002 | 5 wks factory lead time |
|
||||||||||||
a11005rscg | c&k components | swit rotary sp 10 shaft pc pins 2.5a 125vac 125vdc 0.4w - bulk | a11005rscg | 350 in stock |
|
||||||||||||
tsm-110-04-l-dv-a | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st smd - bulk | tsm-110-04-l-dv-a | 1 wks factory lead time |
|
||||||||||||
0210391100 | molex | ffc jumper cbl 39conds 0.08m 30v 1.3a - bulk | 21039-1100 | 8 wks factory lead time |
|
||||||||||||
0510211100 | molex | conn housing rcp 11 pos 1.25mm st - bulk | 51021-1100 | 30 in stock |
|
||||||||||||
esqt-110-02-f-d-750 | samtec inc. | conn elevated sckt skt 20 pos 2mm sldr st th - bulk | esqt-110-02-f-d-750 | 1 wks factory lead time |
|
||||||||||||
clt-110-02-l-d-be | samtec inc. | conn sckt strp skt 20 pos 2mm sldr st smd - bulk | clt-110-02-l-d-be | 1 wks factory lead time |
|
||||||||||||
ssw-110-01-s-d-ll | samtec inc. | conn sckt strp skt 20 pos 2.54mm sldr st th - bulk | ssw-110-01-s-d-ll | 1 wks factory lead time |
|
||||||||||||
clt-110-02-f-d-be | samtec inc. | conn sckt strp skt 20 pos 2mm sldr st smd - bulk | clt-110-02-f-d-be | 1 wks factory lead time |
|
||||||||||||
2012-1511-000 | aep (applied engineering products) | conn smb m 0hz to 4ghz 50ohm sldr ra pnl mnt au - bulk | 2012-1511-000 | 1600 in stock |
|
||||||||||||
ptf-110-03-s-d | samtec inc. | conn sckt strp skt 20 pos 2mm press fit st th - bulk | ptf-110-03-s-d | 1 wks factory lead time |
|
||||||||||||
dc11.0031.203 | schurter | dc11 power entry modul 10a - bulk | dc11.0031.203 | call for delivery |
|
||||||||||||
elxp11100 | amphenol pcd | right angle plug - bulk | elxp11100 | 8 wks factory lead time |
|
||||||||||||
ds1100lu-150 | maxim integrated products | delay line 3v 8p 5tap 150ns usop - rail/tube | ds1100lu-150 | 12 wks factory lead time |
|
||||||||||||
ds1100lz-125/t&r | maxim integrated products | dl 3v 8pin 5tap 125ns soic trl - tape and reel | ds1100lz-125/t&r | call for delivery |
|
||||||||||||
mle-110-01-g-dv-tr | samtec inc. | conn sckt strp skt 20 pos 1mm sldr st smd - tape and reel | mle-110-01-g-dv-tr | 1 wks factory lead time |
|
||||||||||||
ips1-110-01-s-d | samtec inc. | conn isolated pwr sckt strp skt 20 pos 2.54mm sldr st th 20t - bulk | ips1-110-01-s-d | 1 wks factory lead time |
|
||||||||||||
332110000 | c&k components | - bulk | 332110000 | 12 wks factory lead time |
|
||||||||||||
tle-110-01-g-dv-a | samtec inc. | conn sckt strp skt 20 pos 2mm sldr st smd - bulk | tle-110-01-g-dv-a | 1 wks factory lead time |
|
||||||||||||
0510671100 | molex | conn housing rcp 11 pos 3.5mm st - bulk | 51067-1100 | 9 wks factory lead time |
|
||||||||||||
1.10001.011//0104 | c&k components | pushbutton - illuminated & industrial controls - bulk | 1.10001.011/0104 | 10 wks factory lead time |
|
||||||||||||
2025-1511-000 | aep (applied engineering products) | conn smb f 0hz to 4ghz 50ohm sldr st th au - bulk | 2025-1511-000 | 2634 in stock |
|
||||||||||||
tsw-110-06-g-d | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st th - bulk | tsw-110-06-g-d | 1 wks factory lead time |
|
||||||||||||
111007-7 | te connectivity / amp | 30 a/l univ hdr hsg vp - bulk | 111007-7 | call for delivery |
|
||||||||||||
50576-1100e | fci sa | conn din 41612 rcp 100 pos 2.5 - rail/tube | 50576-1100e | 7 wks factory lead time |
|
||||||||||||
5110.0643.1 | schurter | pwr entry mod fltred m 3 pos 250vac 6a st - bulk | 5110.0643.1 | 11 in stock |
|
||||||||||||
tps1100d | texas instruments | trans mosfet p-ch 15v 1.6a 8soic - rail/tube | tps1100d | 15 in stock |
|
||||||||||||
tsm-110-01-f-dv-m-tr | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st smd - tape and reel | tsm-110-01-f-dv-m-tr | 1 wks factory lead time |
|
||||||||||||
2719-1511-000 | aep (applied engineering products) | 75 ohm, straight bulkhead jack receptacle, gold plated - bulk | 2719-1511-000 | call for delivery |
|
||||||||||||
50003-1100h | fci sa | conn din 41612 rcp 100 pos 2.5 - rail/tube | 50003-1100h | 7 wks factory lead time |
|
||||||||||||
ds1100z-40/t&r | maxim integrated products | delay line 8p 5tap 40ns soic trl - tape and reel | ds1100z-40/t&r | call for delivery |
|
||||||||||||
stmm-110-01-g-d | samtec inc. | conn shrd hdr hdr 20 pos 2mm sldr st th - bulk | stmm-110-01-g-d | 1 wks factory lead time |
|
||||||||||||
ssw-110-06-s-t | samtec inc. | conn sckt strp skt 30 pos 2.54mm sldr st th - bulk | ssw-110-06-s-t | 1 wks factory lead time |
|
||||||||||||
tsm-110-01-s-dv-lc-p | samtec inc. | conn unshrd hdr hdr 20 pos 2.54mm sldr st smd - bulk | tsm-110-01-s-dv-lc-p | 1 wks factory lead time |
|
||||||||||||
0304531100 | molex | cbl acc holder polyester natural - bulk | 30453-1100 | 5 wks factory lead time |
|
||||||||||||
ssw-110-02-g-t-ra | samtec inc. | conn sckt strp skt 30 pos 2.54mm sldr ra th - bulk | ssw-110-02-g-t-ra | 1 wks factory lead time |
|
||||||||||||
rsm-110-02-l-d-p-tr | samtec inc. | conn sckt strp skt 20 pos 1.27mm sldr st smd - tape and reel | rsm-110-02-l-d-p-tr | 1 wks factory lead time |
|
||||||||||||
0737821100 | molex | conn hard metric hdr 144 pos 2mm sldr st th - rail/tube | 73782-1100 | 4 wks factory lead time |
|
||||||||||||
esqt-110-02-l-d-440 | samtec inc. | conn elevated sckt skt 20 pos 2mm sldr st th - bulk | esqt-110-02-l-d-440 | 1 wks factory lead time |
|
||||||||||||
031-1007-004 | itt interconnect solutions | conn cont skt 1 pos crmp st 1term - bulk | 031-1007-004 | call for delivery |
|
||||||||||||
ds1100lz-150 | maxim integrated products | delay line 3v 8pin 5tap 150ns soic - rail/tube | ds1100lz-150 | 12 wks factory lead time |
|
||||||||||||
2-1499110-0 | te connectivity / amp | ca/assy,mp,8p,blk,enhcd,c5,nb - bulk | 2-1499110-0 | 4 wks factory lead time |
|
||||||||||||
r431611005 | radiall | hybrid coupler - bulk | r431611005 | call for delivery |
|
||||||||||||
molc-110-01-s-q | samtec inc. | conn shrd hdr hdr 40 pos 1.27mm sldr st th - bulk | molc-110-01-s-q | 1 wks factory lead time |
|
||||||||||||
elm181100 | amphenol pcd | modular horizontal wire entry - bulk | elm181100 | 8 wks factory lead time |
|
||||||||||||
elb101100 | amphenol pcd | cage-clamp/edgecard connector - bulk | elb101100 | 8 wks factory lead time |
|
||||||||||||
elm091100 | amphenol pcd | modular horizontal wire entry - bulk | elm091100 | 8 wks factory lead time |
|
||||||||||||
a91311-000 | te connectivity / raychem circuit protection | fuse 40a 30v fast acting 2pin - bag | ruef250 | 8000 in stock |
|
||||||||||||
tps51100dgqr | texas instruments | ldo reg -0.1v to 3.6v 3a 10htssop ep - tape and reel | tps51100dgqr | 8 wks factory lead time |
|
||||||||||||
elm141100 | amphenol pcd | modular horizontal wire entry - bulk | elm141100 | 8 wks factory lead time |
|
||||||||||||
a11005mncqk | c&k components | swit rotary sp 10 shaft pc pins 2.5a 125vac 125vdc - bulk | a11005mncqk | 12 wks factory lead time |
|
||||||||||||
0743011000 | molex | hdm bp conn extended tail 30au 144ckt - rail/tube | 74301-1000 | 4 wks factory lead time |
|
||||||||||||
b3s1100p | omron electronics | swit tctl no spst rnd btn gw 0.05a 24vdc 500000cycle 1.57n s - tape and reel | b3s-1100p | 22 wks factory lead time |
|
||||||||||||
322110000 | c&k components | - bulk | 322110000 | 12 wks factory lead time |
|
||||||||||||
81100-zz17117 | 3m interconnect solutions | 100/mhdr/ra/sej ins/.115/ - bulk | 81100-zz17117 | 10 wks factory lead time |
|
||||||||||||
05113858840 | 3m interconnect solutions | conn ejector hdr hdr 100 pos 1.27mm sldr ra th - bulk | 81100-550203 | 5 wks factory lead time |
|
||||||||||||
1004-1511-000 | aep (applied engineering products) | conn smc m 0hz to 10ghz 50ohm sldr st pnl mnt au - bulk | 1004-1511-000 | 475 in stock |
|
||||||||||||
1109-7511-000 | aep (applied engineering products) | conn smc m 0hz to 10ghz 50ohm sldr st th au - bulk | 1109-7511-000 | call for delivery |
|
||||||||||||
2025-7511-000 | aep (applied engineering products) | conn smb f 0hz to 4ghz 50ohm sldr st th au - bulk | 2025-7511-000 | call for delivery |
|
元器件型号 | 厂商 | 描述 | arrow# | 数量 | 价格 | |
---|---|---|---|---|---|---|
12214-1100-00pl | 3m interconnect solutions | 14/sdr/rc/bmt/st/thru/gf | 12214-1100-00pl | 0 |
|
|
je150323432 | 3m interconnect solutions | je150323432 12214-1100-00pl=14 | 12214-1100-00pl | 0 |
|
|
je150332326 | 3m interconnect solutions | je150332326 12226-1100-00fr=26 | 12226-1100-00fr | 0 |
|
|
80610029789 | 3m interconnect solutions | sbub jack screw kit- short. bu | 3342-1 (100) | 100 |
|
|
3365/11 (100””) | 3m interconnect solutions | 11/cab/rc/rc/typ1/28awg/str/.050/ | 3365/11 (100””) | 0 |
|
|
80610670343 | 3m interconnect solutions | 11/cab/rc/rc/typ1/28awg/str/.050/ | 3365/11 (100) | 0 |
|
|
80610163943 | 3m interconnect solutions | conn ejector header hdr 34 pos 2.54mm solder ra thru-hole | 3431-1002 | 0 |
|
|
80610163968 | 3m interconnect solutions | conn ejector header hdr 34 pos 2.54mm solder ra thru-hole | 3431-1003 | 1000 |
|
|
89110-0111 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0111 | 696 |
|
|
xe004228906 | 3m interconnect solutions | cable assembly data 1m 26awg 7 pos sata to 7 pos sata pl-pl | 5602-11-0000-000 | 0 |
|
|
xe004228930 | 3m interconnect solutions | cable assembly data 0.5m 26awg 7 pos sata to 7 pos sata pl-pl | 5602-11-0000-500 | 1199 |
|
|
de610020179 | 3m interconnect solutions | conn din 41612 skt 64 pos 2.54mm idt ra cable mount | 62c64-1100ec | 28 |
|
|
80611002553 | 3m interconnect solutions | 80611002553 tes 220 cr 1,220mm | 6400220cr | 0 |
|
|
80611002629 | 3m interconnect solutions | 80611002629 tes 450 cr 1220mm | 6400450cr | 0 |
|
|
ke727013960 | 3m interconnect solutions | ke727013960 brown spark pin te | 711/100 | 0 |
|
|
711/100 | 3m interconnect solutions | pin terminal 8 awg; 0.67" lg p | 711/100 | 0 |
|
|
80601110010 | 3m interconnect solutions | 80601110010 06126 801 s/lok 50 | 801-box | 0 |
|
|
80601110028 | 3m interconnect solutions | 80601110028 06127 801 s/lok 50 | 801-bulk | 0 |
|
|
81100-660203 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660203 | 0 |
|
|
81100-660203-rb | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660203-rb | 0 |
|
|
80000901985 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-500203-rb | 0 |
|
|
80620096125 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-500303 | 0 |
|
|
81100-500303 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-500303 | 0 |
|
|
80001256637 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-500303-rb | 0 |
|
|
80610373872 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-550203 | 0 |
|
|
81100-550203 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-550203 | 0 |
|
|
80001206806 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-550203-rb | 0 |
|
|
80610372627 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-550303 | 0 |
|
|
81100-550303 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-550303 | 0 |
|
|
80000901993 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560203-rb | 168 |
|
|
80130026216 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560303 | 0 |
|
|
80000902009 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560303-rb | 0 |
|
|
80130030721 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560403 | 0 |
|
|
81100-560403 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560403 | 0 |
|
|
80001201039 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder ra thru-hole | 81100-560403-rb | 0 |
|
|
80400021673 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-600201 | 0 |
|
|
80000902017 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-600203-rb | 0 |
|
|
80001256645 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-600303-rb | 0 |
|
|
80001154550 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-600403 | 0 |
|
|
80001247644 | 3m interconnect solutions | 80001247644 81100-600403-rb=10 | 81100-600403-rb | 0 |
|
|
80000902025 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-600c01-rb | 0 |
|
|
80610476097 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-650203 | 0 |
|
|
81100-650203 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-650203 | 0 |
|
|
80001211665 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-650203-rb | 0 |
|
|
80610479513 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-650303 | 0 |
|
|
80001206897 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-650403 | 0 |
|
|
80000916025 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-650c07-rb | 0 |
|
|
80001252461 | 3m interconnect solutions | 80001252461 81100-650c08=100/m | 81100-650c08 | 0 |
|
|
80001223827 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-650c08-rb | 0 |
|
|
80130023304 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660203 | 0 |
|
|
80000917676 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660301 | 0 |
|
|
80130026273 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660303 | 0 |
|
|
81100-660303 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660303 | 0 |
|
|
80001153115 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660303-rb | 0 |
|
|
80130031034 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660403 | 0 |
|
|
80620139321 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st thru-hole | 81100-660403-rb | 0 |
|
|
80400016079 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c01 | 0 |
|
|
81100-660c01 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c01 | 0 |
|
|
80400008829 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c04 | 0 |
|
|
81100-660c04 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c04 | 0 |
|
|
80000917650 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c04-rb | 0 |
|
|
80000931271 | 3m interconnect solutions | conn ejector header hdr 100 pos 1.27mm solder st smd tray | 81100-660c07-rb | 288 |
|
|
80001252420 | 3m interconnect solutions | 80001252420 81100-660c08=100/m | 81100-660c08 | 0 |
|
|
80001252446 | 3m interconnect solutions | 80001252446 81100-660c08-rb=10 | 81100-660c08-rb | 0 |
|
|
81100-m00203-rb | 3m interconnect solutions | conn ejector header hdr 100 pos 2.54mm solder ra thru-hole | 81100-m00203-rb | 0 |
|
|
80610211007 | 3m interconnect solutions | flat cable 6conductors 24awg 30.48m tinned copper dark gray/red edge 300v roll | 8125/06 | 0 |
|
|
80611009228 | 3m interconnect solutions | 80611009228 88t-0.75x36 (3/4"x | 88t-0.75x36 | 0 |
|
|
80611009236 | 3m interconnect solutions | 80611009236 88t-1x36 (1"x36””) | 88t-1x36 | 0 |
|
|
80610706303 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0001 | 165 |
|
|
89110-0001ha | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0001ha | 0 |
|
|
80610706345 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0003 | 712 |
|
|
80610706329 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0101 | 1918 |
|
|
80610379432 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0101ha | 700 |
|
|
89110-0103 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt ra cable mount | 89110-0103 | 1790 |
|
|
xe004230555 | 3m interconnect solutions | cable assembly data 1m 28awg 26 pos scsi to 26 pos scsi pl-pl | 8m26-aa0401-1.00 | 0 |
|
|
xe004229482 | 3m interconnect solutions | xe004229482 8n36-ha0611-1.00=i | 8n36-ha0611-1.00 | 0 |
|
|
xe004229524 | 3m interconnect solutions | xe004229524 8n36-ha0711-1.00=i | 8n36-ha0711-1.00 | 0 |
|
|
80400007870 | 3m interconnect solutions | flat cable 100conductors 30awg tinned copper gray 150v roll | 90101/100 | 0 |
|
|
80000910572 | 3m interconnect solutions | flat cable 100conductors 30awg 30.48m tinned copper gray 150v roll | 90201/100 | 0 |
|
|
80000910580 | 3m interconnect solutions | 80000910580 90201/100 100sf =1 | 90201/100sf | 0 |
|
|
80000910895 | 3m interconnect solutions | flat cable 100conductors 30awg 30.48m tinned copper gray 150v roll | 90211/100 | 0 |
|
|
80001311002 | 3m interconnect solutions | conn board to board connector hdr 6pos 2.54mm thru | 926142-01-03-eu | 0 |
|
|
80001321100 | 3m interconnect solutions | conn unshrouded header hdr 36 pos 2.54mm solder st thru-hole | 929710-03-18 | 108 |
|
|
929975-01-10-05 | 3m interconnect solutions | 929975-01-10-05 | 0 |
|
||
80610479919 | 3m interconnect solutions | 80610479919 93101/100 100/cab/ | 93101/100 | 0 |
|
|
de500011007 | 3m interconnect solutions | conn board stacker hdr 4 pos 2mm solder st smd tube | 951404-2061309-ar-tp | 0 |
|
|
80001204033 | 3m interconnect solutions | conn idc connector skt 10 pos 2.54mm idt st cable mount | d89110-0101hk | 590 |
|
|
11004 | 3m touch systems | 18.1"tchscrn;nec/lcd1860 | 11004 | 0 |
|
|
pg-12.1-1000 | 3m touch systems | 12.1" privacy glass | pg-12.1-1000 | 0 |
|
|
80610294615 | 3m interconnect solutions | hdt tubing heavy-duty, polyolefin | hdt-1100-48a-black | 0 |
|
|
80610769509 | 3m interconnect solutions | hdt tubing heavy-duty, polyolefin | hdt-1100-48a-red | 0 |
|
|
80610693840 | 3m interconnect solutions | heat shrink medium wall cable sleeves | imcsn-1100-25-u | 0 |
|
|
80610677629 | 3m interconnect solutions | imcsn medium wall heat shrink tubing | imcsn-1100-48a | 0 |
|
|
80611210842 | 3m interconnect solutions | infrared thermometers | ir-1100 | 0 |
|
|
80611211055 | 3m interconnect solutions | infrared thermometer circular laser 30:1 1100 degrees nist | ir-1100ni | 0 |
|
|
80610907307 | 3m interconnect solutions | cable accessories heat shrink tubing polyolefin | itcsf-1100-bk-48a-msha | 0 |
|
|
itcsf-1100-bk-48a-msha | 3m interconnect solutions | cable accessories heat shrink tubing polyolefin | itcsf-1100-bk-48a-msha | 0 |
|
|
80610229512 | 3m interconnect solutions | cable accessories heavy wall heat shrinkable tubing polyolefin black box | itcsn-1100-12-box | 0 |
|
|
80008007256 | 3m interconnect solutions | cable accessories heavy wall heat shrinkable tubing polyolefin black bulk | itcsn-1100-12-bulk | 0 |
|
|
80610229504 | 3m interconnect solutions | heat shrink tubing st polyolefin black heavy reel | itcsn-1100-25-u | 0 |
|
元器件型号 | 厂商 | 描述 | allied # | 数量 | 价格 | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5211000303s | ico rally | cable sleeve, 1/8 in nominal, peek expando | 205-0020 | 0 |
|
||||||||||||
9928 001100 | belden wire and cable | wire, hook up, 28awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0039 | 2 |
|
||||||||||||
tljt227m004r1100 | avx | capacitor;tantalum;cap 220uf;tol+-20% ;smt;case 3528-12;vol-rtg 4v;high cv | 213-0495 | 2399 |
|
||||||||||||
9921 001100 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0069 | 76 |
|
||||||||||||
9919 001100 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0079 | 12 |
|
||||||||||||
9918 001100 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0089 | 24 |
|
||||||||||||
9916 001100 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0099 | 7 |
|
||||||||||||
9928 0011000 | belden wire and cable | wire, hook up, 28awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0109 | 2 |
|
||||||||||||
tajd476k025rnj | avx | capacitor, tantalum;47uf;chip;+/-10%;eia 7343;25v;32vdc;0.9 ohms esr;smd;tr | 213-1100 | 0 |
|
||||||||||||
9930 0011000 | belden wire and cable | wire, hook up, 30awg, stranded, pvc, 300v, ul 1007 brown | 214-0029 | 0 |
|
||||||||||||
9926 0011000 | belden wire and cable | wire, hook up, 26awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0119 | 1 |
|
||||||||||||
9923 0011000 | belden wire and cable | wire, hook up, 24awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0129 | 2 |
|
||||||||||||
9921 0011000 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0139 | 4 |
|
||||||||||||
9919 0011000 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0149 | 3 |
|
||||||||||||
9918 0011000 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 300v, ul 1007/1569 brown | 214-0159 | 5 |
|
||||||||||||
8918 001100 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 600v, ul 1015 brown | 214-0209 | 11 |
|
||||||||||||
8917 001100 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 600v, ul 1015 brown | 214-0219 | 13 |
|
||||||||||||
8916 001100 | belden wire and cable | wire, hook up, 14awg, stranded, pvc, 600v, ul 1015 brown | 214-0229 | 5 |
|
||||||||||||
8522 0111000 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 1000v, mil-w-76c type mw tan | 214-0238 | 3 |
|
||||||||||||
9912 001100 | belden wire and cable | wire, hook up, 12awg, stranded, pvc, 600v, ul 1015, brown | 214-0239 | 14 |
|
||||||||||||
8919 0011000 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 600v, ul 1015 brown | 214-0279 | 2 |
|
||||||||||||
8918 0011000 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 600v, ul 1015 brown | 214-0289 | 1 |
|
||||||||||||
8917 0011000 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 600v, ul 1015 brown | 214-0299 | 0 |
|
||||||||||||
9978 001100 | belden wire and cable | wire, hook up, 30awg, solid, semi rigid pvc, 300v, ul 1061 brown | 214-0319 | 3 |
|
||||||||||||
9985 001100 | belden wire and cable | wire, hook up, 26awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0369 | 4 |
|
||||||||||||
9983 001100 | belden wire and cable | wire, hook up, 22awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0399 | 1 |
|
||||||||||||
9981 001100 | belden wire and cable | wire, hook up, 18awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0419 | 4 |
|
||||||||||||
9986 0011000 | belden wire and cable | wire, hook up, 28awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0469 | 1 |
|
||||||||||||
9976 0011000 | belden wire and cable | wire, hook up, 26awg, solid, semi rigid pvc, 300v, ul 1061 brown | 214-0479 | 0 |
|
||||||||||||
9985 0011000 | belden wire and cable | wire, hook up, 26awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0489 | 4 |
|
||||||||||||
9975 0011000 | belden wire and cable | wire, hook up, 24awg, solid, semi rigid pvc, 300v, ul 1061 brown | 214-0499 | 1 |
|
||||||||||||
9984 0011000 | belden wire and cable | wire, hook up, 24awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0509 | 2 |
|
||||||||||||
9983 0011000 | belden wire and cable | wire, hook up, 22awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0519 | 0 |
|
||||||||||||
9982 0011000 | belden wire and cable | wire, hook up, 20awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0529 | 2 |
|
||||||||||||
9981 0011000 | belden wire and cable | wire, hook up, 18awg, stranded, semi rigid pvc, 300v, ul 1061 brown | 214-0539 | 1 |
|
||||||||||||
8505 001100 | belden wire and cable | wire, hook up, 26awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0569 | 6 |
|
||||||||||||
8504 001100 | belden wire and cable | wire, hook up, 24awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0579 | 9 |
|
||||||||||||
8503 001100 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0589 | 10 |
|
||||||||||||
8502 001100 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0599 | 5 |
|
||||||||||||
8501 001100 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0609 | 3 |
|
||||||||||||
8504 0011000 | belden wire and cable | wire, hook up, 24awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0649 | 1 |
|
||||||||||||
8525 001100 | belden wire and cable | wire, hook up, 24awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0709 | 2 |
|
||||||||||||
8503 0011000 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0659 | 4 |
|
||||||||||||
8502 0011000 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0669 | 2 |
|
||||||||||||
8501 0011000 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0679 | 7 |
|
||||||||||||
8500 0011000 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 600v, mil-w-16878/1 type b brown | 214-0689 | 0 |
|
||||||||||||
8524 001100 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0729 | 10 |
|
||||||||||||
8523 001100 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0749 | 5 |
|
||||||||||||
8522 001100 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0759 | 7 |
|
||||||||||||
8521 001100 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0769 | 4 |
|
||||||||||||
8520 001100 | belden wire and cable | wire, hook up, 14awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0779 | 7 |
|
||||||||||||
8525 0011000 | belden wire and cable | wire, hook up, 24awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0799 | 2 |
|
||||||||||||
8524 0011000 | belden wire and cable | wire, hook up, 22awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0819 | 2 |
|
||||||||||||
8523 0011000 | belden wire and cable | wire, hook up, 20awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0839 | 3 |
|
||||||||||||
8522 0011000 | belden wire and cable | wire, hook up, 18awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0849 | 0 |
|
||||||||||||
8521 0011000 | belden wire and cable | wire, hook up, 16awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0859 | 0 |
|
||||||||||||
8520 0011000 | belden wire and cable | wire, hook up, 14awg, stranded, pvc, 1000v, mil-w-76c type mw brown | 214-0869 | 0 |
|
||||||||||||
83023 001100 | belden wire and cable | wire, hook-up; spc; 24 awg; 19x36 strand; tfe ins.; 300v; ul awm 1180; brown | 214-0889 | 6 |
|
||||||||||||
83025 001100 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0899 | 9 |
|
||||||||||||
83026 001100 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0909 | 4 |
|
||||||||||||
83027 001100 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0919 | 5 |
|
||||||||||||
83028 001100 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0929 | 2 |
|
||||||||||||
83029 001100 | belden wire and cable | wire, hook up, high temperature, 18awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0939 | 9 |
|
||||||||||||
83030 001100 | belden wire and cable | wire, hook up, high temperature, 16awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0949 | 5 |
|
||||||||||||
83023 0011000 | belden wire and cable | wire, hook-up; spc; 24 awg; 19x36 strand; tfe ins.; 300v; ul awm 1180; brown | 214-0959 | 2 |
|
||||||||||||
83026 0011000 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0979 | 3 |
|
||||||||||||
83027 0011000 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0989 | 0 |
|
||||||||||||
83028 0011000 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 300v, ul 1180 brow | 214-0999 | 0 |
|
||||||||||||
83009 001100 | belden wire and cable | wire, hook up, high temperature, 18awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1029 | 2 |
|
||||||||||||
83010 001100 | belden wire and cable | wire, hook up, high temperature, 16awg, stranded, tfe teflon, 600v, ul 1371 brow | 214-1039 | 7 |
|
||||||||||||
83009 0011000 | belden wire and cable | wire, hook up, high temperature, 18awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1049 | 4 |
|
||||||||||||
83010 0011000 | belden wire and cable | wire, hook up, high temperature, 16awg, stranded, tfe teflon, 600v, ul 1371 brow | 214-1059 | 1 |
|
||||||||||||
83000 001100 | belden wire and cable | wire, hook up, high temperature, 30awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1069 | 3 |
|
||||||||||||
83001 001100 | belden wire and cable | wire, hook up, high temperature, 28awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1079 | 9 |
|
||||||||||||
83002 001100 | belden wire and cable | wire, hook up, high temperature, 26awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1089 | 7 |
|
||||||||||||
83003 001100 | belden wire and cable | wire, hook up, high temperature, 24awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1099 | 11 |
|
||||||||||||
83004 007100 | belden wire and cable | wire, hook-up; spc; 24 awg; 7x32 strand; tfe ins.; 600v; ul awm 1213; violet | 214-1100 | 0 |
|
||||||||||||
83004 001100 | belden wire and cable | wire, hook-up; spc; 24 awg; 7x32 strand; tfe ins.; 600v; ul awm 1213; brown | 214-1109 | 5 |
|
||||||||||||
83005 001100 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1119 | 11 |
|
||||||||||||
83006 001100 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1129 | 9 |
|
||||||||||||
83007 001100 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1139 | 9 |
|
||||||||||||
83008 001100 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1149 | 3 |
|
||||||||||||
83002 0011000 | belden wire and cable | wire, hook up, high temperature, 26awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1179 | 3 |
|
||||||||||||
83003 0011000 | belden wire and cable | wire, hook up, high temperature, 24awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1189 | 2 |
|
||||||||||||
83004 0011000 | belden wire and cable | wire, hook-up; spc; 24 awg; 7x32 strand; tfe ins.; 600v; ul awm 1213; brown | 214-1199 | 0 |
|
||||||||||||
83005 0011000 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1209 | 2 |
|
||||||||||||
83006 0011000 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1219 | 2 |
|
||||||||||||
83007 0011000 | belden wire and cable | wire, hook up, high temperature, 20awg, stranded, tfe teflon, 600v, ul 1213 brow | 214-1229 | 0 |
|
||||||||||||
83045 001100 | belden wire and cable | wire, hook up, high temperature, 28awg, stranded, tfe teflon, 250v, ul 1371 brow | 214-1269 | 0 |
|
||||||||||||
83048 001100 | belden wire and cable | wire, hook up, high temperature, 24awg, stranded, tfe teflon, 250v, ul 1371 brow | 214-1299 | 2 |
|
||||||||||||
83049 001100 | belden wire and cable | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 250v, ul 1371 brow | 214-1309 | 5 |
|
||||||||||||
83045 0011000 | belden wire and cable | wire, hook up, high temperature, 28awg, stranded, tfe teflon, 250v, ul 1371 brow | 214-1349 | 2 |
|
||||||||||||
83048 0011000 | belden wire and cable | wire, hook up, high temperature, 24awg, stranded, tfe teflon, 250v, ul 1371 brow | 214-1379 | 0 |
|
||||||||||||
39114 0011000 | belden wire and cable | 14 awg ppo hook up wire ul 600v brown | 214-1984 | 0 |
|
||||||||||||
39116 001100 | belden wire and cable | 16 awg ppo hook up wire ul 600v brown | 214-1991 | 0 |
|
||||||||||||
39118 001100 | belden wire and cable | 18 awg ppo hook up wire ul 600v brown | 214-1993 | 0 |
|
||||||||||||
39118 0011000 | belden wire and cable | 18 awg ppo hook up wire ul 600v brown | 214-1994 | 0 |
|
||||||||||||
39122 0011000 | belden wire and cable | 22 awg ppo hook up wire ul 600v brown | 214-1995 | 0 |
|
||||||||||||
39110 002100 | belden wire and cable | 10 awg ppo hook up wire ul 600v red | 214-1996 | 0 |
|
||||||||||||
39110 004100 | belden wire and cable | 10 awg ppo hook up wire ul 600v yellow | 214-2015 | 0 |
|
元器件型号 | 厂商 | 描述 | pkg qty | rohs | pb free | datasheet | 数量 | 价格 (usd) | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
4554-11004-01 | aavid thermalloy | 4554-11004-01 thermal pad | 2500 | y | y | 0 |
|
|||||||||||||
4554-11005-01 | aavid thermalloy | 4554-11005-01 thermal pad | 2500 | y | y | 0 |
|
|||||||||||||
501100b00000g | aavid thermalloy | black anodize 67 c/w dip14/16 heatsink | 1 | y | y | datasheet | 0 |
|
||||||||||||
531100b02500g | aavid thermalloy | extruded heat sink with radial fins and notched base and solderable pins. | 1 | y | y | datasheet | 0 |
|
||||||||||||
abfm1-100.000mhz-lv-t5 | abracon | abfm series 100 mhz 7 x 5 mm 2.5 v 50 ppm smt ceramic crystal clock oscillator | 500 | y | y | datasheet | 0 |
|
||||||||||||
aocjy1-10.000mhz | abracon | aocjy1 series 10 mhz 20.8 x 13.2 mm 3.3v 50 ppb through hole crystal oscillator | 1 | y | y | datasheet | 3 |
|
||||||||||||
aocjy1-10.000mhz-e-sw | abracon | aocjy1 series 10 mhz 20.8 x 13.2 mm 3.3v 200ppb through hole crystal oscillator | 1 | y | y | datasheet | 0 |
|
||||||||||||
aocjy1-100.000mhz | abracon | aocjy1 series 100mhz 20.8 x 13.2 mm 3.3v 50ppb through hole crystal oscillator | 1 | y | y | datasheet | 5 |
|
||||||||||||
aocjy1-100.000mhz-e-sw | abracon | aocjy1 series 100mhz 20.8 x 13.2 mm 3.3v 200ppb through hole crystal oscillator | 1 | y | y | datasheet | 5 |
|
||||||||||||
asem1-10.000mhz-lc-t | abracon | asem series 10 mhz 3.2 x 2.5 mm 3.3 v 50 ppm smt pure silicon clock oscillator | 1000 | y | y | datasheet | 0 |
|
||||||||||||
asfl1-10.000mhz-ec-t | abracon | asfl1 series 10 mhz 5 x 3.2 mm 3.3 v 50 ppm smt crystal clock oscillator | 1000 | y | y | datasheet | 0 |
|
||||||||||||
asfl1-10.000mhz-ek | abracon | asfl1 series 10 mhz 5 x 3.2 mm 3.3 v 30 ppm smt crystal clock oscillator | 1 | y | y | datasheet | 100 |
|
||||||||||||
asfl1-10.000mhz-ek-t | abracon | asfl1 series 10 mhz 5 x 3.2 mm 3.3 v 30 ppm smt crystal clock oscillator | 1000 | y | y | datasheet | 0 |
|
||||||||||||
asfl1-100.000mhz-ec-t | abracon | asfl1 100.000 mhz highly stable 5 x 3.2 mm 3 v 50 ppm low profile oscillator | 1000 | y | y | datasheet | 1000 |
|
||||||||||||
asfl1-100.000mhz-ecs-t | abracon | asfl1 100.000 mhz highly stable 5 x 3.2 mm 3.3 v 50 ppm low profile oscillator | 1000 | y | y | datasheet | 0 |
|
||||||||||||
asflm1-10.000mhz-c-t | abracon | asflm1 10.000 mhz mems based 5 x 3.2 mm 3 v 50 ppm smt oscillator | 1 | y | y | datasheet | 37 |
|
||||||||||||
awcr-11.00md-ammo | abracon | awcr 11 mhz industrial grade built-in capacitor through hole ceramic resonator | 2000 | y | y | datasheet | 0 |
|
||||||||||||
hxzt-11.000mhz | abracon | hxzt 11 mhz low profile high frequency leaded ceramic resonator | 1 | y | y | datasheet | 0 |
|
||||||||||||
sasf1110031 | amphenol | sas straight through hole socket | 1 | y | y | datasheet | 0 |
|
||||||||||||
e110.005 | altech corporation | e110 series 0.5 - 1.0 mm universal ferrule crimper | 1 | y | y | datasheet | 1 |
|
||||||||||||
elm031100 | amphenol | elm series pcb mount 3 position .197 mm 12-28 awg pitch euro style terminal block | 100 | n | y | datasheet | 0 |
|
||||||||||||
lusb-a111-00 | amphenol | 4 position single port socket female right angle type a panel mount usb | 1 | y | y | datasheet | 10 |
|
||||||||||||
musb-a511-00 | amphenol | 4 position single port socket right angle type a panel mount usb | 1 | y | y | datasheet | 60 |
|
||||||||||||
musb-d511-00 | amphenol | rugged usb-a,vertical" | 60 | y | y | datasheet | 0 |
|
||||||||||||
pg21-1000 | argon | pg series high temperature 7.6 mil crepe paper 1.00 inch masking tape | 1 | y | y | datasheet | 15 |
|
||||||||||||
11-001.3-152fb | aries | . | 100 | y | y | datasheet | 500 |
|
||||||||||||
11-002.25-152fb | aries | 152fb serie 11 positions 2.25inch cable jumpers | 100 | y | y | datasheet | 0 |
|
||||||||||||
dk-1611-005/g | assmann electronics | 568b color 24 awg grey 5 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 200 |
|
||||||||||||
dk-1511-001/b | assmann electronics | 568b color 24 awg black 1 foot unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 326 |
|
||||||||||||
dk-1511-001/bl | assmann electronics | 568b color 24 awg black 1 foot unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1511-001/g | assmann electronics | 568b color 24 awg grey 1 foot unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 264 |
|
||||||||||||
dk-1511-001/wh | assmann electronics | 568b color 24 awg white 1 foot unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 300 |
|
||||||||||||
dk-1511-003/b | assmann electronics | 568b color 24 awg blue 3 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1511-003/bl | assmann electronics | 568b color 24 awg black 3 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1511-003/g | assmann electronics | 568b color 24 awg grey 3 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 230 |
|
||||||||||||
dk-1511-003/wh | assmann electronics | 568b color 24 awg white 3 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1511-005/b | assmann electronics | 568b color 24 awg blue 5 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 200 |
|
||||||||||||
dk-1511-005/bl | assmann electronics | 568b color 24 awg black 5 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 1 |
|
||||||||||||
dk-1511-005/g | assmann electronics | 568b color 24 awg grey 5 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 195 |
|
||||||||||||
dk-1511-005/wh | assmann electronics | 568b color 24 awg white 5 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 170 |
|
||||||||||||
dk-1511-007/b | assmann electronics | 568b color 24 awg blue 7 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 150 |
|
||||||||||||
dk-1511-007/bl | assmann electronics | 568b color 24 awg black 7 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 300 |
|
||||||||||||
dk-1511-007/g | assmann electronics | 568b color 24 awg grey 7 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 113 |
|
||||||||||||
dk-1511-007/wh | assmann electronics | 568b color 24 awg white 7 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 150 |
|
||||||||||||
dk-1511-100/b | assmann electronics | 568b color 24 awg blue 100 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 20 |
|
||||||||||||
dk-1511-100/bl | assmann electronics | 568b color 24 awg black 100 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 12 |
|
||||||||||||
dk-1511-100/g | assmann electronics | 568b color 24 awg grey 100 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 20 |
|
||||||||||||
dk-1511-100/wh | assmann electronics | 568b color 24 awg white 100 feet unshielded booted 1:1 contacts cat5e patch cord | 1 | y | y | datasheet | 20 |
|
||||||||||||
dk-1611-001/b | assmann electronics | 568b color 24 awg blue 1 foot unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 100 |
|
||||||||||||
dk-1611-001/bl | assmann electronics | 568b color 24 awg black 1 foot unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 300 |
|
||||||||||||
dk-1611-001/g | assmann electronics | 568b color 24 awg grey 1 foot unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 300 |
|
||||||||||||
dk-1611-001/wh | assmann electronics | 568b color 24 awg white 1 foot unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 300 |
|
||||||||||||
dk-1611-003/b | assmann electronics | 568b color 24 awg blue 3 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1611-003/bl | assmann electronics | 568b color 24 awg black 3 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 240 |
|
||||||||||||
dk-1611-003/g | assmann electronics | 568b color 24 awg grey 3 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1611-003/wh | assmann electronics | 568b color 24 awg white 3 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 250 |
|
||||||||||||
dk-1611-005/b | assmann electronics | 568b color 24 awg blue 5 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 200 |
|
||||||||||||
dk-1611-005/bl | assmann electronics | 568b color 24 awg black 5 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 50 |
|
||||||||||||
dk-1611-005/wh | assmann electronics | 568b color 24 awg white 5 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 200 |
|
||||||||||||
dk-1611-007/b | assmann electronics | 568b color 24 awg blue 7 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 100 |
|
||||||||||||
dk-1611-007/bl | assmann electronics | 568b color 24 awg black 7 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 150 |
|
||||||||||||
dk-1611-007/g | assmann electronics | 568b color 24 awg grey 7 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 0 |
|
||||||||||||
dk-1611-007/wh | assmann electronics | 568b color 24 awg white 7 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 100 |
|
||||||||||||
dk-1611-100/b | assmann electronics | 568b color 24 awg blue 100 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 12 |
|
||||||||||||
dk-1611-100/bl | assmann electronics | 568b color 24 awg black 100 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 12 |
|
||||||||||||
dk-1611-100/g | assmann electronics | 568b color 24 awg grey 100 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 12 |
|
||||||||||||
dk-1611-100/wh | assmann electronics | 568b color 24 awg white 100 feet unshielded booted 1:1 contacts cat6 patch cord | 1 | y | y | datasheet | 12 |
|
||||||||||||
as1100/06/07db | austriamicrosystems | demonstration board for as1100, as1106 and as1107 8-digit 7-segment led driver | 1 | n | n | datasheet | 0 |
|
||||||||||||
as1100pl | austriamicrosystems | as series 330 ma 5.5 v through hole spi interface 8-digit led driver - pdip-24 | 1 | y | y | datasheet | 0 |
|
||||||||||||
as1100wl | austriamicrosystems | as series 330 ma 5.5 v surface mount spi interface 8-digit led driver - soic-24 | 1 | y | y | datasheet | 67 |
|
||||||||||||
aedr-8501-100 | avago technologies | encoders reflective encoder 3 ch w/ interpolator | 1000 | y | y | datasheet | 0 |
|
||||||||||||
assr-1411-001e | avago technologies | relay ssr spst sgl 0.6a 6dip | 50 | y | y | datasheet | 0 |
|
||||||||||||
assr-5211-001e | avago technologies | assr series spst 0.2 a 600 v single channel solid state relay through hole-dip-6 | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcnw2211-000e | avago technologies | dip8 through hole single channel 5000 vrms very high cmr logic gate optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcnw2611-000e | avago technologies | dip8 through hole single channel 5000vrms high speed ttl compatible optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-0211-000e | avago technologies | so-8 single channel 3750 vrms 5 mbd very high cmr logic gate optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-0611-000e | avago technologies | so8 surface mount single channel 3750 vrms high speed ttl compatible optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-2211-000e | avago technologies | dip8 through hole single channel 3750 vrms 5 mbd logic gate optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-2411-000e | avago technologies | dip8 through hole single channel 3750 vrm 20 mbd logic gate optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-2611-000e | avago technologies | dip8 through hole single channel 3750 vrm 10 mbd compatible optocoupler | 1 | y | y | datasheet | 0 |
|
||||||||||||
hcpl-m611-000e | avago technologies | so-5 surface mount single channel 3750 vrms 10 mbd logic gate optocoupler | 1 | y | y | datasheet | 37 |
|
||||||||||||
110-030 | bivar | 110 series to-18 / t-1 3/4 led mounts .100 " high nylon perm-o-pad | 1000 | y | y | datasheet | 2000 |
|
||||||||||||
006208505110000+ | avx | 6208 series 5 position 1 mm pitch vertical slide lock connector surface mount | 1000 | y | y | datasheet | 0 |
|
||||||||||||
006208509110000+ | avx | 1.0mm pitch 10 positions zif smt ffc connector with slide lock | 1 | y | y | datasheet | 1000 |
|
||||||||||||
006208509110000+ | avx | 9 position 2 mm pitch straight solder smt fcc/fpc connector | 1000 | y | y | datasheet | 14000 |
|
||||||||||||
009176001011006 | avx | 9176 series wire to board receptacle press fit discrete wire idc surface mount | 1000 | y | y | datasheet | 0 |
|
||||||||||||
009176002011006 | avx | 9176 series wire to board receptacle press fit discrete wire idc surface mount | 1 | y | y | datasheet | 1100 |
|
||||||||||||
009176002011006 | avx | 9176 series wire to board receptacle 4 mm press fit discrete wire idc | 1000 | y | y | datasheet | 3000 |
|
||||||||||||
009176003011006 | avx | 9176 series wire to board receptacle press fit discrete wire idc surface mount | 1 | y | y | datasheet | 100 |
|
||||||||||||
009176003011006 | avx | 9176 series 3 way awg 14 - 28 discrete wire idc surface mount | 1000 | y | y | datasheet | 0 |
|
||||||||||||
178072110001863+ | avx | 110 position 5 row right angle din header | 20 | y | y | 0 |
|
|||||||||||||
278072110011863+ | avx | 110 position 2.0 mm hard metric socket | 20 | y | y | datasheet | 0 |
|
||||||||||||
609176001521100 | avx | 9176 series 1 way 1.6 - 2.1 mm white discrete wire cap | 1000 | y | y | datasheet | 0 |
|
||||||||||||
709176001511006 | avx | 9176 series 1 way 20 gauge stranded discrete wire idc contact | 1000 | y | y | datasheet | 0 |
|
||||||||||||
tlja227m004r1100 | avx | tlj series 220 uf 20 % 4 v smt solid electrolytic tantalum chip capacitor | 2000 | y | y | datasheet | 0 |
|
||||||||||||
tljt227m004r1100 | avx | tlj series 220 uf 20 % 4 v smt solid electrolytic tantalum chip capacitor | 1 | y | y | 0 |
|
|||||||||||||
tljt227m004r1100 | avx | tlj series 220 uf 20 % 4 v smt solid electrolytic tantalum chip capacitor | 2500 | y | y | 0 |
|
|||||||||||||
901-100 | bivar | 901 series universal .100 in long nylon tubular spacer | 1 | y | y | datasheet | 10039 |
|
||||||||||||
911-100 | bivar | 911 series universal .100 in long nylon tubular spacer | 1 | y | y | datasheet | 0 |
|
||||||||||||
941-100 | bivar | 900 series 0.100 mm natural nylon tubular spacer | 1 | y | y | datasheet | 0 |
|
元器件型号 | 厂商 | 描述 | rs # | 数量 china |
---|---|---|---|---|
62c64-1100ec | 3m | 64/96 way idc cable socket w/o mount ear | 4992262 | 90 |
81100-500203-rb | 3m | miniature he10 male 100 ways | 6288565 | 65 |
81100-600203-rb | 3m | miniature he10 male 100 ways | 6288515 | 25 |
89110-0101 | 3m | 3m 10w bump skt class 3 | 1927445 | 9 |
89110-0101ha | 3m | 10way bump pre-assemble polarised socket | 3237845 | 1061 |
l25330911000 | abb | l253 pcb hor male rect socket 3.81mm 9w | 4572458 | 5 |
1ssa042202r1100 | abb | 2 way vertical header 3.5mm pitch | 195016 | 790 |
l25610211000 | abb | l256 pcb ver male tile socket 7.62mm,2w | 4572622 | 15 |
1ssa455107r1100 | abb | 7 way vertical closed header 5.08mm | 195303 | 5 |
l25630211000 | abb | l256 pcb hor male tile socket 7.62mm,2w | 4572644 | 250 |
1ssa455304r1100 | abb | 4 way horizontal closed header 5.08mm | 195353 | 175 |
l04520211000 | abb | 2 way vertical screw header 5,08mm pitch | 6536886 | 20 |
l04520311000 | abb | 3 way vertical screw header 5,08mm pitch | 6536965 | 80 |
l25311011000 | abb | l253 pcb ver male rect socket 3.81mm 10w | 4572420 | 5 |
l25630311000 | abb | l256 pcb hor male tile socket 7.62mm,3w | 4572650 | 240 |
l34520811000 | abb | l345 pcb male tile plug 5.08mm 8w | 4575750 | 5 |
l35510211000 | abb | l355 pcb ver female tile sock 5.08mm 2w | 4575788 | 10 |
l35510511000 | abb | l355 pcb ver female tile sock 5.08mm 5w | 4575823 | 50 |
l35510811000 | abb | l355 pcb ver female tile sock 5.08mm 8w | 4575845 | 5 |
l35531011000 | abb | l355 pcb hor female tile plug 5.08mm 10w | 4575968 | 30 |
hcnw2211-000e | agilent technologies | optocoupler(5mbd),lf | 2509068897 | 1 |
hcpl-2211-000e | agilent technologies | optocoupler, hcpl-2211-000e | 2509069008 | 1 |
n6705b | agilent technologies | dc power analyzer mainframe | 7110012 | 1 |
aia-5003-11-00-90-10-aa-04 | amphenol | right angle backshell 11screened | 5108424 | 61 |
c016g11000e10v | amphenol | backshell, ecomate, mixed | 503647 | 505 |
adum1100brz | analog devices | adum1100b 100mbps bus isolator | 4972072 | 34 |
adum1100arz | analog devices | adum1100a 25mbps bus isolator | 4972066 | 115 |
adum1100arz | analog devices | adum1100a 25mbps bus isolator | 4972066p | 561 |
adum1100brz | analog devices | adum1100b 100mbps bus isolator | 4972072p | 78 |
adum1100urz | analog devices | adum1100u 100mbps 125 degc bus isolator | 4972088 | 11 |
adum1100urz | analog devices | adum1100u 100mbps 125 degc bus isolator | 4972088p | 37 |
230mltb9w2 | apem | mbc led multi lamp,230v 2w | 211005 | 49 |
301.110.02 | apem | keypad,membrane,blk & wht button,snap in | 6931247 | 18 |
iar5f1100 | apem | switch,p/button,blue actuator,wired | 6917884 | 9 |
ikn0200000 | apem | 2 way low profile tape sealed dil switch | 2911003 | 40 |
ikn0200000 | apem | 2 way low profile tape sealed dil switch | 2911003p | 530 |
sf36s011100 | apem | single pole esd toggle switch, 2a 250vac | 2369222 | 6 |
sf39s011100 | apem | esd toggle switch on-off-on, 2a 250vac | 2369238 | 5 |
hs75 47r j | arcol | hs75 al house wirewound resistor,47r 75w | 3091100 | 20 |
hs75 47r j | arcol | hs75 al house wirewound resistor,47r 75w | 3091100p | 87 |
a72qk1100za00m | arcotronics | caps polyprop 0.001uf | 114547p | 2490 |
a72qk1100za00m | arcotronics | kp172 axial polyprop cap,1nf 1kv | 114547 | 4065 |
fkp02/0.01/100/5 | arcotronics | cap,400v,0.001uf,5mm,5% | 3121649p | 1170 |
fkp02/0.01/100/5 | arcotronics | r82 radial poly cap,1nf 400v 5mm | 3121649 | 1200 |
r413f1100jy00k | arcotronics | cap y2 film 1.0nf r41 | 4419824p | 2720 |
r413f1100jy00k | arcotronics | r41 wire ended cap,1nf 300vac | 4419824 | 1050 |
r73ti1100se00j | arcotronics | caps polyprop 1000pf | 821122p | 965 |
r73ti1100se00j | arcotronics | radial polyprop cap,1nf 1.6kv 15mm | 821122 | 6440 |
r73ui1100se00j | arcotronics | caps polyprop 1000pf | 821188p | 13110 |
r73ui1100se00j | arcotronics | radial polyprop cap,1nf 2kv 15mm | 821188 | 5735 |
acpl-p611-000e | avago | optocoupler logic-out dc i/p 1-ch soic6 | 6936021p | 616 |
acpl-w611-000e | avago | optocoupler logic-out dc i/p 1-ch soic6 | 6936031 | 134 |
acpl-w611-000e | avago | optocoupler logic-out dc i/p 1-ch soic6 | 6936031p | 94 |
assr-1611-001e | avago | relay ssr 2.5a 60v ac/dc-o/p pdip6 | 6936895 | 37 |
assr-1611-001e | avago | relay ssr 2.5a 60v ac/dc-o/p pdip6 | 6936895p | 82 |
assr-4110-003e | avago | relay ssr 0.12a 400v ac/dc-o/p soic4 | 6936911p | 100 |
assr-5211-001e | avago | relay ssr 0.2a 600v ac/dc-o/p pdip6 | 6936918 | 7 |
assr-5211-001e | avago | relay ssr 0.2a 600v ac/dc-o/p pdip6 | 6936918p | 164 |
hcpl-0211-000e | avago | optocoupler (5mbd),hcpl-0211 | 450795 | 7 |
hcpl-0211-000e | avago | optocoupler (5mbd),hcpl-0211 | 450795p | 275 |
hcpl-0611-000e | avago | optocoupler (10mbd),hcpl-0611 | 450880 | 46 |
hcpl-2211-000e | avago | optocoupler(5mbd),lf | 2509649156 | 1 |
hcpl-2611-000e | avago | opto-isolator hcpl 2611 | 5473829 | 189 |
hcpl-2611-000e | avago | opto-isolator hcpl 2611 | 5473829p | 41 |
hcpl-7611-000e | avago | high cmr opto-isolator,hcpl7611 10mbd | 5473942p | 44 |
hcpl-7611-000e | avago | high cmr opto-isolator,hcpl7611 10mbd | 5473942 | 35 |
8500 001100 | belden | wire, hook up, 16awg, stranded, pvc, 600v, mil-w-16878/1 type b brown; 30m | 2509138003 | 30 |
8919 001100 | belden | wire, hook up, 20awg, stranded, pvc, 600v, ul 1015 brown; 30m | 2509142939 | 30 |
9923 001100 | belden | wire, hook up, 24awg, stranded, pvc, 300v, ul 1007/1569 brown; 30m | 2509148369 | 30 |
9926 001100 | belden | wire, hook up, 26awg, stranded, pvc, 300v, ul 1007/1569 brown; 30m | 2509148612 | 30 |
9982 001100 | belden | wire; hook up; 20awg; stranded; semi rigid pvc; 300v; ul 1061 brown; 30m | 2508350586 | 30 |
9986 001100 | belden | wire, hook up, 28awg, stranded, semi rigid pvc, 300v, ul 1061 brown; 30m | 2509151292 | 30 |
83050 001100 | belden | wire, hook up, high temperature, 22awg, stranded, tfe teflon, 250v, ul 1371 brow | 2509136316 | 30 |
3296p-1-100lf | bourns | 3296p side adj cermet trimmer,10r 10mm | 5219467 | 8 |
3296p-1-100lf | bourns | 3296p side adj cermet trimmer,10r 10mm | 5219467p | 85 |
3296w-1-100lf | bourns | 3296w top adj cermet trimmer,10r 10mm | 5219619 | 238 |
3296w-1-100lf | bourns | 3296w top adj cermet trimmer,10r 10mm | 5219619p | 350 |
3296x-1-100lf | bourns | 3296x side adj cermet trimmer,10r 10mm | 5219833 | 309 |
3296x-1-100lf | bourns | 3296x side adj cermet trimmer,10r 10mm | 5219833p | 253 |
3296y-1-100lf | bourns | 3296y top adj cermet trimmer,10r 10mm | 5220035 | 174 |
3296y-1-100lf | bourns | 3296y top adj cermet trimmer,10r 10mm | 5220035p | 106 |
3299w-1-100lf | bourns | 3299w top adj cermet trimmer,10r 10mm | 5220259 | 38 |
3299w-1-100lf | bourns | 3299w top adj cermet trimmer,10r 10mm | 5220259p | 105 |
3314g-1-100e | bourns | 3314g smt top adj cermet trimmer,10r 4mm | 1001076 | 100 |
3314g-1-100e | bourns | 3314g smt top adj cermet trimmer,10r 4mm | 1001076p | 520 |
4816p-t01-100lf | bourns | res net smd med body, 16pins, t01,10r | 6917459p | 1890 |
mf-r1100 | bourns | fuse, ptc, resettable, radial, 11.0a | 6478651 | 810 |
mf-r1100 | bourns | fuse, ptc, resettable, radial, 11.0a | 6478651p | 4900 |
bzh01/z0000/11 | bulgin | dp snap-in fused horizontal plug w/neon | 2111001 | 590 |
n13-032-03-002711000 | chin nan | bnc straight socket/socket adaptor,50ohm | 5464926 | 2962 |
n13-039-05-000211000 | chin nan | ni plated straight bnc goalpost adaptor | 3034961 | 1623 |
n13-060-01-000211000 | chin nan | 50ohm strt pcb skt | 5260279 | 619 |
n13-060-02-000211000 | chin nan | nipt bnc r/a insulated pcb socket,50ohm | 5265864 | 674 |
r11-001-07-042611000 | chin nan | nipt n plug for rg213u cable,50ohm 1500v | 5462469 | 2869 |
r11-026-00-002611000 | chin nan | rs nseries nipt jack/jack/jack t adaptor | 404963 | 204 |
r11-027-00-002611000 | chin nan | rs nseries nipt jack/jack/plug t adaptor | 5462481 | 761 |
r11-032-00-003311000 | chin nan | silverpt male n to female bnc adaptor | 5462453 | 848 |
r11-033-00-000111000 | chin nan | nickelpt male n to female tnc adaptor | 5462504 | 425 |
r12-001-01-010111000 | chin nan | nipt crimp mini uhf strt sokt-rg58 cable | 5462526 | 554 |
r12-003-01-010111000 | chin nan | nipt crimp mini uhf strt plug-rg58 cable | 5462510 | 773 |
元器件型号 | manufacturer | 描述 | 数量 |
---|---|---|---|
as1100pe | austriamicrosystems ag | led driver, 64 outputs, 5ma per output, 3% led to led matching, pdip-24, multiplexed, 5.0v supply, tube | 3 |
as1100we-t | austriamicrosystems ag | led driver, 64 outputs, 5ma per output, 3% led to led matching, soic-24, multiplexed, 5.0v supply, (t/r) | 2 |
as1100wl-t | austriamicrosystems ag | led driver, 64 outputs, 5ma per output, 3% led to led matching, soic-24, multiplexed, 5.0v supply, (t/r) | 98 |
rl-5480-1-1000 | renco electronics inc. | mini drum inductors 1000uh, tray | 2394 |
02110002-000 | schaevitz sensors | clin std ratio ver ce pt 18, bulk | 106 |
02111002-000 | schaevitz sensors | clin std analog ver w/emi pt 18, bulk | 46 |
02350511-000 | schaevitz sensors | ga-hd gcd-121-250 assy, bulk | 9 |
02560411-000 | schaevitz sensors | lvdt, ac operated, mhr series, general purpose, 0.5" stroke length, 0.375" body diameter, bulk | 3 |
62101011-000 | schaevitz sensors | conn bndx pt 06a-10-6s(sr), bulk | 30 |
in110-001 | sirit, inc. | small multi-protocol hf module , bulk | 19 |
971100-3 | solartron metrology | orbit 3, digital probe, 2mm stroke length, spring actuation, 8h6 diameter, axial, t/c tip, bulk | 7 |
元器件型号 | 厂商 | 描述 | 数量 | 价格 | |
---|---|---|---|---|---|
8521-1000 whtgrn | belden wire | single conductor, 16 awg, white / green pvc, hook up wire - 1000 ft | 1 |
|
|
8651-100 | belden wire | single conductor, 14 awg, green / white primary wire (obs) wire - 100 ft | 6 |
|
|
8411-100 chr | belden wire | single conductor, 25 awg, chrome pvc, 52 ohm sheilded microphone cable wire - 100 ft | 42 |
|
|
8521-1000 whtgry | belden wire | single conductor, 16 awg, white / green pvc, hook up wire - 1000 ft | 1 |
|
|
lm1100 | waber | 6 |
|
||
260-0110-001 | johnson components | (disc) | 50 |
|
|
p1100-hc-14.31818m | pletronics | 125 |
|
||
p1100-hc-24.0m | pletronics | 219 |
|
||
4116r-1-100 | bourns | 415 |
|
||
501-1002 | dialight | 88 |
|
||
554-2131-100 | dialight | 80 |
|
||
554-2231-100 | dialight | 391 |
|
||
561-2101-100 | dialight | 655 |
|
||
571-1121-1001-011 | dialight | 25 |
|
||
554-2221-100 | dialight | 307 |
|
||
561-2501-100 | dialight | 280 |
|
||
573-1119-0301-100 | dialight | 230 |
|
||
573-1313-0101-100 | dialight | 65 |
|
||
mdl-1/100 | bussmann | 345 |
|
||
tc511000ap-10 | toshiba | pulls | 144 |
|
|
74ac11004dwr | texas instruments | 1617 |
|
||
74act11000dr | texas instruments | 1255 |
|
||
74act11004d | texas instruments | 399 |
|
||
smm-110-02-s-d-p | samtec inc | 96 |
|
||
tc511000az-80 | toshiba | 303 |
|
||
2ec1100-32.000mhz | ecliptek | 32.000 mhz crystal occilator | 1138 |
|
|
rn1/2wt110-0k1 | seiko | 2500 |
|
||
9851-100 | belden wire | 2 conductor, 29 awg, chrome pvc, 200 ohm twinaxial cable wire - 100 ft | 1 |
|
|
95-9110-09-102 | dialight | 309 |
|
||
mle-110-01-g-dv-tr | samtec inc | 125 |
|
||
p1100-hc 32.260mhz | plet | 55 |
|
||
sm1100jep | plet | 240 |
|
||
31-321-1005 | amp | 197 |
|
||
8101-100-x7r0-102k | arco | radial leads capacitor - 1000pf 100v 10% | 294 |
|
|
8101-100-x7r0-222k | arco | radial leads capacitor - 2200pf 100v 10% | 200 |
|
|
8101-100-x7r0-471k | arco | radial leads capacitor - 470pf 100v 10% | 102 |
|
|
a-110-06 | molex | hook krimptite (a-110-06) | 1600 |
|
|
f02b250v1/100a-s | bussmann | 345 |
|
||
f1100bb01 | corcom | 72 |
|
||
s-1100 | molex | krimptite? ring tongue terminal for 10-12 awg wire, stud size 1/4, length 24.18mm (.952) | 2400 |
|
|
106110-0000 | molex | st adapter zr sleeve | 75 |
|
|
19211-0003 | molex | wirepinterms krimptite awg | 11212 |
|
|
19211-0005 | molex | wirepinterms krimptite awg | 2395 |
|
|
19401-1000 | molex | 3cir self-con splice connec | 706 |
|
|
25001-1002 | molex | standard cable jumper 250011002 | 1699 |
|
|
25001-1004 | molex | 3669 |
|
||
33011-0004 | molex | mx150 bld term gold 16-20awg d wind | 30000 |
|
|
47151-1001 | molex | 948 |
|
||
47151-1005 | molex | 480 |
|
||
501330-1100 | molex | 4000 |
|
||
501331-1007 | molex | 2200 |
|
||
51110-0850 | molex | 2mm mgrid wtb rec crp hsg p | 2650 |
|
|
51110-0851 | molex | 2mm mgrid wtb rec crp hsg p | 3670 |
|
|
63811-0000 | molex | tool 638110000 | 9 |
|
|
63811-1000 | molex | 303 |
|
||
74061-1004 | molex | 15 |
|
||
85011-0036 | molex | 1182 |
|
||
001100 | hammond ma | clipper 60x40x18 hand held bk | 31 |
|
|
1421pcb1-100 | hammond ma | 1/4 inch pcb s-offs slef stk 100pc | 13 |
|
|
pf11000t12bk | hammond ma | 3 |
|
||
pf11000t12bk230 | hammond ma | 2 |
|
||
pf11000t12lg | hammond ma | 16 cfm filter fan t12 | 17 |
|
|
pf11000t12lg230 | hammond ma | 2 |
|
||
pf11000t12lg24 | hammond ma | 16 cfm filter fan t12 | 11 |
|
|
r110-081-000 | hammond ma | 34 |
|
||
r110-082-000 | hammond ma | allum diecast enclosure | 51 |
|
|
r110-083-000 | hammond ma | allum diecast enclosure | 64 |
|
|
r144-311-000 | hammond ma | taraplus rectangle tube 1m | 17 |
|
|
r190-110-000 | hammond ma | rolec alucase enclosure | 40 |
|
|
r251-100-160 | hammond ma | rolec mobilcase extrusion | 25 |
|
|
r251-100-200 | hammond ma | rolec mobilcase extrusion | 18 |
|
|
r271-100-000 | hammond ma | alum diecast encl | 15 |
|
|
r581-100-000 | hammond ma | rolec mobilcase 100 end panels | 113 |
|
|
agc-1/100 | bussmann | buss small dimension fuse fast acting | 45 |
|
part# | 厂商 | rohs | 数量 |
---|---|---|---|
511-00006 | 3m interconnect | y | 95 |
89110-0101 | 3m interconnect | y | 20 |
iar3f1100 | apem components | unknown | 100 |
1231-100 | alpha wire & tubing | y | 2 |
1551-100-1 | alpha wire & tubing | y | 5 |
1551-100-2 | alpha wire & tubing | y | 10 |
1551-100-3 | alpha wire & tubing | y | 3 |
1551-1000-1 | alpha wire & tubing | y | 2 |
1551-1000-15 | alpha wire & tubing | y | 2 |
1551-1000-2 | alpha wire & tubing | y | 7 |
1551-1000-3 | alpha wire & tubing | y | 1 |
1551-1000-4 | alpha wire & tubing | y | 5 |
1551-1000-6 | alpha wire & tubing | y | 1 |
1551-1000-7 | alpha wire & tubing | y | 2 |
1551-1000-8 | alpha wire & tubing | y | 1 |
1561-100-2 | alpha wire & tubing | y | 1 |
1561-100-3 | alpha wire & tubing | y | 1 |
1561-1000-2 | alpha wire & tubing | y | 1 |
1561-1000-4 | alpha wire & tubing | y | 1 |
2171-100 | alpha wire & tubing | y | 2 |
2841/1-100-10 | alpha wire & tubing | y | 12 |
2841/1-100-2 | alpha wire & tubing | y | 11 |
2841/1-100-5 | alpha wire & tubing | y | 1 |
2841/1-100-6 | alpha wire & tubing | y | 2 |
2855/1-1000-1 | alpha wire & tubing | y | 1 |
299/1-100 | alpha wire & tubing | y | 2 |
3051-100-1 | alpha wire & tubing | y | 23 |
3051-100-10 | alpha wire & tubing | y | 2 |
3051-100-12 | alpha wire & tubing | y | 2 |
3051-100-13 | alpha wire & tubing | y | 2 |
3051-100-2 | alpha wire & tubing | y | 20 |
3051-100-3 | alpha wire & tubing | y | 34 |
3051-100-4 | alpha wire & tubing | y | 5 |
3051-100-5 | alpha wire & tubing | y | 2 |
3051-100-6 | alpha wire & tubing | y | 3 |
3051-100-7 | alpha wire & tubing | y | 19 |
3051-100-9 | alpha wire & tubing | y | 7 |
3051-1000-1 | alpha wire & tubing | y | 8 |
3051-1000-2 | alpha wire & tubing | y | 41 |
3051-1000-3 | alpha wire & tubing | y | 25 |
3051-1000-4 | alpha wire & tubing | y | 10 |
3051-1000-7 | alpha wire & tubing | y | 1 |
3051-1000-8 | alpha wire & tubing | y | 1 |
3051/1-1000-2 | alpha wire & tubing | y | 1 |
3051/1-1000-3 | alpha wire & tubing | y | 1 |
3071-100-2 | alpha wire & tubing | y | 2 |
5951-1000-3 | alpha wire & tubing | y | 1 |
6711-1000-1 | alpha wire & tubing | y | 10 |
6711-1000-10 | alpha wire & tubing | y | 5 |
6711-1000-3 | alpha wire & tubing | y | 2 |
6711-1000-4 | alpha wire & tubing | y | 5 |
6711-1000-5 | alpha wire & tubing | y | 5 |
6711-1000-6 | alpha wire & tubing | y | 4 |
6711-1000-7 | alpha wire & tubing | y | 5 |
6711-1000-8 | alpha wire & tubing | y | 10 |
6711-1000-9 | alpha wire & tubing | y | 5 |
7131-100-5 | alpha wire & tubing | n | 3 |
grp130-1-100b | alpha wire & tubing | y | 2 |
grp130-1-100or | alpha wire & tubing | y | 2 |
1231-100 | alpha wire & tubing | y | 2 |
grp130nf-1-100b | alpha wire & tubing | y | 2 |
pvc105-1-100c | alpha wire & tubing | y | 3 |
1551-100-1 | alpha wire & tubing | y | 5 |
1551-100-2 | alpha wire & tubing | y | 10 |
1551-100-3 | alpha wire & tubing | y | 3 |
1551-1000-1 | alpha wire & tubing | y | 2 |
1551-1000-15 | alpha wire & tubing | y | 2 |
1551-1000-2 | alpha wire & tubing | y | 7 |
1551-1000-3 | alpha wire & tubing | y | 1 |
1551-1000-4 | alpha wire & tubing | y | 5 |
1551-1000-6 | alpha wire & tubing | y | 1 |
1551-1000-7 | alpha wire & tubing | y | 2 |
1551-1000-8 | alpha wire & tubing | y | 1 |
1561-100-2 | alpha wire & tubing | y | 1 |
1561-100-3 | alpha wire & tubing | y | 1 |
1561-1000-2 | alpha wire & tubing | y | 1 |
1561-1000-4 | alpha wire & tubing | y | 1 |
2171-100 | alpha wire & tubing | y | 2 |
2841/1-100-10 | alpha wire & tubing | y | 12 |
2841/1-100-2 | alpha wire & tubing | y | 11 |
2841/1-100-5 | alpha wire & tubing | y | 1 |
2841/1-100-6 | alpha wire & tubing | y | 2 |
2855/1-1000-1 | alpha wire & tubing | y | 1 |
299/1-100 | alpha wire & tubing | y | 2 |
3051-100-1 | alpha wire & tubing | y | 23 |
3051-100-10 | alpha wire & tubing | y | 2 |
3051-100-12 | alpha wire & tubing | y | 2 |
3051-100-13 | alpha wire & tubing | y | 2 |
3051-100-2 | alpha wire & tubing | y | 20 |
3051-100-3 | alpha wire & tubing | y | 34 |
3051-100-4 | alpha wire & tubing | y | 5 |
3051-100-5 | alpha wire & tubing | y | 2 |
3051-100-6 | alpha wire & tubing | y | 3 |
3051-100-7 | alpha wire & tubing | y | 19 |
3051-100-9 | alpha wire & tubing | y | 7 |
3051-1000-1 | alpha wire & tubing | y | 8 |
3051-1000-2 | alpha wire & tubing | y | 41 |
3051-1000-3 | alpha wire & tubing | y | 25 |
3051-1000-4 | alpha wire & tubing | y | 10 |
3051-1000-7 | alpha wire & tubing | y | 1 |
元器件型号 | 厂商 | 描述 | mcm # | 数量 | 价格 | |
---|---|---|---|---|---|---|
re01522 | distributed by mcm | reo1522 resistor 4w 100 ohm wi meggett 5 per bag | 451-100 | 20 |
|
|
4610911006 | denon electronics | foot sheetdn-t620 | 4610911006 | 0 |
|
|
4630811005 | denon electronics | spring | 4630811005 | 0 |
|
|
4790a11001a | lg electronics | barrier,single | 4790a11001a | 0 |
|
|
4890ja1100w | lg electronics | decor,glass door | 4890ja1100w | 0 |
|
|
4970h-1100a | lg electronics | spring | 4970h-1100a | 0 |
|
|
4h01100a | lg electronics | nut-fv | 4h01100a | 0 |
|
|
5004jd1100h | lg electronics | basket,door | 5004jd1100h | 0 |
|
|
5027ja1100a | lg electronics | shelf assembly,r | 5027ja1100a | 0 |
|
|
5027jj1100a | lg electronics | shelf assembly,freezer | 5027jj1100a | 0 |
|
|
5027jj1100b | lg electronics | shelf assembly,freezer | 5027jj1100b | 0 |
|
|
5027jj1100h | lg electronics | shelf assembly,freezer | 5027jj1100h | 0 |
|
|
5027jj1100k | lg electronics | shelf assembly,freezer | 5027jj1100k | 0 |
|
|
5027jj1100l | lg electronics | shelf assembly,freezer | 5027jj1100l | 0 |
|
|
5027jj1100m | lg electronics | shelf assembly,freezer | 5027jj1100m | 0 |
|
|
5040h-1100a | lg electronics | rubber | 5040h-1100a | 0 |
|
|
511-002evcr | lg electronics | pwb assy power 2, ghv-41fm | 511-002evcr | 0 |
|
|
511-002m | lg electronics | pwb assypower 2ghv-41fm s | 511-002m | 0 |
|
|
511-007a | lg electronics | pwb assy adapter, vr-031 | 511-007a | 0 |
|
|
511-008a | lg electronics | pwb assy earphone, vr-031 | 511-008a | 0 |
|
|
pl42bl | pyle | pyle blue label 4”””” 2 way speaker pair - 180w max | 51-1100 | 0 |
|
|
511-100b | lg electronics | pwb assy main, fmh-19a ug2 | 511-100b | 0 |
|
|
5210a21100a | lg electronics | tube,discharge | 5210a21100a | 0 |
|
|
5210a21100b | lg electronics | tube,discharge | 5210a21100b | 0 |
|
|
5210a21100c | lg electronics | tube,discharge | 5210a21100c | 0 |
|
|
5210a21100e | lg electronics | tube,discharge | 5210a21100e | 0 |
|
|
5300jb1100d | lg electronics | heater,sheath | 5300jb1100d | 0 |
|
|
541110068008d | denon electronics | instruction manual avr2309ci | 541110068008d | 0 |
|
|
di600p | behringer | ultra_di high performance passive direct injection box | 555-11000 | 5 |
|
|
di400p | behringer | ultra-di direct injection box | 555-11005 | 0 |
|
|
epa300 | behringer | europort ultra-compact 300w 6-channel portable pa system with digital fx | 555-11100 | 1 |
|
|
831-10008 | lg electronics | fan | 831-10008 | 0 |
|
|
1100bla | windtech | microphone windscreen blacklapel mic style | 555-755 | 28 |
|
|
pt1100 | pyle | professional pa amplifierrack mount 200w x 2ch | 555-9410 | 8 |
|
|
pyd1100 | pyle pro | professional four channel dj mixer | 555-9940 | 1 |
|
|
561-100b | lg electronics | connector terminal speaker sp | 561-100b | 0 |
|
|
561-100d | lg electronics | connector terminal speaker ffh | 561-100d | 0 |
|
|
571-100a | lg electronics | jack phone hsj0924-01-010 | 571-100a | 0 |
|
|
580110026aaa | lg electronics | coil-pif det 9060a | 580110026aaa | 0 |
|
|
580110027aaa | lg electronics | coil-sif det ty9059 | 580110027aaa | 0 |
|
|
rt-1100 natural | distributed by mcm | 500 pack natural wire ties 11 1/2" | 58-15095 | 154 |
|
|
rt-1100 uv black | distributed by mcm | 500 pack black wire ties 11 1/2" | 58-15100 | 30 |
|
|
5900v11001c | lg electronics | fan,dc | 5900v11001c | 0 |
|
|
5900v11001d | lg electronics | fan,dc | 5900v11001d | 0 |
|
|
5900v11001f | lg electronics | fan,dc | 5900v11001f | 0 |
|
|
611-007a | lg electronics | vr variable k121l0g-200kb ga | 611-007a | 0 |
|
|
611-009a | lg electronics | vr rotary k122jo(h=10,l=25)a | 611-009a | 0 |
|
|
6150z-1100b | lg electronics | dy(deflection yoke) | 6150z-1100b | 0 |
|
|
6150z-1100e | lg electronics | dy(deflection yoke) | 6150z-1100e | 0 |
|
|
6170911000 | dynex | speakerdx-32l200a12 | 6170911000 | 0 |
|
|
6174911001b | lg electronics | transformer,fbt | 6174911001b | 0 |
|
|
6174911001d | lg electronics | transformer,fbt | 6174911001d | 0 |
|
|
6174t11001a | lg electronics | fbt (fly back transformer) | 6174t11001a | 0 |
|
|
6174t11001c | lg electronics | fbt (fly back transformer) | 6174t11001c | 0 |
|
|
6174t11002a | lg electronics | fbt (fly back transf | 6174t11002a | 0 |
|
|
6174t11002b | lg electronics | fly back transformer | 6174t11002b | 0 |
|
|
6174t11002d | lg electronics | fbt (fly back transformer) | 6174t11002d | 0 |
|
|
6174t11002e | lg electronics | fbt (fly back transf | 6174t11002e | 0 |
|
|
6174t11003a | lg electronics | fbt (fly back transf | 6174t11003a | 0 |
|
|
6174t11003b | lg electronics | fbt (fly back transf | 6174t11003b | 0 |
|
|
6174t11003e | lg electronics | fbt (fly back transf | 6174t11003e | 0 |
|
|
6174t11004a | lg electronics | fbt (fly back transf | 6174t11004a | 0 |
|
|
6174t11004e | lg electronics | fbt (fly back transf | 6174t11004e | 0 |
|
|
6174t11004f | lg electronics | fbt (fly back transf | 6174t11004f | 0 |
|
|
6174t11004g | lg electronics | fbt (fly back transf | 6174t11004g | 0 |
|
|
6174t11004j | lg electronics | fbt (fly back transf | 6174t11004j | 0 |
|
|
6174t11004k | lg electronics | fbt (fly back transf | 6174t11004k | 0 |
|
|
6174t11005a | lg electronics | fbt | 6174t11005a | 0 |
|
|
6174t11005c | lg electronics | fbt (fly back transf | 6174t11005c | 0 |
|
|
6174t11005d | lg electronics | fbt (fly back transf | 6174t11005d | 0 |
|
|
6174t11005e | lg electronics | fbt (fly back transf | 6174t11005e | 0 |
|
|
6174t11005g | lg electronics | fbt (fly back transf | 6174t11005g | 0 |
|
|
6174t11006c | lg electronics | fbt (fly back transf | 6174t11006c | 0 |
|
|
6174t11006d | lg electronics | fbt (fly back transf | 6174t11006d | 0 |
|
|
6174t11006f | lg electronics | transformer,fbt | 6174t11006f | 0 |
|
|
6174t11006l | lg electronics | transformer,fbt | 6174t11006l | 0 |
|
|
6174t11006m | lg electronics | transformer,fbt | 6174t11006m | 0 |
|
|
6174t11006p | lg electronics | transformer,fbt | 6174t11006p | 0 |
|
|
6202r1100aa | lg electronics | x-tal | 6202r1100aa | 0 |
|
|
6202r1100ac | lg electronics | crystal normal | 6202r1100ac | 0 |
|
|
6202r1100ae | lg electronics | crystal,normal | 6202r1100ae | 0 |
|
|
6202r1100ag | lg electronics | crystal,standard | 6202r1100ag | 0 |
|
|
635ks01100 | dynex | ir board dx-37l130a11 | 635ks01100 | 29 |
|
|
58k5084 | multicomp | resistor 1/8w-100kohmcrbn film multicomp | 651-100k | 0 |
|
|
6602t11001a | lg electronics | wafer | 6602t11001a | 0 |
|
|
6631t11004c | lg electronics | connector assy | 6631t11004c | 0 |
|
|
6631t11004d | lg electronics | connector assy | 6631t11004d | 0 |
|
|
6631t11004e | lg electronics | connector assy | 6631t11004e | 0 |
|
|
6631t11005a | lg electronics | connector assy | 6631t11005a | 0 |
|
|
6631t11005b | lg electronics | connector assy | 6631t11005b | 0 |
|
|
6631t11005c | lg electronics | connector assy | 6631t11005c | 0 |
|
|
6631t11005d | lg electronics | connector assy | 6631t11005d | 0 |
|
|
6631t11005e | lg electronics | connector assy | 6631t11005e | 0 |
|
|
6631t11005f | lg electronics | connector assembly | 6631t11005f | 0 |
|
|
6631t11006a | lg electronics | connector | 6631t11006a | 0 |
|
|
6631t11006b | lg electronics | connector assy | 6631t11006b | 0 |
|
|
6631t11006c | lg electronics | connector assy | 6631t11006c | 0 |
|
|
6631t11007a | lg electronics | connectorassy | 6631t11007a | 0 |
|
|
6631t11007c | lg electronics | connector assy | 6631t11007c | 0 |
|
|
6631t11007d | lg electronics | connector assy | 6631t11007d | 0 |
|
元器件型号 | 厂商 | 描述 | 数量 |
---|---|---|---|
1004-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1004-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1009-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1009-1511-005 | radiall - aep | rf coaxial board mount connector | 0 |
1009-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1042-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1025-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1029-1211-001 | radiall - aep | rf coaxial panel mount connector | 0 |
1029-1211-002 | radiall - aep | rf coaxial panel mount connector | 0 |
1029-1211-003 | radiall - aep | rf coaxial panel mount connector | 0 |
1010-1511-001 | radiall - aep | rf coaxial board mount connector | 0 |
1010-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1012-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1012-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1019-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1019-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
105-1110-001 | emerson power | miscellaneous connector | 0 |
1084-1100-00 | tyco electronics | in series adapter | 0 |
1100.01.a | huber + suhner | dc block | 0 |
1100.17.a | huber + suhner | dc block | 0 |
1100.19.a | huber + suhner | dc block | 0 |
1100.26.a | huber + suhner | dc block | 0 |
1100/bbm2e4ajp | empower | rf & mw module power amplifier | 7 |
1109-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1109-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
111-0110-001 | emerson power | miscellaneous connector | 0 |
1110-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1110-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
135101-r1-10.00 | amphenol connex | rf custom cable assembly | 0 |
135101-r1-11.00 | amphenol connex | rf custom cable assembly | 0 |
135101-r2-11.00 | amphenol connex | rf custom cable assembly | 0 |
142-1711-001 | emerson power | rf coaxial panel mount connector | 0 |
1484-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1484-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1486-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1486-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1704-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1709-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1709-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1710-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1710-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
1719-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
1719-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2004-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2004-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2009-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2009-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2010-1511-000 | radiall - aep | rf coaxial board mount connector | 228 |
2010-1511-002 | radiall - aep | rf coaxial board mount connector | 0 |
2010-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2010-7511-002 | radiall - aep | rf coaxial board mount connector | 0 |
2012-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2012-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2014-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2014-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2019-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2019-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
2025-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2025-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2042-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2084-1100-00 | tyco electronics | in series adapter | 148 |
2084-1100-02 | tyco electronics | in series adapter | 0 |
2109-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2109-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2110-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
2110-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
251-0111-003 | emerson power | interconnect tool | 0 |
255110-01-06.00 | amphenol connex | rf standard cable assembly | 0 |
255110-01-12.00 | amphenol connex | rf standard cable assembly | 0 |
255110-01-24.00 | amphenol connex | rf standard cable assembly | 0 |
255110-01-36.00 | amphenol connex | rf standard cable assembly | 0 |
2709-1511-001 | radiall - aep | rf coaxial board mount connector | 0 |
2709-7511-001 | radiall - aep | rf coaxial board mount connector | 0 |
2731-100m | microsemi | rf power transistor bipolar/hbt | 0 |
3004-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3009-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3009-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3010-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3010-1511-003 | radiall - aep | rf coaxial board mount connector | 0 |
3010-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3010-7511-003 | radiall - aep | rf coaxial board mount connector | 0 |
3012-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3014-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3017-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3017-1511-005 | radiall - aep | rf coaxial board mount connector | 0 |
3017-7511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3019-1511-000 | radiall - aep | rf coaxial panel mount connector | 0 |
3025-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3025-1511-005 | radiall - aep | rf coaxial board mount connector | 0 |
3025-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3025-7511-005 | radiall - aep | rf coaxial board mount connector | 0 |
3042-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3042-1511-006 | radiall - aep | rf coaxial board mount connector | 0 |
3042-7511-000 | radiall - aep | rf coaxial board mount connector | 0 |
3042-7511-006 | radiall - aep | rf coaxial board mount connector | 0 |
331100 | tyco electronics | rf coaxial cable mount connector | 0 |
3509-1511-000 | radiall - aep | rf coaxial board mount connector | 0 |
415-0011-006 | emerson power | rf standard cable assembly | 0 |
56-111-006 | spectrum control | emi filtered d-sub connector | 0 |
56-111-007 | spectrum control | emi filtered d-sub connector | 0 |
元器件型号 | manufacturer | 数量 |
---|---|---|
6611-002 | delevan | 9 in stock |
ax11005 developement board | asix | 2 in stock |
cdbb1100-g | comchip | 3000 in stock |
cdbhd1100l-g | comchip | 35000 factory stock |
cdbm1100-g | comchip | 2500 in stock |
cdbm1100-g | comchip | 32500 factory stock |
cdbw1100-g | comchip | 3000 factory stock |
cdba1100-g | comchip | 10000 factory stock |
rmc1/16k1100ftp | kamaya | 5000 factory stock |
rmc1/4k1100fte | kamaya | 1000 factory stock |
rmc1/8k1100ftp | kamaya | 35000 factory stock |
rmcf 1/10 0 r | stackpole | 25000 in stock |
wfc1-1100l | wpi | 2 factory stock |
wpgt-3ssm1100 | wpi | 80 factory stock |
wr02x1100fal | kamaya | 10000 factory stock |
wr04x1100ftl | kamaya | 10000 factory stock |
wr08x1100ftl | kamaya | 5000 factory stock |
元器件型号 | 厂商 | 描述 | oc # | 数量 | 价格 | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
364744b21100 | aavid thermalloy | 364744b21100 | 255 |
|
|||||||||||||||||||
161-1004 | all american misc. | mou 161-1004 | 1611004 | 100 |
|
||||||||||||||||||
820011001 | all american misc. | mpf11-.47-50.5 | 820011001 | 21 |
|
||||||||||||||||||
x363-1.0-1-100 | asc corp | x363101100 | 77 |
|
|||||||||||||||||||
2710-7511-000 | applied eng. prod. | 27107511000 | 100 |
|
|||||||||||||||||||
7210-1511-000 | applied eng. prod. | 72101511000 | 536 |
|
|||||||||||||||||||
31-321-1000 | amphenol rf | bncm db rg-59 cable | 313211000 | 5744 |
|
||||||||||||||||||
842-800-1211-002 | amphenol rf | 8428001211002 | 50 |
|
|||||||||||||||||||
908-21100 | amphenol rf | micromate male pcb edgemount | 90821100 | 79375 |
|
||||||||||||||||||
ialn1-1-51-100 | airpax / sensata | ialn1151100 | 5 |
|
|||||||||||||||||||
ialnk111-1-51-100. | airpax / sensata | ialnk111151100 | 3 |
|
|||||||||||||||||||
ieg11-1-61-10.0-01-v | airpax / sensata | ieg1116110001v | 4 |
|
|||||||||||||||||||
ieg111-1-61-10.0-11-v | airpax / sensata | ieg11116110011v | 8 |
|
|||||||||||||||||||
iegh111-1-61-10.091-v | airpax / sensata | iegh11116110091v | 8 |
|
|||||||||||||||||||
iegh66-1-61-1.00-21-v | airpax / sensata | iegh6616110021v | 9 |
|
|||||||||||||||||||
iegh66-1-61-10.0-21-v | airpax / sensata | iegh6616110021v | 14 |
|
|||||||||||||||||||
iegh666-1-61-10.0-21-v | airpax / sensata | iegh66616110021v | 10 |
|
|||||||||||||||||||
iegzx11-1-61-10.0-g-g3-v | airpax / sensata | iegzx11161100gg3v | 5 |
|
|||||||||||||||||||
iel1-1-51-10.0-01-v | airpax / sensata | iel115110001v | 15 |
|
|||||||||||||||||||
ielhk11-1-61-1.00-b-01-v | airpax / sensata | ielhk11161100b01v | 3 |
|
|||||||||||||||||||
ielk1-1-51-10.0-01-v | airpax / sensata | ielk115110001v | 7 |
|
|||||||||||||||||||
ielk1-1-61-10.0-01-v | airpax / sensata | ielk116110001v | 8 |
|
|||||||||||||||||||
ielk1-1-61-10.0-21-v | airpax / sensata | ielk116110021v | 8 |
|
|||||||||||||||||||
ielr1-1-51-10.0-01-v | airpax / sensata | ielr115110001v | 26 |
|
|||||||||||||||||||
ielr1-61-10.0-01 | airpax / sensata | ielr16110001 | 10 |
|
|||||||||||||||||||
iugn6-1-51-10.0 | airpax / sensata | iugn6151100 | 9 |
|
|||||||||||||||||||
iugx1-3-51-10.0-00 | airpax / sensata | iugx135110000 | 15 |
|
|||||||||||||||||||
iulhk111-1rec4-41-1.00-a01 | airpax / sensata | iulhk1111rec441100a01 | 5 |
|
|||||||||||||||||||
iulnk1-1-51-100. | airpax / sensata | iulnk1151100 | 14 |
|
|||||||||||||||||||
lelk1-1rec4-51-100.-01-v | airpax / sensata | lelk11rec45110001v | 28 |
|
|||||||||||||||||||
pp11-1-1.00a-oa-v | airpax / sensata | pp111100aoav | 21 |
|
|||||||||||||||||||
pp11-1-1.00a-oc-v | airpax / sensata | pp111100aocv | 7 |
|
|||||||||||||||||||
pp14-1-.100a-oa-s | airpax / sensata | pp141100aoas | 12 |
|
|||||||||||||||||||
pr11-1-1.00a-xx-s | airpax / sensata | pr111100axxs | 100 |
|
|||||||||||||||||||
pr11-1-10.0a-xx-v | airpax / sensata | pr111100axxv | 30 |
|
|||||||||||||||||||
pr11-41-1.00a-xx | airpax / sensata | pr1141100axx | 19 |
|
|||||||||||||||||||
pr15-1-10.0a-xx-v | airpax / sensata | pr151100axxv | 85 |
|
|||||||||||||||||||
r11-1-1.00a-b189eh-s | airpax / sensata | r111100ab189ehs | 5 |
|
|||||||||||||||||||
r11-1-10.0a-b02ch-v | airpax / sensata | r111100ab02chv | 11 |
|
|||||||||||||||||||
r11-1-10.0a-b162iv-v | airpax / sensata | r111100ab162ivv | 20 |
|
|||||||||||||||||||
r11-51-10.0a-g06ev-s | airpax / sensata | r1151100ag06evs | 7 |
|
|||||||||||||||||||
r11-61-1.00a-b187e-v | airpax / sensata | r1161100ab187ev | 8 |
|
|||||||||||||||||||
r21-1-1.00a-b02eh | airpax / sensata | r211100ab02eh | 3 |
|
|||||||||||||||||||
r21-61-10.0a-b162iv-v | airpax / sensata | r2161100ab162ivv | 6 |
|
|||||||||||||||||||
t11-1-10.0a-01-31a-v | airpax / sensata | t111100a0131av | 45 |
|
|||||||||||||||||||
t11-1-10.0a-01-10al-v | airpax / sensata | t111100a0110alv | 16 |
|
|||||||||||||||||||
t11-61-10.0a-01-31a-v | airpax / sensata | t1161100a0131av | 87 |
|
|||||||||||||||||||
t21-1-1.00a-01-31l | airpax / sensata | t211100a0131l | 144 |
|
|||||||||||||||||||
t21-1-1.00a-02-11al-v | airpax / sensata | t211100a0211alv | 2 |
|
|||||||||||||||||||
upg11-0-01 | airpax / sensata | upg11001 | 5 |
|
|||||||||||||||||||
31-1008p | aim electronics | 311008p | 11 |
|
|||||||||||||||||||
66f110-0447 | airpax thermal | gullwing | 66f1100447 | 1097 |
|
||||||||||||||||||
66l110-0435 | airpax thermal | gullwing | 66l1100435 | 247 |
|
||||||||||||||||||
67f110-0389 | airpax thermal | lead free plastic bracket & cap | 67f1100389 | 661 |
|
||||||||||||||||||
67l110-0210 | airpax thermal | standard | 67l1100210 | 1837 |
|
||||||||||||||||||
sddjf31100 | alps electric | dpst / right angle / i,o | sddjf31100 | 100 |
|
||||||||||||||||||
spec121100 | alps electric | 2poles / straight / latching | spec121100 | 79 |
|
||||||||||||||||||
0131601100 | allied signal | 0131601100 | 2 |
|
|||||||||||||||||||
1161-100 | alpha wire | 1161100 | 1 |
|
|||||||||||||||||||
1831-100-wht/blk | alpha wire | 1831100whtblk | 1 |
|
|||||||||||||||||||
1851-100-gry | alpha wire | 1851100gry | 1 |
|
|||||||||||||||||||
1851-100-vio | alpha wire | 1851100vio | 1 |
|
|||||||||||||||||||
2461-1000 | alpha wire | 24611000 | 2 |
|
|||||||||||||||||||
5021-100 | alpha wire | 5021100 | 1 |
|
|||||||||||||||||||
7161-100-lt-blu | alpha wire | 7161100ltblu | 2 |
|
|||||||||||||||||||
zip31m-1-100-blk | alpha wire | zip31m1100blk | 1 |
|
|||||||||||||||||||
114121-1.000-ss-g-10 | applied materials | 1141211000ssg10 | 8 |
|
|||||||||||||||||||
imp-1(44511-0010) | applied materials | imp1445110010 | 10 |
|
|||||||||||||||||||
1-100103-0 | te connectivity / amp brand | 10p.a/l.strain rel. | 11001030 | 3697 |
|
||||||||||||||||||
1-100103-4 | te connectivity / amp brand | 14p.a/l.strain rel. | 11001034 | 2601 |
|
||||||||||||||||||
1-1393110-0 | te connectivity / amp brand | ku-1753=ku | 113931100 | 25 |
|
||||||||||||||||||
111008-9 | te connectivity / amp brand | 040 univ hdr sp 4v 30dp std | 1110089 | 651 |
|
||||||||||||||||||
1571100-2 | te connectivity / amp brand | prcsd1-20f-bb0dw,power rocker | 15711002 | 904 |
|
||||||||||||||||||
1611001-3 | te connectivity / amp brand | 3100-15q2999=30a 1pws 24v prod | 16110013 | 50 |
|
||||||||||||||||||
1611004-6 | te connectivity / amp brand | 3100-20q6999=30a 2p 24v produc | 16110046 | 50 |
|
||||||||||||||||||
231-1000 | panasonic ew/aromat | 2311000 | 13 |
|
|||||||||||||||||||
231-1001 | panasonic ew/aromat | 2311001 | 13 |
|
|||||||||||||||||||
231-1002 | panasonic ew/aromat | 2311002 | 13 |
|
|||||||||||||||||||
231-1005 | panasonic ew/aromat | 2311005 | 13 |
|
|||||||||||||||||||
231-1006 | panasonic ew/aromat | 2311006 | 6 |
|
|||||||||||||||||||
231-1007 | panasonic ew/aromat | 2311007 | 13 |
|
|||||||||||||||||||
231-1008 | panasonic ew/aromat | 2311008 | 13 |
|
|||||||||||||||||||
231-1009 | panasonic ew/aromat | 2311009 | 6 |
|
|||||||||||||||||||
2-1393110-0 | te connectivity / amp brand | ku-2085=ku | 213931100 | 25 |
|
||||||||||||||||||
2-1419110-0 | te connectivity / amp brand | 214191100 | 18345 |
|
|||||||||||||||||||
3-1393110-0 | te connectivity / amp brand | 313931100 | 10 |
|
|||||||||||||||||||
3-1611005-0 | te connectivity / amp brand | 3100-20u6999=30a 2p 208/240v p | 316110050 | 29 |
|
||||||||||||||||||
4-1611003-2 | te connectivity / amp brand | 3100-20q18999cl=40a 2p 24v pro | 416110032 | 50 |
|
||||||||||||||||||
5-1393110-0 | te connectivity / amp brand | ku-5097=ku | 513931100 | 17 |
|
||||||||||||||||||
5-1611009-9 | te connectivity / amp brand | 3100-30q807=25a 3p 24v coil te | 516110099 | 136 |
|
||||||||||||||||||
7-1393110-0 | te connectivity / amp brand | ku-5590-2=ku | 713931100 | 38 |
|
||||||||||||||||||
7-1611004-4 | te connectivity / amp brand | 3100-20u18999cl=40a 2p 208/240 | 716110044 | 150 |
|
||||||||||||||||||
7-1611005-0 | te connectivity / amp brand | 716110050 | 68 |
|
|||||||||||||||||||
8-1611004-0 | te connectivity / amp brand | 816110040 | 391 |
|
|||||||||||||||||||
8-1611004-3 | te connectivity / amp brand | 816110043 | 486 |
|
|||||||||||||||||||
8-1611007-5 | te connectivity / amp brand | 3100-15t1999=contactor | 816110075 | 100 |
|
||||||||||||||||||
8-1611007-6 | te connectivity / amp brand | 3100-15u1999=contactor | 816110076 | 21 |
|
||||||||||||||||||
9-1611008-6 | te connectivity / amp brand | 3100-30q1003ux=40a 3p 24v mode | 916110086 | 102 |
|
||||||||||||||||||
a47011-000 | te connectivity / amp brand | a47011000 | 4 |
|
|||||||||||||||||||
m39029/1-100 | te connectivity / amp brand | m390291100 | 2 |
|
元器件型号 | 厂商 | rohs | 数量 | 价格 | |
---|---|---|---|---|---|
bmr4511002/020 | ericsson | 6/6 | 15 |
|
元器件型号 | manufacturer | 描述 | 数量 |
---|---|---|---|
mbrs1100t3g | on semiconductor | schottky power rectifier | 20000 |
mur1100erlg | on semiconductor | switchmode power rectifiers | 11600 |
ads1100a0idbvr | texas instruments | 16-bit analog-to-digital converter | 9600 |
ntgd1100lt1g | on semiconductor | 8v,?3.3a,load switch with level shift,p channel,tsop6 power mosfet | 5700 |
20021111-00006t4lf | fci | headers & wire housings 6p hdr unshrd vrt th 1.27x1.27mm btb | 3250 |
62684-401100alf | fci | ffc/fpc connectors 40p lower side entry w/o cable lock | 3200 |
20021111-00008t4lf | fci | headers & wire housings 8p hdr unshrd vrt th 1.27x1.27mm btb | 2450 |
20021111-00022t4lf | fci | headers & wire housings 22p hdr unshrd vert 1.27x1.27mm btb th | 2350 |
ads1100a3idbvr | texas instruments | 16-bit analog-to-digital converter | 2350 |
20021311-00006t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 2350 |
20021311-00010t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 2250 |
20021111-00014t1lf | fci | headers & wire housings 14p hdr unshrd vert 1.27x1.27mm btb th | 2100 |
20021111-00024t4lf | fci | headers & wire housings 24p hdr unshrd vert 1.27x1.27mm btb th | 2100 |
20021111-00010t4lf | fci | headers & wire housings 10p hdr unshrd vrt 1.27x1.27mm btb th | 1950 |
20021111-00026t4lf | fci | headers & wire housings 26p hdr unshrd vert 1.27x1.27mm btb th | 1950 |
20021311-00012t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1900 |
90511-001lf | fci | telecom & ethernet connectors4-4p vert pcb jck | 1900 |
np1100sat3g | on semiconductor | thyristor surge protectors | 1900 |
20021311-00022t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1800 |
20021111-00016t4lf | fci | headers & wire housings 16p hdr unshrd vert 1.27x1.27mm btb th | 1800 |
20021311-00008t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1800 |
20021311-00014t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1600 |
20021111-00018t4lf | fci | headers & wire housings 18p hdr unshrd vert 1.27x1.27mm btb th | 1600 |
20021311-00024t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1600 |
20021111-00030t4lf | fci | headers & wire housings 30p hdr unshrd vert 1.27x1.27mm btb th | 1600 |
20021111-00034t4lf | fci | headers & wire housings 34p hdr unshrd vert 1.27x1.27mm btb th | 1500 |
20021311-00026t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1500 |
20021311-00016t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1450 |
20021111-00036t4lf | fci | headers & wire housings 36p hdr unshrd vert 1.27x1.27mm btb th | 1400 |
20021311-00030t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1300 |
20021311-00018t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1250 |
20021111-00040t4lf | fci | headers & wire housings 40p hdr unshrd vert 1.27x1.27mm btb th | 1250 |
20021311-00034t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1150 |
20021311-00036t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1150 |
20021311-00020t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 1150 |
mbr1100g | on semiconductor | axial lead schottky barrier power rectifier | 1050 |
20021311-00040t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 950 |
20021111-00050t4lf | fci | headers & wire housings 50p hdr unshrd vert 1.27x1.27mm btb th | 900 |
20021111-00060t4lf | fci | headers & wire housings 60p hdr unshrd vert 1.27x1.27mm btb th | 800 |
20021611-00008t1lf | fci | headers & wire housings8p eject hdr vert 1.27x1.27mm btb th | 500 |
20021111-00090t4lf | fci | headers & wire housings 90p hdr unshrd vert 1.27x1.27mm btb th | 500 |
20021311-00080t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 500 |
20021611-00006t1lf | fci | headers & wire housings 6p eject hdr vert 1.27x1.27mm btb th | 500 |
20021111-00080t4lf | fci | headers & wire housings 80p hdr unshrd vert 1.27x1.27mm btb th | 500 |
20021311-00060t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 500 |
ads1100a2idbvt | texas instruments | 16-bit analog-to-digital converter | 500 |
20021311-00050t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 500 |
78211-003lf | fci | headers & wire housings 3 pos pcb housing | 500 |
90311-004lf | fci | headers & wire housings 2x2p ctw housing | 500 |
90311-006lf | fci | headers & wire housings 2x3pos ctw cntr keyd | 500 |
90311-008lf | fci | headers & wire housings 2x4p ctw hsg black | 500 |
20021311-00090t4lf | fci | board to board / mezzanine connectors receptacle vert th 1.27x1.27mm btb | 480 |
20021611-00014t1lf | fci | headers & wire housings 14p eject hdr vert 1.27x1.27mm btb th | 480 |
np1100sct3g | on semiconductor | thyristor surge protectors | 450 |
20021611-00016t1lf | fci | headers & wire housings 16p eject hdr vert 1.27x1.27mm btb th | 440 |
20021611-00020t8lf | fci | headers & wire housings 20p eject hdr vert 1.27x1.27mm btb th | 400 |
tps61100pw | texas instruments | dual-output, single-cell boost converter | 313 |
20021611-00050t1lf | fci | headers & wire housings 50p eject hdr vert 1.27x1.27mm btb th | 240 |
20021611-00064t1lf | fci | headers & wire housings 64p eject hdr vert 1.27x1.27mm btb th | 200 |
ads1100a6idbvt | texas instruments | 16-bit analog-to-digital converter | 3 |
ads1100a4idbvt | texas instruments | 16-bit analog-to-digital converter | 2 |
元器件型号 | 厂商 | 数量 |
---|---|---|
ec1100hsett-20.000m | ecliptek | 500 |
cmf1-1003sm | gowanda | 200 |
chp1-100-8r00j-lf-7 | irc | 1500 |
chp1-100-r250f-7 | irc | 3000 |
chp1-100-r250f-lf-7 | irc | 1500 |
chp1-100-r510j-lf-7 | irc | 1500 |
cph1-100-4300j-lf-7 | irc | 1500 |
mkp2 0.1/100/5 | wima | 3000 |
元器件型号 | 厂商 | 描述 | nrc # | 数量 | 价格 | |
---|---|---|---|---|---|---|
r73ti1100se00k | arcotronics america, inc. | cp flm rd pp #221 r73ti1100se00k 1000pf 1600v 10% .6"ls | 18761-2 | 2000 |
|
|
fkp1-1000pf-1250v-10% | inter-technical group inc. | cp fm rd pp #40 fkp1-1000pf-1250v-10% 1kpf 1250v10%(rohs | 848787-2 | 3784 |
|
|
fkp1-1000pf-2kv-5% | inter-technical group inc. | cap flm rd pp #40 fkp1-1000pf-2kv-5% pcm22.5(rohs) | 42034-2 | 360 |
|
|
fkp1-100pf-2kv-5% | inter-technical group inc. | cap flm rd pp #40 fkp1-100pf-2kv-5% pcm15(rohs) | 42033-2 | 710 |
|
|
mks2 0.1/100/10 | inter-technical group inc. | cap film rad mpe #40 mks2 0.1/100/10 .1uf 100v 10% | 21796-2 | 6000 |
|
|
rc210t101jt | jaro components, inc. | res chp #178 rc210t101jt .125w 100 5% t/r(0805)(rohs) | 611005-1 | 95000 |
|
|
rc315t1000ft | jaro components, inc. | res chp #178 rc315t1000ft .25w 100 ohm 1% t/r(1206)(rohs | 611006-1 | 5000 |
|
|
rc315t1000ft | jaro components, inc. | res chp #178 rc315t1000ft .25w 100 1% t/r(1206)(rohs) | 311006-1 | 65000 |
|
|
rc315t101jt | jaro components, inc. | res chp #178 rc315t101jt .25w 100 5% t/r(1206)(rohs) | 611007-1 | 30000 |
|
|
rc315t1180ft | jaro components, inc. | res chip #178 rc315t1180ft .25w 118 1% t/r (1206)(rohs) | 611009-1 | 20000 |
|
|
21100-671 | nrc electronics | pin #167 21100-671 1.6mm pivot pin(100/bag)(schroff)rohs | 346018-2 | 700 |
|
|
rc315t820jt | jaro components, inc. | res chip #178 rc315t820jt .25w 82 ohm 5% t/r(1206)(rohs) | 611000-1 | 20000 |
|
|
rc350t101jt | jaro components, inc. | res chp #178 rc350t101jt .33w 100 5% t/r (1210)(rohs) | 611008-1 | 12000 |
|
|
rc350t910jt | jaro components, inc. | res chp #178 rc350t910jt .33w 91 ohm 5% t/r (1210)(rohs) | 611001-1 | 12000 |
|
|
rc500t910jt | jaro components, inc. | res chip #127 rc500t910jt .75w 91 ohm 5% t/r(2010)(rohs) | 611002-1 | 20000 |
|
|
jtb611-00-1-03-1 | jite connectors, inc. | terminal block #942 jtb611-00-1-03-1 3pos 5mm blk (rohs) | 43596-2 | 7900 |
|
|
00-542001-100 | jewell instruments | meter #959 00-542001-100 w/meter clip (emico) | 33994-2 | 394 |
|
|
39-30-1100 | nrc electronics | header #991 39-30-1100 rgt angl 5-pos 2 row .165"(rohs) | 635392-2 | 8100 |
|
|
co1100-1.8432 | rami technology asia ltd | crystal #146 co1100-1.8432 1.8432mhz clock oscillator | 10018-2 | 500 |
|
|
rl1256-1-100 | renco electronics, inc. | choke rad #276 rl1256-1-100 100uh 2.8a 10% powerlne(rohs | 845441-2 | 1264 |
|
|
ajt01a8811-002 | ria connect, inc. | jack #518 ajt01a8811-002 8p8c 1port 6u"gld(rohs) | 847349-2 | 5500 |
|
|
tsm-110-02-l-sv-a-p-tr | samtec | terminal sm #576 tsm-110-02-l-sv-a-p-tr 10pos t/r(rohs) | 641278-2 | 5250 |
|
|
c1206cog101-100jsne | venkel corp. | cr chp #352 c1206cog101-100jsne 10pf 100v 5% t/r (rohs) | 35576-2 | 12000 |
|
元器件型号 | manufacturer | 描述 | 数量 |
---|---|---|---|
qsh4218-41-10-035 | trinamic | steppermotor 42mm, 1a, 0.35nm | 50 |
ud1100001-01 | lantronix | uds1100,10/100 deviceserver,w/ | 164 |
ud1100002-01 | lantronix | uds1100,10/100 deviceserver w/ | 14 |
ud110000b-01 | lantronix | uds1100,10/100 deviceserverboa | 42 |
ud1100ia2-01 | lantronix | uds1100,ia single port 10/100 | 2 |
ud1100nl2-01 | lantronix | uds1100 no-label 10/100 device | 13 |
元器件型号 | manufacturer | p&s# | 数量 |
---|---|---|---|
12110078 | power and signal group | 12110078 | 0 |
mpp1100170 | delfingen | mpp1100170 | 0 |
mpp1100220 | delfingen | mpp1100220 | 0 |
12110007 | delphi | 12110007 | 250 |
12110011 | delphi | 12110011 | 0 |
12110031 | delphi | 12110031 | 0 |
12110034 | delphi | 12110034 | 0 |
12110035 | delphi | 12110035 | 0 |
12110038 | delphi | 12110038 | 0 |
12110041 | delphi | 12110041 | 1150 |
12110043 | delphi | 12110043 | 350 |
12110047 | delphi | 12110047 | 500 |
12110048 | delphi | 12110048 | 4000 |
12110053 | delphi | 12110053 | 12000 |
12110053-b | delphi | 12110053-b | 1300 |
12110054 | delphi | 12110054 | 12000 |
12110054-b | delphi | 12110054-b | 2600 |
12110057 | delphi | 12110057 | 1200 |
12110058 | delphi | 12110058 | 10000 |
12110063 | delphi | 12110063 | 0 |
12110064 | delphi | 12110064 | 0 |
12110075 | delphi | 12110075 | 4000 |
12110075-b | delphi | 12110075-b | 0 |
12110087 | delphi | 12110087 | 0 |
12110088 | delphi | 12110088 | 0 |
12110088-b | delphi | 12110088-b | 400 |
12110089 | delphi | 12110089 | 0 |
12110090 | delphi | 12110090 | 0 |
12110091 | delphi | 12110091 | 0 |
12110092 | delphi | 12110092 | 0 |
12131100 | delphi | 12131100 | 0 |
13711008 | delphi | 13711008 | 0 |
120110-0044 | itt cannon | 120110-0044 | 0 |
0005121100 | molex | 0005121100 | 4500 |
0015921100 | molex | 0015921100 | 0 |
0029110042 | molex | 0029110042 | 0 |
0039301100 | molex | 0039301100 | 0 |
0190110003 | molex | 0190110003 | 0 |
0190110006 | molex | 0190110006 | 0 |
0190110008 | molex | 0190110008 | 0 |
0190110039 | molex | 0190110039 | 0 |
0192110002 | molex | 0192110002 | 0 |
0192110003 | molex | 0192110003 | 0 |
0192110004 | molex | 0192110004 | 0 |
0192110005 | molex | 0192110005 | 0 |
0192110006 | molex | 0192110006 | 0 |
b3f1100 | omron | b3f1100 | 0 |
0194011000 | molex | 0194011000 | 0 |
b3j1100 | omron | b3j1100 | 0 |
0250011002 | molex | 0250011002 | 0 |
0307001100 | molex | 0307001100 | 9600 |
0309681100 | molex | 0309681100 | 7700 |
0313801100 | molex | 0313801100 | 0 |
0313811000 | molex | 0313811000 | 0 |
0313811005 | molex | 0313811005 | 0 |
0313811008 | molex | 0313811008 | 0 |
0313811100 | molex | 0313811100 | 0 |
0330011004 | molex | 0330011004 | 0 |
0330110002 | molex | 0330110002 | 0 |
0330110004 | molex | 0330110004 | 37500 |
0330110004-mr | molex | 0330110004-mr | 6500 |
0330110006 | molex | 0330110006 | 0 |
0330111002 | molex | 0330111002 | 0 |
0330111004 | molex | 0330111004 | 0 |
0330111006 | molex | 0330111006 | 0 |
0331100002 | molex | 0331100002 | 0 |
0331100004 | molex | 0331100004 | 0 |
0331100006 | molex | 0331100006 | 0 |
0331100007 | molex | 0331100007 | 0 |
0331100008 | molex | 0331100008 | 0 |
0331100009 | molex | 0331100009 | 0 |
0331100010 | molex | 0331100010 | 0 |
0331100013 | molex | 0331100013 | 0 |
0331100014 | molex | 0331100014 | 0 |
0331100015 | molex | 0331100015 | 0 |
0331100016 | molex | 0331100016 | 0 |
0331100019 | molex | 0331100019 | 0 |
0331100020 | molex | 0331100020 | 0 |
0331100022 | molex | 0331100022 | 0 |
0331110001 | molex | 0331110001 | 16000 |
0331110002 | molex | 0331110002 | 4000 |
0331110003 | molex | 0331110003 | 0 |
0331110004 | molex | 0331110004 | 0 |
b3u1100pm | omron | b3u1100pm | 0 |
d2d1100 | omron | d2d1100 | 0 |
0345111001 | molex | 0345111001 | 0 |
0347811004 | molex | 0347811004 | 0 |
0350211001 | molex | 0350211001 | 0 |
0355721100 | molex | 0355721100 | 0 |
0393511003 | molex | 0393511003 | 0 |
0393511006 | molex | 0393511006 | 0 |
0393511008 | molex | 0393511008 | 0 |
0436451100 | molex | 0436451100 | 0 |
0457111000 | molex | 0457111000 | 0 |
0471511001 | molex | 0471511001 | 0 |
0510211000 | molex | 0510211000 | 0 |
0510211100 | molex | 0510211100 | 0 |
0511031100 | molex | 0511031100 | 0 |
0511100660 | molex | 0511100660 | 0 |
0511100851 | molex | 0511100851 | 0 |
元器件型号 | 厂商 | 描述 | date code | 数量 |
---|---|---|---|---|
.008283021100000 | elco | 93 | 817 | |
.008283021100000. | elco | 93 | 817 | |
.1/100/5% | arc | rf410x100v .2 arco 5% | 4920 | |
.1/100v/20% | iec | rf410x100v .6 eic 20% cut/crimped | 597 | |
.11005% | arc | rf410x100v .2 arco 5% | 4920 | |
.1100v20% | iec | rf410x100v .6 eic 20% cut/crimped | 597 | |
1/100v/10% | arc | rf410x100v .2 arco 10% | 1300 | |
11008 | see internal comment | 141 | ||
1100v10% | arc | rf410x100v .2 arco 10% | 1300 | |
120110008-001 | currently stock to 3 weeks | 2011 | 480 | |
120110008-001 | duopowerware | stock to 1 week | 500 | |
120110008001 | currently stock to 3 weeks | 2011 | 480 | |
120110008001 | duopowerware | stock to 1 week | 500 | |
226-11100020-0367 | 4600 | |||
226111000200367 | 4600 | |||
3006y-1-100 | toc | pot10 tr62y100 | 448 | |
3006y1100 | toc | pot10 tr62y100 | 448 | |
31-321-1000 | amph | connector co-ax | 218 | |
311-0110-00 | ab | type w 100k -ohm gold leads | 8236 | 10 |
311004 | lit | fuse s1g3b | 3500 | |
311011000 | ab | type w 100k -ohm gold leads | 8236 | 10 |
313211000 | amph | connector co-ax | 218 | |
3329p-1-100 | bou | pot10-3329p bourns nxg6c | 40 | |
3329p1100 | bou | pot10-3329p bourns nxg6c | 40 | |
3329w-1-100 | bou | pot10-3329w bourns nxg6d | 50 | |
3329w1100 | bou | pot10-3329w bourns nxg6d | 50 | |
3339w-1-100 | pot 10-3339 nxg4d | 6 | ||
3339w1100 | pot 10-3339 nxg4d | 6 | ||
339-011-0001 | duo | power semiconductor | 10 | |
3390110001 | duo | power semiconductor | 10 | |
36de1100p | united chemi-con | cgb050x316m 3-lead rad | 1 | |
36dx11006 | united chemi-con | cgaa300x025 | 96 | 3 |
50295-1100e | ber | 502951100e berg s1a10c | 41 | |
502951100e | ber | 502951100e berg s1a10c | 41 | |
511000-ug | sloan | 30 | ||
511000ug | sloan | 30 | ||
663uw-.22-1-1000 | trw | af422x1000 | none | 5 |
663uw2211000 | trw | af422x1000 | none | 5 |
68d11001 | mc235 30v 5pin lead | 11 | ||
68d11005 | mc211 200v 5 leads | 10 | ||
68d11009 | sprague/vishay | mc175 200v 5 leads s11c3g | 13 | |
8630471%100 | asc | af347x100 | 67 | |
86311%100 | asc | af410x100 asc 1% s8k5b | 25 | |
90011001021 | mur | filter murata see internal comment | 33 | |
9011-100-1026 | 3 | |||
8101-100x7r471k | eri | rmx147x1k100 loc shelf lot g | 18 | |
8101100651681m | mur | rmz168x1m100 murata s8g3a | 110 | |
8101100x7r471k | eri | rmx147x1k100 loc shelf lot g | 18 | |
8111-100x7r561j | eri | rmx156x1k100 erie s6h6c | 48 | |
8111100cog152k | eri | rmx215x1k100 erie s7k2b | 5 | |
8111100x7r561j | eri | rmx156x1k100 erie s6h6c | 48 | |
8121-100x7r332k | eri | rmx233x1k100 s7k2b | 3 | |
8121-100x7r332m | eri | rmx233x1m100 s8m7a | 407 | |
8121-100x7r472k | eri | rmx247x1k100 erie 1718 | 620 | |
8121-100z5u273m | eri | rmz327x1m100 erie s8g3a | 140 | |
8121100cog470k | eri | rmn047x1k100 erie s6h6c | 57 | |
8121100cog681k | eri | rmn068x1k100 s8m3b | 7 | |
8121100x7r0152m | eri | rmx215x1m100 s4c5a | 118 | |
8121100x7r332k | eri | rmx233x1k100 s7k2b | 3 | |
8121100x7r332m | eri | rmx233x1m100 s8m7a | 407 | |
8121100x7r472k | eri | rmx247x1k100 erie 1718 | 620 | |
8121100z5u273m | eri | rmz327x1m100 erie s8g3a | 140 | |
8131-100x7r473k | eri | rmx347x2k100 erie s4c5a | 18 | |
8131-100x7r563k | eri | rmx356x2k100 erie shelf | 8 | |
8131100651274m | mur | rmz427x2m100 murata s8g3a | 20 | |
8131100x7r0683k | rmx368 s4c5a | 6 | ||
8131100x7r123k | eri | rmx312x2k100 erie s6h6c | 41 | |
8131100x7r473k | eri | rmx347x2k100 erie s4c5a | 18 | |
8131100x7r563k | eri | rmx356x2k100 erie shelf | 8 | |
9001-100-1000 | feed thru w/ factory certs | 11 | ||
9001-100-1017 | mur | 9001-100-1017 | 2328 | |
9001-100-1021 | mur | filter murata see internal comment | 33 | |
90011001000 | feed thru w/ factory certs | 11 | ||
863.1-1%/100 | asc | af410x100 asc 1% s8k5b | 25 | |
863/.047/1%/100 | asc | af347x100 | 67 | |
90011001017 | mur | 9001-100-1017 | 2328 | |
9011-100-1002 | mur | filter murata s12a1c | 4 | |
90111001002 | mur | filter murata s12a1c | 4 | |
90111001026 | 3 | |||
99211006001 | mur | 9921-100-6001 filter murata s12a1c | 62 | |
9951100216 | har | 9951100216 har””85 n10c7a | 9 | |
asfl1-10.000mhz-ek-t | abracon corporation | 95 | ||
asfl110000mhzekt | abracon corporation | 95 | ||
assv1-10.000mhz-ec-c1 | abracon | 100 | ||
assv110000mhzecc1 | abracon | 100 | ||
cmo11001jlftr | irc | 1k 1w 5% mo | 7500 | |
cmo11001jlftr | irc | 1k 1w 5% mo | 22500 | |
cmo11002jlftr | irc | 10k 1w 5% mo | 5000 | |
cmo11002jlftr | irc | 10k 1w 5% mo | 25000 | |
cmo11003jlftr | irc | 100k 1w 5% mo | 7500 | |
cmo11003jlftr | irc | 100k 1w 5% mo | 22500 | |
cmo11003jlftr | irc | 100k 1w 5% mo | 25000 | |
cpa-11-00-01 | hecon | 2 | ||
cpa110001 | hecon | 2 | ||
cpcc1100v47p | bc | bc components 4k/reel 47pf 2% | 12000 | |
crcw08051100ft | dal | rsmt0805xc1r10xf dale s9i7b | 4742 | |
dm10-1100j | n/a | dm10x0110 | 204 | |
dm101100j | n/a | dm10x0110 | 204 | |
ea060-11100 | namco | 2 | ||
ea06011100 | namco | 2 |
元器件型号 | 厂商 | 描述 | chip outpost # | 数量 | 价格 | ||
---|---|---|---|---|---|---|---|
bt151-1000rt,127 | nxp semiconductors | thyristor 1000v 12a to-220ab | 954-bt151-1000rt127-chp | 4000 tube |
|
||
tb1100l-13 | diodes/zetex | thyristor protect bi-dir 30a smb | 981-tb1100l-13-chp | 3000 tape & reel |
|
||
stcl1100ybfcwy5 | stmicroelectronics | ic osc silicon 10mhz sot23-5 | 1026-stcl1100ybfcwy5-chp | 6000 tape & reel |
|
||
tb1100m-13 | diodes/zetex | thyristor protect bi-dir 50a smb | 981-tb1100m-13-chp | 3000 tape & reel |
|
||
zxld1100h6ta | diodes/zetex | ic led drvr white bcklgt sc-70-6 | 981-zxld1100h6ta-chp | 3000 tape & reel |
|
coilcraft # | manufacturer | 描述 | rohs | pb free | 数量 |
---|---|---|---|---|---|
cst1-100lb | coilcraft | current sensor, smt, rohs | yes | no | 3079 |
cst1-100lc | coilcraft | current sensor, smt, rohs | yes | no | 3079 |
cs1100l | coilcraft | current sensor, rohs | yes | no | 712 |
元器件型号 | 厂商 | packaging | date code | 数量 |
---|---|---|---|---|
008283021100000 | elco | 1000/bag | 93 | 244000 |
00-8283-021-100-000 | elco | 1000/bag | 93 | 244000 |
008283121100868 | elco | bulk | . | 955 |
00-8283-121-100-868 | elco | bulk | . | 955 |
011-0057-01 | tektronix | bulk | . | 1 |
03-03111-004 | reeves | 27/tube | 99 | 50 |
095-9110-09-102 | dialight | 1/bag | 98 | 3 |
105061100000856 | elco | 60/tray | 00 | 900 |
10-5061-100-000-856 | elco | 60/tray | 00 | 900 |
105061100101861 | elco | 45/tray | 00 | 360 |
10-5061-100-101-861 | elco | 45/tray | 00 | 360 |
172-037-211-001 | norcomp | tray | . | 31 |
2010-7511-002 | aep | 1/bag | 03 | 33 |
2312-901-11003 | beyschlag | 1000/ammo-pak | 93 | 1000 |
2322-156-11006 | philips | bulk | 98 | 1750 |
2322-157-11001 | philips | 1000/ammo-pak | 92 | 1000 |
2322-157-11005 | philips | 1000/ammo-pak | 93 | 1000 |
2322-175-11001 | beyschlag | 1000/ammo-pak | 92 | 3000 |
39-30-1100 | molex | bulk | 00 | 395 |
39-30-1100 | molex | bulk | . | 390 |
714p102x1100 | sprague | bulk | . | 1365 |
73642-1100 | molex | 11/tube | 01 | 506 |
73951-1004 | berg | 12/tube | 01 | 28 |
73951-1004 | berg | 12/tube | 98 | 1056 |
73951-1006 | berg | 8/tube | 98 | 96 |
73951-1006 | berg | 12/tube | 98 | 84 |
73951-1006 | berg | 12/tube | 98 | 1807 |
74act11004dw | ti | tape | 98 | 100 |
74act11008d | ti | 40/tube | 94 | 72 |
87701-1001 | molex | bulk | 05 | 12 |
89110-0103 | 3m | (rohs)tray | 08 | 54 |
adum1100arz | ad | (rohs) | 09 | 10 |
as1100wl | austriamicrosys | (rohs)31/tube | 05 | 779 |
b37940k1100j60 | siemens | 5000/reel(0805-10pf-100v) | 99 | 5000 |
bt151-1000rt | nxp | (rohs)50/tube | 07 | 100 |
cdrh2d11-100nc | sumida | (rohs)partial-reel | 06 | 860 |
ces-110-01-s-d | samtec | tube | . | 16 |
chp-1-100-2210-f | irc | tape | 01 | 225 |
chp-1-100-2670-f | irc | partial-reel | 01 | 965 |
chp-1-100-3650-f | irc | partial-reel | 01 | 600 |
chp-1-100-4990-f | irc | partial-reel | 01 | 4950 |
clp-110-02-f-d | samtec | 45/tube | 98 | 1900 |
clq61-100nc | sumida | tape | . | 10 |
cmd4d11-100mc | sumida | partial-reel | 04 | 505 |
cpb8110-0110 | smk | partial-reel | 93 | 998 |
cpc c1 100v 18p | bc comp | partial-reel | 00 | 3955 |
ds1100z-125 | dallas | tube | 00 | 5 |
ds1100z-175 | dallas | tube | 99 | 53 |
ds1100z-50 | dallas | tube | 02 | 14 |
ec1100-20.00mhz | ecliptec | tube | 96 | 53 |
ec1100-66.000mhz | ecliptek | 40/tube | 96 | 50 |
hm511000aji-8 | hitachi | 27/tube | 92 | 27 |
ips1-110-01-s-d-ra-pol | samtec | 22/tube | 03 | 666 |
is-21-1000-10% | dale | 250/reel | 99 | 250 |
is-21-1000-10% | dale | 750/reel | 99 | 750 |
is-21-1000-10% | dale | 100/bag | 99 | 900 |
is-21-100-10% | dale | tape | 95 | 475 |
jpm1110-0201 | smk | 500/bag | . | 5885 |
lg01-1006n1tr | halo | partial-reel | 99 | 270 |
lg01-1006n1tr | halo | 1000/reel | 00 | 1000 |
lg01-1006n1tr | halo | 1000/reel | 99 | 3000 |
lg01-1006n1tr | halo | tape | 98 | 80 |
lg01-1006w | halo | 25/tube | 94 | 80 |
mcm511001aj70 | mot | 27/tube | 90 | 27 |
mcm511001aj80 | mot | tape | 92 | 49 |
mks4-1/100/10% | wima | bulk | 99 | 870 |
mpsd311-10029 | wsi | 27/tube | 99 | 3803 |
mpsd311-10029 | wsi | 27/tube | 98 | 531 |
mpsd311-10029 | wsi | 27/tube | 98 | 252 |
mpsd311-10077 | wsi | 27/tube | 99 | 4507 |
mpsd311-10085 | wsi | 27/tube | 00 | 27 |
p1100sarp | littelfuse | partial-reel | 08 | 2410 |
p1100sbrp | littelfuse | partial-reel | 05 | 1415 |
p1100sbrp | teccor | 2500/reel | 03 | 2500 |
prc211100k/150m | cmd | 55/tube | 96 | 275 |
r60qf1100aa01j | arcotronics | 2000/box | 98 | 5200 |
sc11006cn | sierra | 13/tube | 94 | 212 |
sc11006cn | sierra | 13/tube | 91 | 90 |
sc11006cn | sierra | 13/tube | 89 | 71 |
sm1100cy-33.333mhz | seikoeps | 23/tube | 06 | 69 |
sm1100jp-53.1250mhz | pletronics | tube | 96 | 13 |
tc511000aj-10 | tosh | tape | 94 | 274 |
tc511000aj-10 | toshiba | 25/tube | 89 | 25 |
tc511000az-80 | toshiba | 20/tube | 92 | 180 |
tg01-1006w | halo | 43/tube | 94 | 485 |
tsm-110-01-s-dv | samtec | 23/tube | 96 | 1947 |
tsm-110-02-s-dv-p-tr | samtec | 125/reel | 99 | 250 |
tsm-110-02-s-dv-p-tr | samtec | 125/reel | 00 | 875 |
unr221100l | pana | partial-reel | 02 | 2970 |
unr221100l | pana | 3000/reel | 00 | 69000 |
wd1100pe-03-02 | wdc | . | 87 | 11 |
wd1100pe-03-02 | wdc | . | 86 | 22 |
wd1100pe-03-02 | wdc | . | 85 | 5 |
wd1100-pe-12-02 | wdc | . | 86+ | 12 |
元器件型号 | 厂商 | 描述 | distrelec # | 数量 switzerland | 价格 (chf) | |
---|---|---|---|---|---|---|
11 00 000 9501 | harting | coding pin han yellock | 117723 | 2 in stock |
|
|
11 00 300 0101 | harting | adaptor frame for carrier hood 30 han yellock | 117724 | available for order |
|
|
11 00 300 0301 | harting | adaptor frame for housing 30 han yellock | 117725 | available for order |
|
|
09 45 151 1100 | harting | cable plug 8/4 rj45 | 120201 | 59 in stock |
|
|
09 45 145 1100 | harting | cable plug 8/4 rj45 | 120202 | 29 in stock |
|
|
09 45 115 1100 | harting | cable plug 8/4 rj45 | 120204 | 28 in stock |
|
|
09 45 215 1100 | harting | wall jack 8, 8/8rj45 | 120205 | 15 in stock |
|
|
g826441100eu | amphenol | ribbon cable connector 2x22p | 127191 | 230 in stock |
|
|
09 45 125 1100 | harting | cable plug 8/4 rj45 | 129693 | 4 in stock |
|
|
09 45 225 1100 | harting | wall jack 8, 8/8rj45 | 129694 | available for order |
|
|
akt7211100j | panasonic | thermostat | 420256 | 1 in stock |
|
|
akt7111100j | panasonic | thermostat | 420259 | 1 in stock |
|
|
akt4211100j | panasonic | thermostat | 420262 | 2 in stock |
|
|
akt4111100j | panasonic | thermostat | 420265 | 2 in stock |
|
|
erjp03f1100v | panasonic | metal film resistor smd 110 ohm 1 % 0603 | 722949 | 4995 in stock |
|
元器件型号 | 厂商 | rapid quote | 数量 |
---|---|---|---|
00-110-0347 | get rapid quote | 1 | |
00-110-0388 | get rapid quote | 45 | |
00-110-0464 | get rapid quote | 1 | |
00-477-1100 | get rapid quote | 1 | |
00-811-0079 | research incorporated | get rapid quote | 8 |
001100196 | military specifications p | get rapid quote | 125 |
001100196 | united states p | get rapid quote | 291 |
001100310 | military specifications p | get rapid quote | 29 |
001100991 | get rapid quote | 247 | |
001100992 | military specifications p | get rapid quote | 6 |
001100993 | military specifications p | get rapid quote | 4 |
002811001 | federal specifications pr | get rapid quote | 8 |
004811000 | get rapid quote | 1 | |
00724-57-01100-001 | plastic associates inc | get rapid quote | 4 |
007245701100001 | plastic associates inc | get rapid quote | 4 |
01-100-0653 | se relays llc magnecraft | get rapid quote | 1 |
01-100-3676 | andrew california corp | get rapid quote | 15 |
01-100-4889 | ducommun | get rapid quote | 15 |
01-100-5503 | military specifications | get rapid quote | 79 |
01-100-5724 | military specifications | get rapid quote | 15 |
01-100-5812 | get rapid quote | 1 | |
01-100-8399 | get rapid quote | 10 | |
01-100-9570 | get rapid quote | 182 | |
01-100-9694 | sunair services corp. | get rapid quote | 2 |
01-100193 | simpson electric company | get rapid quote | 49 |
010110006 | amphenol | get rapid quote | 15 |
0110004001 | get rapid quote | 9 | |
01100193 | simpson electric company | get rapid quote | 49 |
011002 | get rapid quote | 2 | |
011002042 | get rapid quote | 10 | |
011004805 | american radionic co inc | get rapid quote | 3 |
011004836 | kings | get rapid quote | 12 |
011004927 | military specifications p | get rapid quote | 1 |
011005580 | military specifications p | get rapid quote | 278 |
011005585 | spectrum control inc. | get rapid quote | 2 |
011006894 | raytheon compan | get rapid quote | 2 |
011007488 | military specifications p | get rapid quote | 11 |
011007489 | military specifications p | get rapid quote | 3 |
011007758 | vishay dale electronics i | get rapid quote | 36 |
011007825 | cts corp | get rapid quote | 66 |
011007891 | get rapid quote | 4 | |
011008407 | martin marietta corp elec | get rapid quote | 4 |
011009640 | national controls corp | get rapid quote | 4 |
0131100000 | get rapid quote | 4 | |
025t1100m | lax electronics | get rapid quote | 1 |
032-0011-0001 | tyco microdot | get rapid quote | 131 |
03200110001 | tyco microdot | get rapid quote | 131 |
0491100003 | telos corporati | get rapid quote | 7 |
07c1100gr | military specifications p | get rapid quote | 21 |
0811-0007 | get rapid quote | 7 | |
08110007 | get rapid quote | 7 | |
1-1-10-03 | get rapid quote | 1 | |
10097511001 | a.e.p | get rapid quote | 118 |
1009-1511-001 | a.e.p | get rapid quote | 99 |
1009-7511-001 | a.e.p | get rapid quote | 118 |
10091511001 | a.e.p | get rapid quote | 99 |
1010-1511-003 | a.e.p | get rapid quote | 31 |
1010-1511-004 | a.e.p | get rapid quote | 112 |
10101511003 | a.e.p | get rapid quote | 31 |
10101511004 | a.e.p | get rapid quote | 112 |
1011-0001 | solitron | get rapid quote | 6 |
1011000 | get rapid quote | 12 | |
10110001 | solitron | get rapid quote | 6 |
101711001 | raytheon techni | get rapid quote | 35 |
106511-002 | get rapid quote | 17 | |
106511-003 | get rapid quote | 30 | |
106511002 | get rapid quote | 17 | |
106511003 | get rapid quote | 30 | |
11-00059-001 | general dynamics ots aero | get rapid quote | 2 |
11-0049 | get rapid quote | 3 | |
11-100025-005 | litton systems, inc. div | get rapid quote | 2 |
110-05 | san-tron | get rapid quote | 104 |
110-07502-000 | aqua-chem inc | get rapid quote | 3 |
1100 | get rapid quote | 2 | |
1100 | bussmann | get rapid quote | 40 |
1100 | lambda | get rapid quote | 3 |
1100-1-5-stpp | fnt industries inc | get rapid quote | 3 |
110000105 | get rapid quote | 2 | |
110003001 | harris corp-rf communicat | get rapid quote | 4 |
1100056 | get rapid quote | 31 | |
1100059001 | general dynamics ots aero | get rapid quote | 2 |
11001 | singer | get rapid quote | 1 |
1100102 | get rapid quote | 1 | |
11001ss | samtec | get rapid quote | 30 |
110023-001 | get rapid quote | 6 | |
11002gdra | samtec | get rapid quote | 601 |
11003h44b35 | drs power & control techn | get rapid quote | 1 |
11003h54a5 | eaton corp | get rapid quote | 1 |
110041 | drs technologies canada l | get rapid quote | 1 |
110049 | get rapid quote | 3 | |
11005 | fsc | get rapid quote | 91 |
11005 | san-tron | get rapid quote | 104 |
11006 | fsc | get rapid quote | 90 |
110063h708 | itt | get rapid quote | 10062 |
11007502000 | aqua-chem inc | get rapid quote | 3 |
11007pc49 | cooper industries inc | get rapid quote | 33 |
1100911 | gil technologies | get rapid quote | 37 |
1100f69 | ted | get rapid quote | 2 |
1100nll | ti | get rapid quote | 117 |
1100p04 | get rapid quote | 1275 |
mouser electronics product detail | pricing | availability | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
50
in stock |
||||||||||||||||||||
|
|
530
in stock |
||||||||||||||||||||
|
|
265
in stock |
||||||||||||||||||||
|
|
2,298
in stock |
||||||||||||||||||||
|
|
3,670
in stock |
||||||||||||||||||||
|
|
1,033
in stock |
||||||||||||||||||||
|
|
2,000
in stock |
||||||||||||||||||||
|
|
1,200
in stock |
||||||||||||||||||||
|
|
19,531
in stock |
||||||||||||||||||||
|
|
5
in stock |
||||||||||||||||||||
|
|
217
in stock |
||||||||||||||||||||
|
|
2,586
in stock |
||||||||||||||||||||
|
|
6,757
in stock |
||||||||||||||||||||
|
|
2,730
in stock |
||||||||||||||||||||
|
|
1,400
in stock |
||||||||||||||||||||
|
|
295
in stock |
||||||||||||||||||||
|
|
680
in stock |
||||||||||||||||||||
|
|
28
in stock |
||||||||||||||||||||
|
|
1,950
in stock |
||||||||||||||||||||
|
|
391
in stock |
||||||||||||||||||||
|
|
117
in stock |
||||||||||||||||||||
|
|
2,063
in stock |
||||||||||||||||||||
|
|
15
in stock |
||||||||||||||||||||
|
|
10
in stock |
||||||||||||||||||||
|
|
11
in stock |
||||||||||||||||||||
|
|
819
in stock |
||||||||||||||||||||
|
|
2,000
in stock |
||||||||||||||||||||
|
|
50
in stock |
||||||||||||||||||||
|
|
3,915
in stock |
||||||||||||||||||||
|
|
125
in stock |
||||||||||||||||||||
|
|
107
in stock |
||||||||||||||||||||
|
|
917
in stock |
||||||||||||||||||||
|
|
200
in stock |
||||||||||||||||||||
|
|
7
in stock |
||||||||||||||||||||
|
|
19
in stock |
||||||||||||||||||||
|
|
1,800
in stock |
||||||||||||||||||||
|
|
2,482
in stock |
||||||||||||||||||||
|
|
3,675
in stock |
||||||||||||||||||||
|
|
1,792
in stock |
||||||||||||||||||||
|
|
19
in stock |
||||||||||||||||||||
|
|
1,813
in stock |
||||||||||||||||||||
|
|
16
in stock |
||||||||||||||||||||
|
|
3,975
in stock |
||||||||||||||||||||
|
|
1,550
in stock |
||||||||||||||||||||
|
|
917
in stock |
||||||||||||||||||||
|
|
2,970
in stock |
||||||||||||||||||||
|
|
9
in stock |
||||||||||||||||||||
|
|
1,686
in stock |
||||||||||||||||||||
|
|
164
in stock |
||||||||||||||||||||
|
|
68
in stock |
||||||||||||||||||||
|
|
2,467
in stock |
||||||||||||||||||||
|
|
1,890
in stock |
||||||||||||||||||||
|
|
3,684
in stock |
||||||||||||||||||||
|
|
185
in stock |
||||||||||||||||||||
|
|
120
in stock |
||||||||||||||||||||
|
|
3,950
in stock |
||||||||||||||||||||
|
|
2,945
in stock |
||||||||||||||||||||
|
|
11,967
in stock |
||||||||||||||||||||
|
|
19
in stock |
||||||||||||||||||||
|
|
1,178
in stock |
||||||||||||||||||||
|
|
215
in stock |
||||||||||||||||||||
|
|
108
in stock |
||||||||||||||||||||
|
|
150
in stock |
||||||||||||||||||||
|
|
300
in stock |
||||||||||||||||||||
|
|
945
in stock |
||||||||||||||||||||
|
|
45
in stock |
||||||||||||||||||||
|
|
9,230
in stock |
||||||||||||||||||||
|
|
594
in stock |
||||||||||||||||||||
|
|
270
in stock |
||||||||||||||||||||
|
|
1,975
in stock |
||||||||||||||||||||
|
|
400
in stock |
||||||||||||||||||||
|
|
1
in stock |
||||||||||||||||||||
|
|
704
in stock |
||||||||||||||||||||
|
|
1,677
in stock |
||||||||||||||||||||
|
|
75
in stock |
||||||||||||||||||||
|
|
433
in stock |
||||||||||||||||||||
|
|
56
in stock |
||||||||||||||||||||
|
|
500
in stock |
||||||||||||||||||||
|
|
2,354
in stock |
||||||||||||||||||||
|
|
1,232
in stock |
||||||||||||||||||||
|
|
382
in stock |
||||||||||||||||||||
|
|
109
in stock |
||||||||||||||||||||
|
|
109
in stock |
||||||||||||||||||||
|
|
3,815
in stock |
||||||||||||||||||||
|
|
630
in stock |
||||||||||||||||||||
|
|
2,890
in stock |
||||||||||||||||||||
|
|
2
in stock |
||||||||||||||||||||
|
|
150
in stock |
||||||||||||||||||||
|
|
4,456
in stock |
||||||||||||||||||||
|
|
499
in stock |
||||||||||||||||||||
|
|
1,010
in stock |
||||||||||||||||||||
|
|
810
in stock |
||||||||||||||||||||
|
|
163
in stock |
||||||||||||||||||||
|
|
519
in stock |
||||||||||||||||||||
|
|
276
in stock |
||||||||||||||||||||
|
|
1,788
in stock |
||||||||||||||||||||
|
|
994
in stock |
||||||||||||||||||||
|
|
81
in stock |
||||||||||||||||||||
|
|
3,176
in stock |
||||||||||||||||||||
|
|
1,000
in stock |